what is the probability that when rolled a die will come up with an odd number ​

Answers

Answer 1

Numbers on dice: 1,2,3,4,5,6= 6 numbers

Odd numbers: 1,3,5 = 3 number

P=3/6= 1/2


Related Questions

Write an equation of each line that passes through the following points in slope-intercept form:
M (5, 5) and N (–10, –19)


Help me Please!!!!!

Answers

Answer:

[tex]\large\boxed{y=\dfrac{8}{5}x-3}[/tex]

Step-by-step explanation:

The slope-intercept form of an equation of a line:

[tex]y=mx+b[/tex]

m - slope

b - y-intercept

The formula of a slope:

[tex]m=\dfrac{y_2-y_1}{x_2-x_1}[/tex]

We have the points M(5, 5) and N(-10, -19). Substitute:

[tex]m=\dfrac{-19-5}{-10-5}=\dfrac{-24}{-15}=\dfrac{8}{5}[/tex]

We have the equation:

[tex]y=\dfrac{8}{5}x+b[/tex]

Put the coordinates of the point M to the equation:

[tex]5=\dfrac{8}{5}(5)+b[/tex]

[tex]5=8+b[/tex]        subtract 8 from both sides

[tex]-3=b\to b=-3[/tex]

Finally we have the equation:

[tex]y=\dfrac{8}{5}x-3[/tex]

The larger of two number is 5 more than the smaller. The smaller number plus the twice the larger equals 100. Find the numbers

Answers

Answer:

smaller number :30

larger number : 35

Step-by-step explanation:

Find the least common denominator of 3/20 and 9/8

Answers

Answer:

40

Step-by-step explanation:

To find the least common denominator, you find the least common multiples of the denominators, which in this case is 20 and 8.

Tower method:

Start: |20, 8

4 |20, 8 -> 4 is a factor that 20 and 8 have in common

  5,   2   -> 20/4 = 5, 8/4 = 2, those numbers do not have a common factor.

4 * 5 * 2 = 40.

The fractions with 40 as its denominator is 6/40 and 45/40.

What is the surface area of this rectangular prism? 10 Points to the right answer! :D

Answers

Answer:

[tex]S.A=160cm^2[/tex]

Step-by-step explanation:

The surface area of a rectangular prism is given by the formula;

[tex]S.A=2(lw+lh+wh)[/tex]

From the diagram;

The length is [tex]l=10cm[/tex].

The width is  [tex]w=5cm[/tex].

The height is  [tex]h=2cm[/tex].

Substitute these values into the formula to obtain;

[tex]S.A=2(10\times5+10\times2+5\times2)[/tex]

[tex]S.A=2(50+20+10)[/tex]

[tex]S.A=2(80)[/tex]

[tex]S.A=160cm^2[/tex]

Samantha is painting the outside of a box that is in the shape of a rectangular prism. It’s length is 18cm, it’s width is 6 cm, and it’s height is 3cm. What is the surface area of the box in square cm?

A. 162 cm squared
B. 180 cm squared
C. 324 cm squared
D. 360 cm squared

Answers

D. 360 cm squared

Explanation:

Multiply each faces edges.

18x7(WxL)

3x6(HxW)

3x18(HxL)

multiply each equations answer by 2, because the opposite face is the same.

108x2=216

18x2=36

54x2=108

add these together to get 360 cm squared.

Final answer:

The surface area of the box is 360 cm².

Explanation:

To find the surface area of the rectangular prism, we need to find the areas of all the sides and add them together.

The formula to find the surface area is:

Surface Area = 2lw + 2lh + 2wh

Plugging in the given dimensions:

Surface Area = 2(18)(6) + 2(18)(3) + 2(6)(3) = 216 + 108 + 36 = 360 cm²

Therefore, the surface area of the box is 360 cm², which is option D.

Learn more about Surface Area
https://brainly.com/question/951562

#SPJ2

Order from least to greatest 0.14,1/8,1.9%

Answers

Answer: 1/8,1.9,0.14

Step-by-step explanation:

Answer:

0.019 (1.9%), 0.14, 0.125 (1/8)

Step-by-step explanation:

factor completely. x^2+4x-12

Answers

Answer:

(x + 6)(x - 2)

Step-by-step explanation:

To factor the quadratic

Consider the factors of the constant term (- 12) which sum to give the coefficient of the x- term ( + 4)

The factors are + 6 and - 2 since

+ 6 × - 2 = - 12 and + 6 - 2 = + 4, hence

x² + 4x - 12 = (x + 6)(x - 2)

Select all expressions that are equivalent to -36x+54y-90

Answers

The equivalent expressions  of -36x+54y-90 are -18(2x - 3y + 5), 18(-2x + 3y - 5), and -2(18x - 27y + 45). So options (2), (4) and (5) are correct.

