The weights of bags of peas are normally distributed with a mean of 13.50 ounces and a standard deviation of 1.06 ounces. Bags in the upper 4% are too heavy and must be repackaged. What is the most that a bag can weigh and not need to be repackaged?

Answers

Answer 1

Answer:

The most that a bag can weigh and not need to be repackaged is 15.355 ounces.

Step-by-step explanation:

Problems of normally distributed samples can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the zscore of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the pvalue, we get the probability that the value of the measure is greater than X.

In this problem, we have that:

[tex]\mu = 13.50, \sigma = 1.06[/tex]

Bags in the upper 4% are too heavy and must be repackaged. What is the most that a bag can weigh and not need to be repackaged?

Bags in the upper 4% have a pvalue of 1-0.04 = 0.96. So the most that a bag can weight and not need to be repackaged is the value of X when Z has a pvalue of 0.9599. So this is X when [tex]Z = 1.75[/tex]

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]1.75 = \frac{X - 13.50}{1.06}[/tex]

[tex]X - 13.50 = 1.75*1.06[/tex]

[tex]X = 15.355[/tex]

The most that a bag can weigh and not need to be repackaged is 15.355 ounces.


Related Questions

An apartment has two fire alarms. In the event of a fire, the probability that alarm A will fail is 0.004, and the probability that alarm B will fail is 0.01. Assume the two failures are independent, what is the probability that at least one alarm fails in the event of a fire

Answers

Answer: 0.0136

Step-by-step explanation:

Let events are:

A = alarm A will fail

B=  alarm B will fail

We have given ,

P(A) =  0.004  ,   P(B)=0.01

Since both events are independent , so

P(A and B) = P(A) x P(B)

= 0.04 x 0.01 =0.0004

i.e. P(A and B) =0.0004

Now , P(A or B) = P(A)+P(B)-P(A and B)

= 0.004+ 0.01-0.0004=0.0136

Hence, the probability that at least one alarm fails in the event of a fire is 0.0136 .

The probability that at least one alarm fails in the event of a fire is approximately 0.014 or 1.4%.

The probability that at least one alarm fails in the event of a fire is given by:

[tex]\[ P(\text{at least one fails}) = 1 - P(\text{both work}) \][/tex]

Since the failures are independent, the probability that both alarms work is the product of their individual probabilities of working:

[tex]\[ P(\text{both work}) = P(\text{A works}) \times P(\text{B works}) \][/tex]

The probability that alarm A works is the complement of the probability that it fails, which is [tex]\( 1 - 0.004 \)[/tex]. Similarly, the probability that alarm B works is  1 - 0.01 .

Thus, we have:

[tex]\[ P(\text{A works}) = 1 - 0.004 = 0.996 \] \[ P(\text{B works}) = 1 - 0.01 = 0.99 \][/tex]

Now we can calculate [tex]\( P(\text{both work}) \)[/tex]:

[tex]\[ P(\text{both work}) = 0.996 \times 0.99 \] \[ P(\text{both work}) = 0.98604 \][/tex]

Finally, we find the probability that at least one alarm fails:

[tex]\[ P(\text{at least one fails}) = 1 - 0.98604 \] \[ P(\text{at least one fails}) = 0.01396 \][/tex]

Suppose we have 12 women and 4 men. If we divide these 16 people into4 groups of size 4, what is the probability that each group contains a man?

Answers

Answer:

P= 0.0039

Step-by-step explanation:

From Exercise we have 12 women and 4 men.

We calculate the number of combinations of 16 people, to be divided into 4 teams of 4 people each.

{16}_C_{4} · {12}_C_{4} · {8}_C_{4} =

=\frac{16!}{4!·(16-4)!} · \frac{12!}{4!·(12-4)!}· \frac{8!}{4!·(8-4)!}

=1820 · 495 ·  105

=94594500

The number of favorable combinations is

{12}_C_{3} · {9}_C_{3} · {6}_C_{3} =

=\frac{12!}{3!·(12-3)!} · \frac{9!}{3!·(9-3)!}· \frac{6!}{3!·(6-3)!}

=220 · 84 ·  20

=369600

The  probability is 369600/94594500=16/4095=0.0039

P= 0.0039

Historically, the proportion of people who trade in their old car to a car dealer when purchasing a new car is 48%. Over the previous 6 months, in a sample of 115 new-car buyers, 46 have traded in their old car. To determine (at the 10% level of significance) whether the proportion of new-car buyers that trade in their old car has statistically significantly decreased, what can you conclude concerning the null hypothesis?

Answers

Answer:

[tex]z=\frac{0.4 -0.48}{\sqrt{\frac{0.48(1-0.48)}{115}}}=-1.717[/tex]  

[tex]p_v =P(z<-1.717)=0.0429[/tex]  

So the p value obtained was a very low value and using the significance level given [tex]\alpha=0.1[/tex] we have [tex]p_v<\alpha[/tex] so we can conclude that we have enough evidence to reject the null hypothesis, and we can said that at 5% of significance the proportion of people that have traded in their old car is lower than 0.48 or 48%.  

