1-sin^2x/sinx-cscx

How do I solve this problem? I keep getting the wrong answer.

1-sin^2x/sinx-cscx How Do I Solve This Problem? I Keep Getting The Wrong Answer.

Answers

Answer 1

Answer:

-sinx

Step-by-step explanation:

a trig identity that is crucial to solving this problem is: sin^2 + cos^2 = 1

with knowing that, you can manipulate that and turn it into 1 - sin^2x = cos^x

so 1-sin^2x/sinx - cscx becomes cos^2x/sinx - cscx

it is also important to know that cscx is the same thing as 1/sinx

knowing this information, cscx can be replaced with 1/sinx

(cos^2x)/(sinx - 1/sinx)

now sinx and 1/sinx do not have the same denominator, so we need to multiply top and bottom of sinx by sinx; it becomes....

cos^2x

---------------------

(sin^2x - 1)/sinx

notice how in the denominator it has sin^2x-1 which is equal to -cos^2x

so now it becomes:

cos^2x

--------------

-cos^2x/sinx

because we have a fraction over a fraction, we need to flip it

cos^2x          sinx

---------- * ----------------

1                  -  cos^2x

because the cos^2x can cancel out, it becomes 1

now the answer is -sinx


Related Questions

A tetrahedron is a triangular pyramid whose four faces are identical equilateral triangles. The total lateral surface area is 93 square centimeters. Find the surface area of the tetrahedron. Answer quick plz!!

Answers

Answer:

SA = 124 cm²

Step-by-step explanation:

The lateral surface area is the area of all sides besides that base, so 93 cm² is the sum of 3 sides of the tetrahedron.  

93/3 = 31 cm² per side, there are 4 sides, so 31(4) = 123 cm² is the total surface area

The surface area of the tetrahedron is 124 square centimeters.

Let's denote the surface area of one equilateral triangle as A The total surface area of the tetrahedron, which includes all four faces, is then  4A.

 Given that the lateral surface area (which is three faces) is 93 square centimeters, we can write:

 3A = 93

To find the area of one face (A), we divide both sides by 3:

[tex]\[ A = \frac{93}{3} = 31 \][/tex]

Now, to find the total surface area of the tetrahedron, we multiply the area of one face by 4:

[tex]\[ \text{Total Surface Area} = 4A = 4 \times 31 = 124 \][/tex]

Therefore, the surface area of the tetrahedron is 124 square centimeters.

3) This is a writer's opinion or way of seeing an issue.

Answers

Answer:

the word is viewpoint

Step-by-step explanation:

Answer:

Viewpoint.

Step-by-step explanation:

Viewpoint refers to a particular and individual way to see the world. It's the personal perspective in a specific context, it's people's point of view. For example, in a situation like an accident between a motorcycle and a bus, some people would say that the fault is no the bus drives, other would say that it's on the motorcycle driver, but at the end, those just are different viewpoint.

In this case, a writer's opinion or way of seeing an issue, it's referring to a point of view, or viewpoint, because involves an individual opinion about something.

if g(x)=4x^2-16 were shifted 7 units to the right and 3 down, what would the new equation be?

Answers

ANSWER

[tex]f(x) = 4 {(x - 7)}^{2} - 19[/tex]

EXPLANATION

The given equation is

[tex]g(x) = 4 {x}^{2} - 16[/tex]

If the equation is shifted 7 units to the right and 3 units down, then the new equation becomes.

[tex]f(x) = g(x - 7) - 3[/tex]

This implies that,

[tex]f(x) = 4 {(x - 7)}^{2} - 16 - 3[/tex]

The required equation is

[tex]f(x) = 4 {(x - 7)}^{2} - 19[/tex]

on which number line are negative 3 and it's opposite shown​ flvs flex

Answers

Answer:

the first one

Step-by-step explanation:

How would the expression x^2-9 be written using difference of swuares

Answers

(x+3)(x-3)

x squared and -9 are both square numbers.

the square root of x^2 is x

the square root of -9 is 3. so you just need to write (x+3)(x-3)

you can check by expanding the brackets and the middle x terms should cancel out

Answer:

(x-3)(x+3)

Step-by-step explanation:

Here we have to represent our algebraic expression as difference of square.

In order to do so we have use the formula given under.

[tex](x^2-a^2)=(x-a)(x+a)[/tex]

Hence first we have to guess the square root of the 9 , which is 3 and represent our numeric term in our expression as square of it.

Hence

[tex](x^2-9)\\= (x^2-3^2)[/tex]

Now we apply the formula

[tex](x^2-3^2)=(x-3)(x+3)[/tex]

Hence the above expression is our answer.