To determine which expressions are equivalent to -36x + 54y - 90, we'll distribute the coefficients and compare the resulting expressions.

Let's start by distributing each expression:

1. -9(4x - 6y - 10) = -36x + 54y + 90

2. -18(2x - 3y + 5) = -36x + 54y - 90

3. -6(6x + 9y - 15) = -36x - 54y + 90

4. 18(-2x + 3y - 5) = -36x + 54y - 90

5. -2(18x - 27y + 45) = -36x + 54y - 90

6. 2(-18x + 54y - 90) = -36x + 108y - 180

Among these, expressions 2, 4, and 5 result in the same expression as -36x + 54y - 90.

Expression 2 is -18(2x - 3y + 5), expression 4 is 18(-2x + 3y - 5), and expression 5 is -2(18x - 27y + 45).

Therefore, the equivalent expressions are -18(2x - 3y + 5), 18(-2x + 3y - 5), and -2(18x - 27y + 45).

The stem and leaf plot below could not represent which of the following ​

Answers

The stem and leaf plot below could not represent "the weight of phonebooks, in pounds".

The stem-and-leaf plot you've provided represents a dataset, but without specific labels for the data points, it's challenging to definitively assign the plot to a particular category. However, we can analyze the options you've provided.

1. **Average number of inches of rain in June:** The data points don't seem to represent rainfall values. Rainfall would typically be measured in fractions or decimals, not whole numbers like 33.

2. **Height of plant seedlings, in inches:** This is a possibility, especially if the numbers represent the height of seedlings in inches. The decimal point represented by the key (3 | 5 means 3.5) supports this interpretation, indicating a measurement in inches.

3. **Weight of phonebooks, in pounds:** Phonebook weights are usually measured in pounds or ounces. The given numbers do not correspond to common weights and are unlikely to represent phonebook weights.

4. **Height of NBA basketball players, in meters:** NBA player heights are typically measured in feet and inches, not meters. Additionally, the provided numbers do not align with typical heights of NBA players.

Given the context of the data and the presence of the decimal point in the key, it's most likely that the stem-and-leaf plot represents the **height of plant seedlings, in inches.** This interpretation is consistent with the format of the data and the provided key, suggesting measurements in inches.

So, the correct answer is "the weight of phonebooks, in pounds".

For more such questions on weight

https://brainly.com/question/29892643

#SPJ2

Complete the square to determine the maximum or minimum value of the function defined by the expression. x2 + 8x + 6 A) minimum value at 8 B) maximum value at 10 C) minimum value at −14 D) minimum value at −10

Answers

Answer:

[tex]\large\boxed{\text{ D) minimum value at -10}}[/tex]

Step-by-step explanation:

[tex]\text{The vertex form of equation}\ y=ax^2+bx+c:\\\\y=a(x-h)^2+k\\\\\text{We have the equation:}\ y=x^2+8x+6.\\\\a=1>0,\ \text{the parabola is o}\text{pen up.}\\\text{Therefore the function has the minimum in vertex}\\\\x^2+8x+6=x^2+2(x)(4)+6=x^2+2(x)(4)+4^2-4^2+6\\\\\text{use}\ (a+b)^2=a^2+2ab+b^2\to x^2+2(x)(4)+4^2=(x+4)^2\\\\y=(x+4)^2-16+6=(x+4)^2-10\to\text{vertex}\ (-4,\ -10).[/tex]

Final answer:

To determine the minimum value of the quadratic function x^2 + 8x + 6, we complete the square to get the expression (x + 4)^2 - 10 = 0. The function has a minimum value at (x, y) = (-4, -10), so the correct answer is D) minimum value at -10.

Explanation:

To find the maximum or minimum value of the quadratic function given by the expression x2 + 8x + 6, we need to complete the square. First, we will write the quadratic in the form of (x + h)2 + k, where h and k are constants.

The coefficient of x is 8. We take half of it, which is 4, and square it to get 16. Now add and subtract this square inside the quadratic expression:

x2 + 8x + 16 - 16 + 6 = 0

Now, group the perfect square trinomial and write it as a square of a binomial:

(x + 4)2 - 10 = 0

To find the minimum value, we set the squared term equal to zero, since the minimum value of a square is zero. As such, (x + 4)2 reaches its minimum value when x = -4, and the overall minimum value of the function is when k = -10. Because this is a quadratic with a positive leading coefficient, the function has a minimum value, not a maximum.

