given 8y — 6x =8 :

A) transform the equation into slope-intercept form.

b) find the slope and y-intercept of the line.

c) what is the slope of a line parallel to this line?

d) what is the slope of a line perpendicular to this line ?

e) find the equation, in point-slope form, of the line that is perpendicular to this line and passes through the point (0,2).

Answers

Answer 1

Answer:

Step-by-step explanation:

A:  slope-intercept form:  Solve 8y — 6x =8 for y, as follows:  8y = 6x + 8, so that y = (3/4)x + 1.

B:  Slope:  3/4; y-intercept:  (0, 1)

C:  Any line parallel to this line has the same slope, namely, 3/4.

D:  Any line perpendicular to this line has a slope that is the negative reciprocal of 3/4; that is, the slope of the perp. line is -4/3.


Related Questions

What is the value of x in the graph below? PLEASE SHOW WORK

Answers

Answer:

Your answer is B.

Step-by-step explanation:

4 x 2 = 8

I know this because 12 / 6 = 2.

Therefore, Sense it is divided by two, you multiply the 4 by 2.

The points (4, 1) and (x, -6) lie on the same line. If the slope of the line is 1, what is the value of x?


A. x=-3

B. x=3

C. x=9

D. x=11
(Could you also show it step by step please?)

Answers

Answer:

A

Step-by-step explanation:

Calculate the slope m using the slope formula

m = ( y₂ - y₁ ) / ( x₂ - x₁ )

with (x₁, y₁ ) = (4, 1) and (x₂, y₂ ) = (x, - 6)

m = [tex]\frac{-6-1}{x-4}[/tex] = 1

m = [tex]\frac{-7}{x-4}[/tex] = 1 ( cross- multiply )

x - 4 = - 7 ( add 4 to both sides )

x = - 3 → A

The value of 'x' is -3 and this can be determined by using the two point slope formula and also by using the given data.

Given :

The points (4, 1) and (x, -6) lie on the same line.The slope of the line is 1.

When two points are given then to determine the slope of the given line below formula can be used:

[tex]\rm m = \dfrac{y_2-y_1}{x_2-x_1}[/tex]

where [tex](x_1,y_1)[/tex] and [tex](x_2,y_2)[/tex] are the points on the same line.

Now, substitute the value of slope m and points [tex](x_1,y_1)[/tex] and [tex](x_2,y_2)[/tex] in the above equation in order to determine the value of 'x'.

[tex]\rm 1 = \dfrac{-6-1}{x-4}[/tex]

x - 4 = -7

x = -3

So, the value of x is -3.

For more information, refer to the link given below:

https://brainly.com/question/18666670

What is the scale factor of the dilation?
1/3
2/3
3/2 3/1

Answers

The scale factor is 1/3

The correct answer is 1/3

:))

The scale factor of the given dilation is 1/3

What is scale factor ?

To change the size of a figure without changing the figure's shape, we use a exact number or factor which is called scale factor.

Dilated figure = Original figure × Scale factor

What is the required scale factor ?

In the diagram,

Co-ordinate of the point V in original triangle is (3, - 6)

Co-ordinate of the point V' in dilated triangle is (1, -2)

We know that, if we multiply scale factor to the original co-ordinate then we get dilated co-ordinate.

Here, if we multiply 1/3 to the original co-ordinate V(3, - 6) then we get the dilated co-ordinate V' (3/3, -6/3) , i.e. V'(1, -2)

So, the scale factor is 1/3.

Learn more about scale factor here :

https://brainly.com/question/1903243

#SPJ2

With increased concentration, temperature, and pressure, there is also an increased chance that a chemical reaction will occur. What do all these factors have in common?

Answers

Answer:

A chemical reaction will occur

Hope this helps

Love,

Morgan Malice

Answer: increased particle collisions

Step-by-step explanation: Is the correct answer on Edge

Simplify 5 – 2x – 3 + x.

Answers

Hey there!

All we have to do is combine like terms. Therefore, your final answer would be 2 - x

Hope this helps you!

God bless ❤️

xXxGolferGirlxXx

The expression 5 - 2x - 3 + x simplifies by combining like terms: constants 5 - 3 = 2 and variable terms -2x + x = -x, resulting in 2 - x.