Step-by-step explanation:

Data given and notation

n=115 represent the random sample taken

X=46 represent the number of people that have traded in their old car.

[tex]\hat p=\frac{46}{115}=0.4[/tex] estimated proportion of people that have traded in their old car

[tex]p_o=0.48[/tex] is the value that we want to test

[tex]\alpha=0.1[/tex] represent the significance level

Confidence=90% or 0.9

z would represent the statistic (variable of interest)

[tex]p_v[/tex] represent the p value (variable of interest)  

Concepts and formulas to use  

We need to conduct a hypothesis in order to test the claim that the proportion is less than 0.48.:  

Null hypothesis:[tex]p\geq 0.48[/tex]  

Alternative hypothesis:[tex]p < 0.48[/tex]  

When we conduct a proportion test we need to use the z statistic, and the is given by:  

[tex]z=\frac{\hat p -p_o}{\sqrt{\frac{p_o (1-p_o)}{n}}}[/tex] (1)  

The One-Sample Proportion Test is used to assess whether a population proportion [tex]\hat p[/tex] is significantly different from a hypothesized value [tex]p_o[/tex].

Calculate the statistic  

Since we have all the info requires we can replace in formula (1) like this:  

[tex]z=\frac{0.4 -0.48}{\sqrt{\frac{0.48(1-0.48)}{115}}}=-1.717[/tex]  

Statistical decision  

It's important to refresh the p value method or p value approach . "This method is about determining "likely" or "unlikely" by determining the probability assuming the null hypothesis were true of observing a more extreme test statistic in the direction of the alternative hypothesis than the one observed". Or in other words is just a method to have an statistical decision to fail to reject or reject the null hypothesis.  

The significance level provided [tex]\alpha=0.1[/tex]. The next step would be calculate the p value for this test.  

Since is a left tailed test the p value would be:  

[tex]p_v =P(z<-1.717)=0.0429[/tex]  

So the p value obtained was a very low value and using the significance level given [tex]\alpha=0.1[/tex] we have [tex]p_v<\alpha[/tex] so we can conclude that we have enough evidence to reject the null hypothesis, and we can said that at 5% of significance the proportion of people that have traded in their old car is lower than 0.48 or 48%.  

Evaluate cos(sin^-1(3/7)). Please I really confused about how to solve it. ASAP!!!!!!

Answers

Answer:

2√10 / 7

Step-by-step explanation:

to solve cos(sin^-1(3/7))

we break it into simpler terms

sin^-1(3/7) ------ these will be taken as an angle when dealing with cos

sin Ф = opposite / hypothenus = 3/7

Using Pythagoras Theorem

Hypothenus ² = opposite² + adjacent ²

7² = 3² + a²

49 = 9 + a²

a² = 49 - 9 = 40

a = √40 = √2x2x10 = 2√10

cos Ф = adjacent / hypothenus = 2√10 / 7  

cos(sin^-1(3/7)) = 2√10 / 7  

The value of the given expression is 2√10 / 7.

What is trigonometric identity?

Trigonometry is the branch of mathematics that set up a relationship between the sides and angle of the right-angle triangles.

Trigonometric identities are equality conditions in trigonometry that hold for all values of the variables that appear and are defined on both sides of the equivalence. These are identities that, geometrically speaking, involve certain functions of one or more angles.

Solve cos(sin⁻¹(3/7)). Break it into simpler terms sin⁻¹(3/7) these will be taken as an angle when dealing with cos.

sin Ф = opposite / hypothenus = 3/7

Using Pythagoras Theorem

Hypothesis ² = opposite² + adjacent ²

7² = 3² + a²

49 = 9 + a²

a² = 49 - 9 = 40

a = √40 = √2x2x10 = 2√10

cos Ф = adjacent / hypothenus = 2√10 / 7  

cos(sin⁻¹(3/7)) = 2√10 / 7  

Hence, the value of cos(sin⁻¹(3/7)) will be 2√10 / 7.

To know more about Trigonometry follow

https://brainly.com/question/24349828

#SPJ2

The meat department of a supermarket sells ground beef in approximate 1 lb packages, but there is some variability. A random sample of 65 packages yielded a mean of 1.05 lbs and a standard deviation of .23 lbs. What is the 99% Confidence Interval for this problemA..99 to 1.11
B.1.00 to 1.10
C..98 to 1.12
D.1.01 to 1.09

Answers

Answer:

[tex] 1.05-2.65 \frac{0.23}{\sqrt{65}} \approx 0.98[/tex]

[tex] 1.05+2.65 \frac{0.23}{\sqrt{65}} \approx 1.12[/tex]

So on this case the 99% confidence interval for the mean would be given by (0.98;1.12)

And the best option is:

C..98 to 1.12

Step-by-step explanation:

Previous concepts

A confidence interval is "a range of values that’s likely to include a population value with a certain degree of confidence. It is often expressed a % whereby a population means lies between an upper and lower interval".