Therefore, the correct answer is D) minimum value at -10.

Learn more about Completing the Square here:

https://brainly.com/question/4822356

#SPJ2

can someone help me with this?

Answers

Answer:

780

Step-by-step explanation:

What is the sum of the series 5^n from n=1 to 4.

5^1 + 5^2 + 5^3+ 5^4 =

5 + 25 + 125 + 625 =780

The code to unlock a safety deposit box is three consecutive odd integers whose sum is 75. Find the integers

Answers

Answer: The integers are 23, 25, and 27

Step-by-step explanation:

Call the first integer n, and then the next two odd ones are n + 2 and n + 4.

Add them together to get 75:

n + n+ 2 + n + 4 = 75

which becomes 3n + 6 = 75

so 3n = 69, and n is therefore 23. n + 2 = 25, and n + 4 = 27.

The three consecutive odd integers whose sum is 75 are 23, 25, and 27. These are determined by forming an equation with the first odd integer as 'x' and the other two as 'x+2' and 'x+4', respectively, since consecutive odd numbers differ by 2.

The task is to find three consecutive odd integers whose sum is 75. To solve this, we can represent the three consecutive odd integers as x, x + 2, and x + 4. Since the sum of these integers is 75, we can set up the following equation: x + (x + 2) + (x + 4) = 75.

Simplifying the equation we get:
3x + 6 = 75
3x = 69
x = 23

Now we have our first integer x = 23. The next consecutive odd integer would be x + 2 which is 25, and the third one would be x + 4 which is 27. Therefore, the three consecutive odd integers that sum up to 75 are 23, 25, and 27.

help plz explain how to do this.

Answers

Answer:

1/3

Step-by-step explanation:

Write the letter of the largest number (below): _____
A. 0.9837 B. 2/165 C. 4 x 10-5 D. 23

Answers

Answer:

C.

Step-by-step explanation:

4x10 = 40 - 5 = 35.

35 is bigger than 23,

35 is bigger than 0.9837

and 35 is also bigger than 2/165, therefore 35 is the largest number.

What is the solution to the inequality -4x < 8? x < -24 x > -24 x < -2 x > -2

Answers

Answer:

x > -2

Step-by-step explanation:

Solve the inequality -4x < 8 using inverse operations. If you divide or multiply by a negative, flip the inequality sign.

[tex]-4x < 8\\\\\frac{-4x}{-4} < \frac{8}{-4}[/tex]

x > -2

simplify b^10/b^2, help me pls​

Answers

Answer:

[tex]\text{\bf{A.}}\quad b^8[/tex]

Step-by-step explanation:

It may be helpful to remember that an exponent signifies repeated multiplication:

  b¹⁰ = b·b·b·b·b·b·b·b·b·b . . . . . . . b is a factor 10 times

and

  b² = b·b . . . . . . . . . . . . . . . . . . . . b is a factor 2 times

Then the division can be simplified by using the denominator factors to cancel 2 of the numerator factors:

[tex]\dfrac{b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b}{b\cdot b}=b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b\cdot b=b^8[/tex]

In terms of exponents, we write this as ...

[tex]\dfrac{b^{10}}{b^2}=b^{10-2}=b^8[/tex]

Answer:

A) b^8

Step-by-step explanation:

help please!!! thank u!​

Answers

The answer is 33. Because when you have a scale factor of a whole number you multiply by the given area, point or line. Because of this the equation is 11(x) times 3 (scale factor)

Answer:

99

Step-by-step explanation:

The perimeter is increased by a factor of 3. The formula for perimeter is

New Perimeter = scale factor * original perimeter.

Area is a different matter. It is

New area = (scale factor)^2 * old area

Givens

old area = 11

Solution

New Area = 3^2 * 11

New area = 9 * 11

New area = 99

solve -37 + n equals -56 for n​

Answers

Simplifying

-37 + n = -56

Solving

-37 + n = -56

Solving for variable 'n'.

Move all terms containing n to the left, all other terms to the right.

Add '37' to each side of the equation.

-37 + 37 + n = -56 + 37

Combine like terms: -37 + 37 = 0

0 + n = -56 + 37

n = -56 + 37

Combine like terms: -56 + 37 = -19

n = -19

Simplifying

n = -19

Answer:

N=-19

Step-by-step explanation:

Just add 37 to bot sides

The back of mangled angles

Answers

Answer:

what do you want me to do?