To simplify the expression 5 \'u2013 2x \'u2013 3 + x, we combine like terms. The like terms in this case are constant numbers and the terms with the variable x.

First, combine the constants 5 and -3:

5 - 3 = 2

Next, combine the variable terms -2x and +x:

-2x + x = -x

Therefore, the simplified expression is:

2 - x

Emilie draws a circle with a diameter of 10 inches.Ethan draws a circle with a diameter that is half as long as the diameter of Emilie's circle.How will the circumference of Ethan's circle compare with the circumference of Emilie's circle?Explain.​

Answers

Answer:

The circumference of Ethan's circle is half the circumference of Emilie's circle

Step-by-step explanation:

we know that

Emilie's circle

[tex]D=10\ in[/tex]

The circumference is equal to

[tex]C=\pi D[/tex]

[tex]C=\pi (10)[/tex]

[tex]C=10\pi\ in[/tex]

Ethan's circle

[tex]D=10/2=5\ in[/tex]

The circumference is equal to

[tex]C=\pi D[/tex]

[tex]C=\pi (5)[/tex]

[tex]C=5\pi\ in[/tex]

therefore

The circumference of Ethan's circle is half the circumference of Emilie's circle

Answer: The circumference of Ethan's circle is half the circumference of Emilie's circle

Step-by-step explanation:

Square root of 2y+3=11 what’s the value of y in this equation

Answers

Answer:

y = 32

Step-by-step explanation:

For the given expression √(2y+3) =11, the value of y in this equation is 59.

The given expression is,

√(2y+3) =11

Take square both sides of the equation to eliminate the square root.

This gives us:

(√(2y+3))² = 11²

Simplifying the left side, we have:

2y + 3 = 121

Next, Subtract 3 from both sides to isolate the 2y term:

2y + 3 - 3 = 121 - 3

2y = 118

Finally, Divide both sides by 2 to solve for y:

y = 59

Therefore, the value of y in this equation is 59.

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ2

Evaluate the equation. -8x = -90

Answers

Answer:

[tex]\large\boxed{x=\dfrac{45}{4}=11\dfrac{1}{4}}[/tex]

Step-by-step explanation:

[tex]-8x=-90\qquad\text{divide both sides by (-8)}\\\\\dfrac{-8x}{-8}=\dfrac{-90}{-8}\\\\x=\dfrac{90}{8}\\\\x=\dfrac{90:2}{8:2}\\\\x=\dfrac{45}{4}\to x=11\dfrac{1}{4}[/tex]

Which of the following would be the best example of parallel lines in the real world?
O A. The lines formed on a windowpane
O B. A four-way stop at an intersection
O C. The northbound and southbound lanes on a straight highway
O D. A bridge extending over a river

Answers

C

Because their on a straight highway and the lines go up and down (north and south) and parallel lines is a set of straight lines

Final answer:

The northbound and southbound lanes on a straight highway are the best example of parallel lines, as they never intersect and stay equidistant from each other, fulfilling the criteria for parallelism in geometry which is the option c.

Explanation:

The best example of parallel lines in the real world would be C. The northbound and southbound lanes on a straight highway. In mathematics, parallel lines are two lines in the same plane that do not meet; they stay the same distance apart over their entire length. When we look at the northbound and southbound lanes on a straight highway, they are designed to be straight and run alongside each other without crossing, making them a practical example of parallel lines.

It is important to understand that parallel lines have several key features. They are always the same distance apart (equidistant), and they never intersect or cross each other. This principle is seen in the highway lanes, which must stay separate to facilitate traffic in opposite directions.

To contrast, other options like A. The lines formed on a windowpane may not necessarily be parallel, B. A four-way stop at an intersection involves intersecting lines, and D. A bridge extending over a river can be a single line or may curve, which does not fit the definition of parallel lines.

La altura de un trapecio isósceles es de 4 cm, la suma de las medidas de las bases es de 14 cm y los lados oblicuos miden 5 cm. Averigua las medidas de las bases del trapecio.

Por favor, necesito ayuda.