The margin of error is the range of values below and above the sample statistic in a confidence interval.

Normal distribution, is a "probability distribution that is symmetric about the mean, showing that data near the mean are more frequent in occurrence than data far from the mean".

[tex]\bar X=1.05[/tex] represent the sample mean for the sample  

[tex]\mu[/tex] population mean (variable of interest)

s=0.23 represent the sample standard deviation

n=65 represent the sample size  

Solution to the problem

The confidence interval for the mean is given by the following formula:

[tex]\bar X \pm t_{\alpha/2}\frac{s}{\sqrt{n}}[/tex]   (1)

In order to calculate the critical value [tex]t_{\alpha/2}[/tex] we need to find first the degrees of freedom, given by:

[tex]df=n-1=65-1=64[/tex]

Since the Confidence is 0.99 or 99%, the value of [tex]\alpha=0.01[/tex] and [tex]\alpha/2 =0.005[/tex], and we can use excel, a calculator or a table to find the critical value. The excel command would be: "=-T.INV(0.005,64)".And we see that [tex]t_{\alpha/2}=2.65[/tex]

Now we have everything in order to replace into formula (1):

[tex] 1.05-2.65 \frac{0.23}{\sqrt{65}} \approx 0.98[/tex]

[tex] 1.05+2.65 \frac{0.23}{\sqrt{65}} \approx 1.12[/tex]

So on this case the 99% confidence interval for the mean would be given by (0.98;1.12)

And the best option is:

C..98 to 1.12

Suppose the manager of a gas station monitors how many bags of ice he sells daily along with recording the highest temperature each day during the summer. The data is plotted with temperature, in degrees Fahrenheit (degree), on the horizontal axis and the number of ice bags sold on the vertical axis. One of the plotted points on the graph is (82.67). The least squares regression line for this data is y =-192.20 + 3.13x. Determine the predicted number of bags of ice sold, y, when the temperature is 82 degree F. Round the predicted value to the nearest whole number. y = ice bags Compute the residual at this temperature. Round the value to the nearest whole number. residual = ice bags

Answers

Answer:

64bags of ice were sold when the temperature is 82 degree F

Step-by-step explanation:

From the equation ; Y =-192.20 + 3.13x

where Y = predicted number of bags of ice sold

x = temperature, in degrees Fahrenheit (degree)

To find Y when x = 82

substitute the value of x in the equation given

= Y = -192.20 + 3.13(82)

Y = 64.46 and approximately, Y = 64

To Compute the residual at this temperature;

residual = 67 - 64.46= 2.53 which is approximately 3

Compact and oversized tires are produced on two different machines. The table shows the number of each type of tire produced, y, depending on the number of hours, x, the machines work.

Answers

Answer:

OPTION B: 57x - 3

Step-by-step explanation:

Total tires produced is the sum of number of over-sized tires and the number of compact tires.

So, we have when x = 1, tires, y = 23 + 31 = 54

When x = 2, total tires y = 48 + 63  = 111

When x = 3, total tires y = 73 + 95  = 168

When x = 4, total tires y = 98 + 127 = 225

We can substitute the options to check which one will be the correct representation.

Option A: 55x - 1

When x = 1, y = 55(1) - 1    = 54

When x = 2, y = 55(2) - 1  = 109    [tex]$ \ne $[/tex]    111

So, this option is eliminated.

Option B: 57x - 1

When x = 1, y = 57(1) - 3    =   54

When x = 2, y = 57(2) - 3  =   111

When x = 3, y = 57(3) - 3  =   168

When x = 4, y = 57(4) - 3  =   225

These values exactly match with the values from the table. So, Option B is the right answer.

Option C: 110x - 2

When x = 1, y = 110(1) - 2 = 108  [tex]$ \ne $[/tex]  54

Hence, this option is incorrect.

Option D: 114x - 6

When x = 1, y = 114(1) - 6 [tex]$ \ne $[/tex]  54

Hence, this option is also eliminated.

Option B is the required answer.

Find u.
Write your answer in simplest radical form

Answers

Check the picture below.

Express the confidence interval 0.333less thanpless than0.555 in the form ModifyingAbove p with caret plus or minus Upper E. ModifyingAbove p with caret plus or minus Upper Eequals nothingplus or minus nothing

Answers

Answer:

The confidence interval is (0.444 ± 0.111).