Step-by-step explanation:

Enter the missing numbers in the boxes to complete the table of equivalent ratios of lengths to widths. PLS HELP WORTH 50 POINTS!!!!!

Length (cm) Width (cm)
6 ?
9 36
? 48
15 ?

Answers

i think they were multiplying each by 4. so 6x4 would be 24. and 12x4 = 48, then 15x4= 60. so i believe the blanks are 24,12,60.

Answer:

x    y

6  24

9  36

12 48

15  60

Step-by-step explanation:

We need to find the rate of change in the table.

Lets start with the x-values.

6 to 9?

9 - 6 = 3

So, the rate of change in the x-value is 3

9 to 3 is 12

12 to 3 is 15

Now let's go onto the y-values.

We don't know the first number, so let's move to the next number, 36.

36 to 48?

48 - 36 = 12

Therefore, the rate of change in the y-value is 12

So, let's work backwards to find the first number.

36 - 12 = 24

48 + 12 = 60

Another easier way you could do it (really simple).

9 times what is 36?

9 x 4 = 36, right?

So, the change of rate is 4

So multiply everything in the x column by 4.

6 x 4 = 24

15 x 4 = 60

Since we don't have one the x value for 48, divide it by 4 which is 12

Voilà ;)

A coffee shop recently sold 20 drinks, including 8 mochas. Considering this data, how many of the next 95 drinks sold would you expect to be mochas?

Answers

Answer:

38 mochas

Step-by-step explanation:

Of the 20 drinks sold, 8 were mochas, so

8/20 = 0.4 = 40% of the drinks they sold were mochas.

If the sold 95 drinks, then 95(0.4) = 38 of them would be mochas if the proportion stays the same

____ improves as degree of educational attainment increases.
A)Interest rate
B)median income
C)savings ability
D)borrowing rate

Answers

Median income improves as degree of educational attainment increases. (B)

The answer is B) median income

Rachel likes to read books. She records the number of books she read over a period of 5 weeks. The set of ordered pairs below gives the details, where the x-coordinate is the number of weeks since she starts recording and the y-coordinate is the number of books she read each week.

Which of the following describes the set of ordered pairs?
A. both a relation and a function
B. a function only
C. neither a function nor a relation
D. a relation only

Answers

Answer:

A. both a relation and a function

Step-by-step explanation:

The given set of ordered pairs is

{(1,2),(2,3),(3,1),(4,4),(5,2)}.

This ordered pairs represent a relation.

The x-coordinates represent the domain and the co-domain or range is the set of the y-coordinates.

The relation is many-to-one relation.

All many-to-one relations are functions.

The correct choice is A.

Please help!!!!??? I have no idea what this is asking

Answers

It's asking you to find the distance measurement of  ADB

angle 1 or AD = 100 degrees

angle BC or 3 = 30 degrees

Hope this helps!

????????????????????

Answers

Answer:

A= 28-16x       B+= 21y

Step-by-step explanation:

For A you use distributive properties to get your answer and for B since they all have the same variable you can add them like regular addition.

If a certain number is added to the numerator and denominator of 8/11, the result is 6/7. Find the number.

Answers

Answer:

x = 10

Step-by-step explanation:

8 + x =  6

11 + x     7

Cross Multiply

6(11 + x) = 7(8 + x)

66 + 6x = 56 + 7x

10 = x

Final answer:

The number that needs to be added to the numerator and denominator of 8/11 to result in 6/7 is 10.

Explanation:

The subject of the question is Mathematics, specifically algebra and fractions. We can represent the student's problem with an equation, where x stands for the unknown number to be added to the numerator and denominator of 8/11 to get 6/7.

The initial fraction is 8/11 and the desired fraction is 6/7. Hence, we can translate this problem into the equation: (8 + x)/(11 + x) = 6/7. By cross-multiplying to eliminate the fractions, we get: 7(8 + x) = 6(11 + x). Simplified, this equation becomes 56 + 7x = 66 + 6x. Solving for x, we subtract 6x from both sides: x = 66 - 56, so x = 10.

Learn more about Fraction here:

https://brainly.com/question/10354322

#SPJ3

What is the length of the intercepted arc?

Answers

First you need to calculate the circumference of the circle:

Circumference = diameter x PI =  16 x PI = 16 * 3.14 = 50.24

The intercepted arc is 15 degrees.

To find the length multiply the circumference by the central angle divided by 360.

Arc length = 50.25 x (15/360) = 2.1 units.

Gabriella uses 8.4 pints of white paint and blue paint to paint her bedroom walls.
2/5 of this amount is white paint, and the rest is blue paint. How many pints of blue paint did she use to paint her bedroom walls?