Plz help! Giving away more points than usual!!! Thxs :) (btw the rate of change isn't 8 nor 29, I tried them both like 500 times)

Answers

Answer:

rate change: -8

Equation: y = 232 -8x

After 5 hours: 192

Step-by-step explanation:

8 are destroyed every hour, so there are 8 less every hour, so the rate of change is -8

It starts with 232 and loses 8 per hour, so the formula is

y = 232 - 8x

After 5 hours:

y = 232 - 8(5)

    y = 232 - 40

         y = 192

Answer:

Step-by-step explanation:

The rate of change in this case is -8, since the amount is decreasing.

The equation is:

y=232-8x.

After 5 hours, he will have 192 rews.

Length of a rectangle is 5 cm longer than the width. Four squares are constructed outside the rectangle such that each of the squares share one side with the rectangle. The total area of the constructed figure is 120 cm2. What is the perimeter of the rectangle?

Answers

Answer:

The perimeter of rectangle is [tex]18\ cm[/tex]

Step-by-step explanation:

Let

x-----> the length of the rectangle

y----> the width of the rectangle

we know that

[tex]x=y+5[/tex] ----> equation A

[tex]120=xy+2x^{2}+2y^{2}[/tex] ---> equation B (area of the constructed figure)

substitute the equation A in equation B

[tex]120=(y+5)y+2(y+5)^{2}+2y^{2}\\ 120=(y+5)y+2(y+5)^{2}+2y^{2}\\ 120=y^{2}+5y+2(y^{2}+10y+25)+2y^{2}\\ 120=y^{2}+5y+2y^{2}+20y+50+2y^{2}\\120=5y^{2}+25y+50\\5y^{2}+25y-70=0[/tex]

using a graphing calculator -----> solve the quadratic equation

The solution is

[tex]y=2\ cm[/tex]

Find the value of x

[tex]x=y+5 ----> x=2+5=7\ cm[/tex]

Find the perimeter of rectangle

[tex]P=2(x+y)=2(7+2)=18\ cm[/tex]

Answer:

Perimeter of rectangle = 38 cm

Step-by-step explanation:

It is given that, Length of a rectangle is 5 cm longer than the width.

Let 'x' be the width then length = x + 5

Area of of rectangle = x(x + 5)

One side of square = ( x+ 5)/4

Area of all squares = [(x +5)/4]² * 4 = (x + 5)²/4

To find the value of x

Total area = 120 cm²

Area of of rectangle + Area of all squares  = 120

x(x + 5) + (x + 5)²/4 = 120

x² + 5x + (x² + 10x + 25)/4 = 120

4x² + 20x + x² + 10x + 25 = 120 * 4

x² + 6x + 5  = 24 * 4

x² + 6x - 96 =0

x = 7

To find the perimeter of rectangle

width = x = 7

Length = x + 5 = 7 + 5 = 12

Perimeter = 2(length + width) = 2(7 + 12) = 38 cm

Find the value of x, rounded to the nearest tenth.
Answer options: 4.2, 3.7, 4.4, 8.9

Answers

Answer:

= 8.9 units

Step-by-step explanation:

When a chord intersects with a tangent outside a circle then we use the relationship;

X ² = AO × BO, Where A and are the points of intersection of the chord an the circle, while O is the point of intersection between the chord and the tangent.

Therefore;

x² = 4 × 20 or 8 × 10

x² = 80

x = √80

= 8.944

 ≈ 8.9

Answer: 8.9

Step-by-step explanation:

x² = 4 × 20 or 8 × 10

x² = 80

x = √80

= 8.944

≈ 8.9

help me with this question pls!?

Answers

Your answer is A) 1/2 inch per foot

Multiply the given info by 2 to get the answer.

Please mark brainliest if this helps you! :)

So I am doing this school assignment and it's due tomorrow.... PLEASE HELP MEEEE

Answers

Answer:

im pretty sure its the second one to the right

Answer:

|7| + |-2| | +|5| + |-8|=

Step-by-step explanation:

We want to find the total number of spaces traveled, it doesn't matter whether they are forward or backward.

We moved 7 spaces right then 2 spaces left then 5 spaces right then 8 spaces left.  The total spaces are just the number of spaces, not whether they were left or right so we take the absolute value

|7| + |-2|  +|5| + |-8|=

help plz plz plz i need help, not good at math

Answers

♫ - - - - - - - - - - - - - - - ~Hello There!~ - - - - - - - - - - - - - - - ♫

➷The answer is: the corresponding angles are both the same.

Explanation: The angles B and F are the same. The same goes for A and E, D and H, and C and G. So the conclusion is that the corresponding angles have both the same measure, or are both congruent.