Answers

Teorema de Pitagoras a^2 + b^2 = c^2
4^2 + b^2 = 5^2
16 + b^2 = 25
- 16. -16
b^2 =. 9
b = 3

Si el fondo base mide mas que el superior base, miden 14 (fondo) y 14 - 3 (izquierda) -3 (derecho) = 8

write an example of constant polynomial​

Answers

Answer:

One example of constant polynomial is q(x) = 7.

Step-by-step explanation:

A constant polynomial is the same thing as a constant function. That is, a

constant polynomial is a function of the form

p(x) = c

In other words a polynomial P(x) that, when evaluated over each x in the domain of definition, results in the same value. The simplest example is P(x)=c for x in R and c a constant.

I need help with this question

Answers

Answer:

294.6 earth years

Step-by-step explanation:

You only need to multiplied by 10

Best regards

Answer:

C

Step-by-step explanation:

multply by 10

nnnnnnnnnnnnnnnnn



3x -4 = 2

Answers

Answer:

2

Step-by-step explanation:

[tex]\bold{Hey\ there!} \\ \\ \bold{3x-4=2}\\ \bold{First:add\ by\ 4\ to\ your\ sides!}\\ \bold{Like\downarrow}\\ \bold{3-4+4=2+4}\\ \bold{Cancel:-4+4\ because\ it\ = \ 0}\\ \bold{Keep:2+4\ because\ it\ helps\ us\ solve\ for\ our\ answer} \\ \bold{2+4=6} \\ \bold{3x=6} \\ \bold{Second: divide\ by\ 3\ on\ your\ sides!} \\ \bold{Like\downarrow} \\ \bold{\frac{3x}{3}=\frac{6}{3}} \\ \bold{Cancel:\frac{3x}{3}\ because\ it\ gives\ us\ 1} \\ \bold{Keep:\frac{6}{3}\ because\ it\ gives\ us\ the\ answer\ for\ 'x'}[/tex]

[tex]\boxed{\boxed{\bold{Answer:x=2}}}\checkmark\\ \\ \bold{Good\ luck\ on\ your\ assignment\ \& \ enjoy\ your\ day!} \\ \\ \\ \frak{LoveYourselfFirst:)}[/tex]

Please need help on this

Answers

Answer:

284.37

Step-by-step explanation:

If you use the pythagorean theory, it's so much easier

The distance of the earth's horizon from point p is 284.372 miles.

Pythagoras Theorem

In a right-angled triangle,  the square of the hypotenuse side is equal to the sum of squares of the other two sides [tex]Hypotenuse^{2} = Perpendicular^{2} + Base^{2}[/tex]

How to find the distance between earth and point p?

Here also we have a right angle triangle so to find the remaining side we use Pythagoras Theorem.

[tex]3959^{2} + x^{2} =(3959+10.2)^{2}[/tex]

[tex]3959^{2} + x^{2} = (3969.2)^{2}[/tex]

[tex]x^{2} = 80867.64[/tex]

x = 284.372 miles

Thus the distance of the earth's horizon from point p is 284.372 miles.

Learn more about Pythagoras Theorem here: https://brainly.com/question/231802

#SPJ2

Please Help!!!!

x 2 - 5x - 14

Answers

Answer:

(x-7)(x+2); x = -2, 7

Step-by-step explanation:

Solve the equation by factoring and setting each factor equal to 0.

The expression x² - 5x - 14 factors into two numbers which multiply to -14 and add to -5. These numbers are -7 and 2. The factors are (x-7)(x+2). Set each equal to 0 and solve.

x-7 = 0

x = 7

x+2 = 0

x = -2

Given: m∠AOB = 35°, m∠BOC = 50°. Find: m∠FOD.

Answers

Answer:

∠FOD = 85°

Step-by-step explanation:

∠AOC = ∠AOB + ∠BOC = 35° + 50° = 85°

∠AOC and ∠FOD are opposite angles and congruent, hence

∠FOD = 85°

julian currently has a balance of -$10.48 in his checking account. His bank requires him to maintain minimum balance of $20.

Answers

He should put in $30.48 to reach the minimum.

Hope this helps.