Answers

Answer:

8

Step-by-step explanation:

covert 8.4 into a fraction which would be 42/5

then subtract 42/5 from 2/5 and youll get 8

Final answer:

To calculate the amount of blue paint Gabriella used, multiply 8.4 pints by 2/5 to determine the white paint, and then subtract this from the total, resulting in 5.04 pints of blue paint.

Explanation:

Gabriella uses a total of 8.4 pints of paint to paint her bedroom walls, with 2/5 of this amount being white paint. To find out how many pints of blue paint she used, we first need to determine the amount of white paint and then subtract that from the total.

Multiply the total amount of paint by 2/5 to find the white paint: 8.4 pints  imes 2/5 = 3.36 pints (white paint).

To find the blue paint, subtract the white paint from the total paint: 8.4 pints - 3.36 pints = 5.04 pints (blue paint).

Therefore, Gabriella used 5.04 pints of blue paint to paint her bedroom walls.

How do Find this answer

Answers

Answer:

B and E

Step-by-step explanation:

When the probability of an event is;

Nearing 0, the even is unlikely to happenNeither unlikely nor likely,it is a half, 1/2Nears 1,it is a likely event to happen

In this case event E, with probalility of P(E)=1/2 and event B with probability P(B)=0.49  have the probability neither unlikely nor likely

At the airport, ten people are waiting on standby. Two seats become available, one first class and one coach. How many ways are there to fill the two seats?

10
20
45
90

Answers

Answer:

Last Option

Step-by-step explanation:

We have 10 people and two seats. Then we must choose 2 people out of 10 to occupy the seats.

The seats are different so the order in which people feel is important.

This is a problem of permutations

For the first seat I must choose a person of between 10.

For the second seat I must choose a person from 9.

So, if we call m the number of ways in which you can assign the seats:

[tex]m = 10*9\\\\m = 90[/tex]

Answer:

90

Step-by-step explanation:

Other Questions
Phosphatases are a family of enzymes that remove phosphate groups from specific proteins; these phosphate groups had been added to the proteins by protein kinases. Vanadate is an inhibitor of phosphatases in eukaryotic cells. What effect would vanadate have on the response of cells to signals received by receptor kinases? The response of the cell would be shorter than it normally would. The response of the cell would last longer than it normally would. The signal would still bind the receptor, so there would be no effect. Which of the following is not a main priority of the U.S. government?subsidizing businesses to keep product prices lowproviding education for all childrencreating laws that protect property rights and enforce contractsproviding for national defense How do I find and what is the x? TRUE OR FALSE? earth revolves around the sun tilted on its axis Bonita said that the product of 5/6 1 2/3 is 7/ 3. How can you tell that her answer is wrong? During the 1945 conference in Potsdam,Question 14 options:Churchill replaced Clement Atlee as prime minister of Britain.the Big Three decided that Poland, Bulgaria, and Romania would be independent.Stalin reneged on his pledge to enter the war against Japan in the Pacific.the Big Three formalized the plan to divide Germany into four zones of occupation. Disuss the difference between fixed expenses and variable expenses as they relate to a budget? in the figure PQ is parallel to RS. the length of RP is 6 cm; the length of PT is 18 cm; the length of QT is 21 cm; what is the length of SQ? what is the definition of positive effect 535 invenstment compounded continuosly for 10 years at 6 percent A candle is placed 40cm in front of a convex mirror with a focal length of 20cm, as shown on the diagram. What is the distance from the lens to the image? X-10 explain why mental disorders should be viewed like any other physical illness.why it important not to stigmatize someone with a mental disorders . the point slope form of the equation of a line that passes through (8,4) and (0,2) is y-4=1/4(-8) what is the slope intercept form of the equation for this line. After the gaps between the firm's labor supply and labor demand are identified, a firm should ________. develop and implement action plans conduct a workforce analysis identify its business strategy articulate its talent philosophy and strategic staffing decisions The primary advantage quick-service restaurants have over other restaurant types is URGENT! Which of the following correctly expresses sin(2)sin(6) as a product?Select the correct answer below:2sin(4)cos(2)2sin(2)cos(4)2sin(2)cos(4)2sin(2)sin(4) What are some ideas that i would put for a visual project (power point) on NRA civil rights issues. please idc if you guys get political as long as i can put them in the power point. Identify Cause and Effect How did World War I affect the role of women in society? Subtract 6 ounces from 3 pounds.5 lb., 7 oz.6 lb., 3 oz.2 lb., 10 oz.2 lb., 13 oz. Steam Workshop Downloader