➶ Hope This Helps You!

➶ Good Luck (:

➶ Have A Great Day ^-^

DOGE

A school has an art club, a drama club, and a cooking club. The ratio of the number of students in these clubs is given.

Art club to drama club: 7 to 13
Cooking club to art club: 5 to 14
There are 130 students in the drama club. No students are in more than one club.

How many students are in the cooking club?

Answers

Answer:

25 students in the cooking club

Step-by-step explanation:

Let

x-----> the number of students in art club

y-----> the number of students in drama club

z-----> the number of students in cooking club

step 1

Substitute the value of y in equation A and solve for x

step 2

substitute the value of x in equation B and solve for z

Which statement is true about the distribution?

Answers

Answer:

The answer is C

Step-by-step explanation:

Answer:The answer is actually A

Step-by-step explanation:

Suden wants to know the theoretical and experimental probability of rolling a number smaller than a 3 on a 6-sided number cube numbered 1 to 6. He rolls the number cube 8 times and records the results in this table.

4 2 5 3
5 6 1 4

Drag and drop the answers in the boxes to correctly complete the sentences comparing theoretical probability and experimental probability.

Actually happened
we expect to happen
1/3
1/4
1/6

The theoretical probability of rolling a number smaller than a 3 is _______because this is what_______ . The experimental probability of rolling a number smaller than a 3 is ______ because this is what_______ .

Answers

Answer:

The theoretical probability of rolling a number smaller than a 3 is __1/3_____because this is what__we expect to happen____ . The experimental probability of rolling a number smaller than a 3 is __1/4____ because this is what___actually happened____

Step-by-step explanation:

The experimental probability is

P (<3) = (  getting a one or 2)/ number of times that he rolled

        He rolled a one or a two 2 times of the 8 times rolled

          = 2/8 = 1/4

Theoretical probability is what we expect  happen

P (<3) = (getting a one or two) / 6

         = 2/6 = 1/3

The theoretical probability of rolling a number smaller than a 3 is __1/3_____because this is what__we expect to happen____ . The experimental probability of rolling a number smaller than a 3 is __1/4____ because this is what___actually happened____

Erin goes to a stamp fair once a month to buy new stamps for her collection. The equation y = 115 + 10x represents the number of stamps in Erin's collection when she has been to the stamp fair x number of times. How many stamps are in her collection after 7 trips to the fair?

Answers

Answer:

Step-by-step explanation:

115+10x = y

After 7 trips to the fair, Erin has 185 stamps in her collection according to to the equation y = 115 + 10x.

To find out how many stamps Erin has after 7 trips to to the fair, we can use the given equation:

[tex]\[ y = 115 + 10x \][/tex]

where:

- [tex]\( y \)[/tex] represents the number of stamps in Erin's collection.

- [tex]\( x \)[/tex] represents the number of times Erin has been to to the stamp fair.

Substituting [tex]\( x = 7 \)[/tex] into the equation, we get:

[tex]\[ y = 115 + 10(7) \][/tex]

[tex]\[ y = 115 + 70 \][/tex]

[tex]\[ y = 185 \][/tex]

So, after 7 trips to the fair, Erin has [tex]\( 185 \)[/tex] stamps in her collection.

The Klein family is taken a weekend trip to their grandparents who live 134 miles away. Mr. Klein always drives at a
steady rate of 60 miles per hour. After 42 minutes into the trip, the kids want to know how many more miles until they get
there. Find the number of miles left to travel.

Answers

Answer:

92 more miles

Step-by-step explanation:

60 mph is 1 mile per min so in 42 min they traveled 42 miles and 134 miles minus 42 miles is 92 miles

If 12 pens cost 3.48 how much do 20 cost

Answers

Step-by-step explanation:

12/3.48= cost of 1 book

cost of 20 books = 12/3.48×20 =68.95

To find the cost of 20 pens when 12 pens cost $3.48, divide $3.48 by 12 to get the cost per pen and then multiply by 20. The cost for 20 pens would be $5.80.

To calculate the cost of 20 pens when 12 pens cost $3.48, first, we need to find the cost of one pen. We do this by dividing the total cost of 12 pens by the number of pens:

$3.48 / 12 pens = $0.29 per pen.

Now that we know the cost of one pen, we can calculate the cost of 20 pens by multiplying the cost per pen by 20:

$0.29 / pen x 20 pens = $5.80.

So, 20 pens would cost $5.80.