You buy a total of 25 sweatshirts and hats for $172.50ypu pay $8.00 per sweatshirt and $2.50 per hat how many items do you buy

Answers

Answer:

im not sure but you can find the answer on  math solver with steps

Step-by-step explanation:

Humans shed about three million particles of skin every five hours. Humans can shed about fifty thousand particles of skin every five minutes. The approximate number of particles of skin a human can shed in five hours can be written in the form a × 10b, where a is 3 and b is____. The approximate number of particles of skin a human can shed in five minutes can be written in the form a × 10b, where a is 5 and b is ____. Humans shed approximately ____ times more particles of skin in five hours than in five minutes.

Answers

Answer:

for 5 hours: b is 6

for 5 minutes: b is 4

60 times more skin in 5 hours than 5 minutes

Step-by-step explanation:

I think it should be written as a x 10^b, so I'm going to answer it that way.  

3 x 10^6 = 5 times 10^6

   10^6 = 1,000,000, so we have 3 x 1,000,000 = 3,000, 000

5 x 10^4 = 5 times 10^4

   10^4 = 10,000, so we have 5 x 10,000 = 50, 000

For part 3, divide 3 million by 50 thousand to find the scalar multiple

   3,000,000/50,000 = 300/5 = 60

Answer:

The approximate number of particles of skin a human can shed in five hours can be written in the form a × 10b, where a is 3 and b is 6.

The approximate number of particles of skin a human can shed in five minutes can be written in the form a × 10b, where a is 5 and b is 4.

Humans shed approximately 60 times more particles of skin in five hours than in five minutes.

Step-by-step explanation:

In scientific notation, a number can be written in the form, a × 10b, where a is a number that must be greater than or equal to 1, but less than 10, and b is any integer.

First, write the approximate number of particles of skin a human can shed in five hours in scientific notation. This number is three million which can be written in the form a × 10b, where a is 3 and b is 6.

Next, write the approximate number of particles of skin a human can shed in five minutes in scientific notation. This number is fifty thousand which can be written in the form a × 10b, where a is 5 and b is 4.

Then, divide the approximate number of particles a human can shed in five hours by the approximate number of particles a human can shed in five minutes to find out how many times more skin is shed in five hours than in 5 minutes.

Therefore, humans shed approximately 60 times more particles of skin in five hours than in five minutes.

Have a good day.

What would be the sum of the lengths of the first and second diagonals rounded to the nearest whole number?

Answers

Answer:

16.17684994

Step-by-step explanation:

First diagonal

x^2 = a^2 + b^2

x^2 = 5^2 + 6^2

x^2 = 61

x ≈ 7.810249676

Second diagonal

x^2 = a^2 + b^2

x^2 = 7.810249676^2 + 3^2

x^2 = 70

x ≈ 8.366600265

Sum of both diagonals

8.366600265 + 7.810249676

= 16.17684994

Answer:

16

Step-by-step explanation:

i just know

If 2/5 x h = 3, what is H

Answers

Answer:

h = 7 1/2

Step-by-step explanation:

2/5 h = 3

Multiply each side by 5/2 to isolate h

5/2 * 2/5 h = 5/2 *3

h = 15/2

h = 7 1/2

Help me with this please

Answers

Answer:

Look for where both functions have the same y value. For example, when x = 3 in #7, both are 5. So the solution is (3,5).

Step-by-step explanation:

Each table has two functions. This forms a system of equations. A system of equations is essentially two conditions that must both be met to produce a solution. A solution can be found as where the two equations are equal. In the table, look for where both functions have the same y value for some x. This will be where the values are the same in the same row. This is the solution and is written as an (x,y) point.

7. When x = 3 both functions are 5. The solution is (3,5).

What is the area of medium pizza with 10 inches

Answers

Answer:

A: 25[tex]\pi[/tex]

Step-by-step explanation:

The area for a circle is:

A = [PI*d^2] / 4

Then

A = (25/2)*[tex]\pi[/tex]

Best regards

I need this one done too! Really need help, big brain fart.

Answers

6x2+1<

6x2<-1

=×2<=-1/6 B is the answer

Answer:

6x2+1<

6x2<-1

=×2<=-1/6

Step-by-step explanation:

B is the answer

If p x 5/6 = 4, what is p​

Answers

♫ - - - - - - - - - - - - - - - ~Hello There!~ - - - - - - - - - - - - - - - ♫

➷P*5/6=4

First, you need to multiply each side by 6/5 to get ride of the 5/6:

p=24/5

Final answer:

p=24/5

➶ Hope This Helps You!