What is the solution to the equation 1 over 24 multiplied by x is equal to 1 over 6?

x = 144
x = 30
x = 18
x = 4

Answers

x=4

Multiply the reciprocal of 1/24, which is 24, on both sides. You will result in getting x=24/6, or 4

x=4

Answer:

x=4

Step-by-step explanation:

24 divided by 6 = 4

or 6 x 4 = 24

I WILL AWARD BRAINLIEST!! PLEASE HELP!!

The number a is smaller than the number B by 1/5 of b . By what part of a is b bigger than a?

Answers

Answer:

Bigger by ¼ of a.

Step-by-step explanation:

Let b be represented by all five slices of the pie, and a by the four yellow slices.

Then a is ⅘ of the pie and it is ⅕ smaller than b.

Now, let's turn the argument around.

The four yellow slices represent a, and all 5 slices represent b.

b is greater than a by one slice compared to four.

In mathematical terms, b is bigger by ¼ of a.

please help NOW!!!! 20 Points!

how is this number expressed in decimal notation? 2 x 10-5

Answers

1.5 × 10 to the 1 st power

Answer:

0.00002

2*10^-5 = 2*00001 = 0.00002

A right triangle ABC with height AB labeled 3 units and base BC labeled 5 units is shown. The area of the triangle above will equal one half of a rectangle that is 5 units long and units wide.

Answers

Answer:

Step-by-step explanation:

Answer:

w=3

Step-by-step explanation:

The area of the triangle is given by

A = 1/2 bh

the base is 5 and the height is 3

A = 1/2 (3) * 5 = 15/2  units ^2

The area of a rectangle is

A = l*w

A = 5w

The area of the triangle = 1/2 the area of the rectangle

15/2 = 1/2 *5w

15/2 = 5/2 w

Multiply each side by 2/5 to isolate w

2/5 * 15/2 = 2/5 *5/2 w

3 =w

Read more on Brainly.com - https://brainly.com/question/11938580#readmore

Final answer:

The area of the triangle is 7.5 units and the width of the rectangle is 3 units.

Explanation:

The area of a triangle can be calculated using the formula A = (base * height) / 2. In this case, the base of the triangle is given as 5 units and the height is given as 3 units.

So, the area of the triangle is A = (5 * 3) / 2 = 15 / 2 = 7.5 units.

The area of the rectangle is given as 5 units long and units wide. Since the area of the triangle is equal to half of the area of the rectangle, we can set up the equation 7.5 = (5 * width) / 2 and solve for the width.

By multiplying both sides of the equation by 2 and then dividing by 5, we get width = (7.5 * 2) / 5 = 15 / 5 = 3 units. Therefore, the width of the rectangle is 3 units.


David invested $220 in a savings account that offers a 3% return on the investment. The value of
____ years David's investment will be at least $400 after a period of years.
Hint: Use the formula A = P(1 + r)t, where A is the amount after t years, P is the amount invested, r is the rate of interest, and t is the time period. Use a calculator to compute the answer, and round it off to the nearest year.



Answers

Answer:

20 years

Step-by-step explanation:

Using the formula; A = P(1 + r)^t

We can plug in the known to find t

400 = 220(1.03)^t

then solve for t;

1.818 = 1.03^t

Introducing In

In 1.818 = t × In (1.03)

t = 20.225  

t = 20 years to the nearest year

Answer:

20 years

Step-by-step explanation:

Plato

Solve 5/8 x - 2/3 y = -3 3/4 x + 1/2 y = -4

Answers

Answer:

I am not sure that this is a solvable equation.

What are the zeros of f(x)=2x^3+3x^2-9x?

Answers

Answer:

x = -3, x= 0, and x = 1.5

Step-by-step explanation:

The zeros of a function f(x) refers to the x-values for which f(x) = 0.

We simply graph the function and determine the points where the graph crosses the x-axis. Thus, we shall be solving the problem graphically;

From the attachment below, the graph of f(x) crosses the x-axis at;

x = -3, x= 0, and x = 1.5

which pair of expressions is equivalent to each other?​

Answers

Answer:

C

Step-by-step explanation:

4^5 expanded is 4 * 4 * 4 * 4* 4

Which is an example of an operation

Answers

Exponents
Multiplication
Division
Addition
Subtraction

Please consider marking this answer as Brainliest to help me advance.

A pack of cinnamon-scented pencils sells for $4.00. What is the sales tax rate if the total cost of the pencils is $4.20?

Answers

Answer: The sales tax rate is 5%.

Step-by-step explanation: In order to calculate the sales tax rate you need to divide the amount of sales tax by the amount of the purchase. In this case you divide .20 by $4.00. .2 / 4 = .05 = 5% sales tax rate

The sales tax rate for a pack of cinnamon-scented pencils that sells for $4.00 and totals $4.20 is 5%.

To calculate the sales tax rate for a pack of cinnamon-scented pencils that sells for $4.00 and has a total cost of $4.20 including tax, you first need to find the amount of sales tax paid. The sales tax paid is the difference between the total cost and the sale price, which is

$4.20 - $4.00 = $0.20.

Next, you convert the sales tax amount to the sales tax rate by dividing the tax amount by the original price and then multiplying by 100 to get a percentage. Therefore, the sales tax rate is

($0.20 / $4.00) x 100, which equals 5%. The packed pencils had a 5% sales tax added to the original price.

Find the equation of the line below.

Answers

The equation of the line below : y= -6x.

Find the solutions to the equation below check all that apply 30x^2-26x+4=0

Answers

Answer:

A. 1/5

C. 2/3

Step-by-step explanation:

30x^2 - 26x + 4=0

2(15x^2 - 13x + 2) = 0

2(15x^2 - 10x - 3x  + 2) = 0

2[(5x(3x - 2)  - 1(3x - 2)] = 0

2(5x - 1)(3x - 2) = 0

5x - 1 = 0; x = 1/5

3x - 2 = 0; x = 2/3

Answer:

x = 1/5, x = 2/3.

Step-by-step explanation:

30x^2 - 26x + 4 = 0

15x^2 - 13x +2 = 0

(5x - 1 )(3x  - 2) = 0

5x - 1 = 0  or 3x - 2 = 0

x =  1/5,  2/3.

Which expression is equal to 3x?

x + 3
x + x + x
x + x2
2x + 1

Answers

Answer:

The answer is x + x + x.

Step-by-step explanation:

Tripling something means 3 of that thing. 3 + 3 + 3, which is also 3x.

I hope this helped!

Have a wonderful Wednesday!

~Lola

The expression which is equal to 3x is x+x+x. Therefore, option B is the correct answer.

We need to check which expression from the options is equal to 3x.

What is an expression?

An expression is a combination of terms that are combined by using mathematical operations such as subtraction, addition, multiplication, and division.

From option B,

In the expression x+x+x, all three terms are same(like terms), by adding them we get

x+x+x=3x

The expression which is equal to 3x is x+x+x. Therefore, option B is the correct answer.

To learn more about an expression visit;

https://brainly.com/question/28170201.

#SPJ3

Other Questions
Find the distance between the points (5.5) and (3.7). Round your answer to the nearest tenth, if necessary. The length of a rectangle is 12 in. and the perimeter is 56 in. Find the width of the rectangle. PLEASE HELP!!If the measure of a central angle is 28, then to find the measure of its arc, you would need to do which of the following?Nothing, they are equal.Multiply the angle measure by 2.Divide the angle measure by 2. What do the words "We the People" in the beginning of the U.S. Constitution mean? What does it say about the authority of the U.S. Government? Which political organization was MOST associated with the "iron curtain" countries? A)OPEC B)NATO C)Warsaw Pact D)United Nations The transformation (x,y) (x+4,y-3 is performed on the segment AB.The imgae is the line segment AB where point A=(3,-3) and point B =(5,-3).What are the coordinates of A and B in the line segment AB The experimental probability of spinning a number greater than 3 is What does the quote the only way to get through a bigots door is to break it mean susan gets sick often and misses school as a result? which habit should she adopt? Coffee shops that reward customers with one free cup of coffee after every ten coffee purchases are using a ___________ reinforcement schedule. What company was credited with developing the first smartphone? the product of-5 and a number is greater than 35 or less than 10 Please help!!! Will mark brainliest!!! how is health care a problem in today's society 5 50/100 - 2 72/100= What is Hrxn for the following chemical reaction? CS2(g)+2H2O(l)CO2(g)+2H2S(g) You can use the following table of standard heats of formation (Hf) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218 N(g) 473 H2(g) 0 O2(g) 0 H2O(l) 285.8 O(g) 249 CS2(g) 116.7 H2S(g) 20.60kJ C(g) 71 CO2(g) 393.5kJ C(s) 0 HNO3(aq) 206.6 Express the standard enthalpy of reaction to three significant figures and include the appropriate units. View Available Hint(s) Why are publicly traded corporations required to release financial reports on a regular basis?A. because shareholders are entitled to transparencyB. so the government can determine the corporate taxes owedC. so owners know when it is time to hire a new board of directorsD. because it would be impossible to raise financial capital otherwise Find the slope of the line. 5x 2y = 7 which of the following groups is most likely to be dealing with eating disorders teenage girls pregnant women those who abuse alcohol young men in their 20s If you want to lift a 30-kg box to the height of 1 m how much work will it take Steam Workshop Downloader