➶ Good Luck (:

➶ Have A Great Day ^-^

TROLLER

Is the following shape a rectangle? How do you know?

Answers

Answer:

The correct answer is A.

Step-by-step explanation:

You can see that it's not a rectangle because the aides that are adjacent to are not perpendicular.

Answer:

D

Step-by-step explanation:

:D

The diagram below shows a square inside a regular octagon. The apothem of the octagon is 13.28 units. To the nearest square unit, what is the area of the shaded region?

Answers

463 square units. ok

Answer:

The correct option is:  A.  463 square units.

Step-by-step explanation:

According to the given diagram, the side length of the regular octagon is 11 units.

So, the perimeter[tex](p)[/tex] of the octagon [tex]=(11\times 8)units= 88\ units[/tex]

The apothem[tex](a)[/tex] of the octagon is 13.28 units.

So, the area of the octagon:  [tex]A=\frac{1}{2}pa=\frac{1}{2}(88)(13.28)=584.32\ units^2[/tex]

Now, the side length of the inside square is 11 units. So, the area of the square  [tex]=(11)^2 =121\ units^2[/tex]

Thus, the area of the shaded region [tex]=(584.32-121)units^2=463.32\ units^2 \approx 463\ units^2[/tex]

on an airplane, there are two seats on the left side in each row and three seats on the right side. There are 57 seats on the right side of the plane how many seats are on the left side of the plane?

Answers

Answer:

Answer: 38 Seats

Step-by-step explanation:

I don't know how to do this, help please.

Answers

Answer:

1000 units wide, 300 units is the height

Step-by-step explan

you do 500-(-500) for the wideness, 1000 and for height, 0-(-300) is 300

please help with explanation​

Answers

Answer:

m = 1/3

Step-by-step explanation:

The equation of a straight line is given by the equation of the form;

y = mx+c

The slope of the line is simply the coefficient of x in the equation, m in this case. The given equation can be re-written as;

y = 1/3 x + 4

The coefficient of x is 1/3 which is also the slope.

Other Questions
The experimental probability of spinning a number greater than 3 is What does the quote the only way to get through a bigots door is to break it mean susan gets sick often and misses school as a result? which habit should she adopt? Coffee shops that reward customers with one free cup of coffee after every ten coffee purchases are using a ___________ reinforcement schedule. What company was credited with developing the first smartphone? the product of-5 and a number is greater than 35 or less than 10 Please help!!! Will mark brainliest!!! how is health care a problem in today's society 5 50/100 - 2 72/100= What is Hrxn for the following chemical reaction? CS2(g)+2H2O(l)CO2(g)+2H2S(g) You can use the following table of standard heats of formation (Hf) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218 N(g) 473 H2(g) 0 O2(g) 0 H2O(l) 285.8 O(g) 249 CS2(g) 116.7 H2S(g) 20.60kJ C(g) 71 CO2(g) 393.5kJ C(s) 0 HNO3(aq) 206.6 Express the standard enthalpy of reaction to three significant figures and include the appropriate units. View Available Hint(s) Why are publicly traded corporations required to release financial reports on a regular basis?A. because shareholders are entitled to transparencyB. so the government can determine the corporate taxes owedC. so owners know when it is time to hire a new board of directorsD. because it would be impossible to raise financial capital otherwise Find the slope of the line. 5x 2y = 7 which of the following groups is most likely to be dealing with eating disorders teenage girls pregnant women those who abuse alcohol young men in their 20s If you want to lift a 30-kg box to the height of 1 m how much work will it take How is the conflict in Black Cowboy, Wild Horses resolved? The base of a regular pyramid is a hexagon.What is the area of the base of the pyramid?Express your answer in radical form. How is editing for a broadcast different from editing for print journalism? Please and Thank you:) Julio is lifting weights. He wants to have 210 pounds on the bar. How many 15-pound weights should he put on the bar? what is the decimal form of 63/100 How many times smaller is the volume of a triangular prism if the height is divided by 4? Steam Workshop Downloader