Step-by-step explanation:

The general form of a confidence interval for single proportion is: [tex](\hat p- E<p<p\hat + E)=\hat p \pm E[/tex]

The interval provided is: (0.333 < p < 0.555)

Then

[tex]\hat p-E=0.333...(i)\\\hat p + E = 0.555...(ii)[/tex]

Solving the two equation simultaneously:

Add (i) and (ii),

[tex]2\hat p=0.888\\\hat p=\frac{0.888}{2}\\ =0.444[/tex]

Substitute the value of [tex]\hat p[/tex] in (i) to compute the value of E:

[tex]\hat p-E=0.333\\0.444-E=0.333\\E=0.444-0.333\\=0.111[/tex]

Thus, the confidence interval is,

[tex](0.444-0.111<p<0.444+0.111)=0.444 \pm 0.111[/tex]

Use scalar projection to show that the distance from a point P1(x1,y1) to the line ax+by+c=0 is |ax1+by1+c|/underroot(a^2 +b^2)

Use this formula to find the distance from the point (-2,3) to the line 3x-4y+5=0

Answers

Answer:

d = 13 / 5 units          

Step-by-step explanation:

Given:

- Point P = (-2 , 3 )

- line : 3x - 4y + 5 = 0

Find:

- Use projection to show the given formula

- use the formula to find the distance from given point and line.

Solution:

- Let line L be defined as:

                                     a*x + b*y + c = 0

- Choose A as fixed point on the line L whose coordinates are ( m , k ).

- Now the coordinates of any point (x , y ) can be given by the line L:

                                    a*( x - m ) + b*( y - k ) + c = 0

- We did that by subtracting the coordinates (x,y) from (m,k).

- The above line can represented by dot product of constants (a , b ) to vector coordinates between points (x,y) to (m,k):

                                   ( a , b ) . ( x - m , y - k) = 0

- For above expression to be true i.e the dot product of two vectors is only zero when the vectors are orthogonal. So vector (a , b ) is always perpendicular to every vector in direction of line L

- The vector:

                                         v =  ( x - m , y - k)

- It may represent the line connecting the points (x_1 , y_1) and (m, k).

Then the distance d from the point P_1: (x_1, y_1) to the line L is given by the magnitude of the scalar projection of v onto a, because the latter is the length of the side of a right  triangle with two of the vertices being P_1 and

( m , k), and the other vertex lying on L So:

                                      d = | component v along x |

                                      d =  | v . ( a , b ) | / | (a , b ) |

                                      d = | (x_1 - m , y_1 - k ) . ( a , b)| / sqrt(a^2 + b^2)

                                      d = | ax_1 + by_1 - (a*m + b*k) | / sqrt(a^2 + b^2)

Where point A (m,k) lies on line hence;

                                      a*m + b*k + c = 0

                                      c = - (a*m + b*k)

Hence,

                                      d = | ax_1 + by_1 + c | / sqrt(a^2 + b^2)

- Given point P (-2,3) and line L : 3x - 4y + 5 = 0

where,

                                    (x_1 , y_1) = (-2 , 3 )

                                     (a , b) = ( 3 , -4 )

                                            c = 5

-Evaluate:

                                    d = | 3*(-2) + -4*3 + 5 | / sqrt(3^2 + 4^2)

                                    d = | - 13 | / 5

                                    d = 13 / 5 units                                    

                               

The distance from the point (-2,3) to the line [tex]\(3x - 4y + 5 = 0\)[/tex] is [tex]\(\frac{|3(-2) - 4(3) + 5|}{\sqrt{3^2 + (-4)^2}}\)[/tex].

To find the distance from a point [tex]\(P_1(x_1, y_1)\)[/tex] to a line [tex]\(ax + by + c = 0\)[/tex], one can use the formula derived from scalar projection:

[tex]\[ \text{Distance} = \frac{|ax_1 + by_1 + c|}{\sqrt{a^2 + b^2}} \][/tex]

Here, [tex]\(a\)[/tex], [tex]\(b\)[/tex], and [tex]\(c\)[/tex] are the coefficients of the line, and [tex]\(x_1\)[/tex] and [tex]\(y_1\)[/tex] are the coordinates of the point. The numerator represents the absolute value of the expression [tex]\(ax_1 + by_1 + c\)[/tex], which is the scalar projection of the vector from the origin to the point onto the normal vector of the line. The denominator is the magnitude of the normal vector of the line.

Given the point [tex]\(P_1(-2, 3)\)[/tex] and the line [tex]\(3x - 4y + 5 = 0\)[/tex], we substitute [tex]\(x_1 = -2\)[/tex] and [tex]\(y_1 = 3\)[/tex] into the formula:

[tex]\[ \text{Distance} = \frac{|3(-2) - 4(3) + 5|}{\sqrt{3^2 + (-4)^2}} \][/tex]

Now, we calculate the numerator:

[tex]\[ 3(-2) - 4(3) + 5 = -6 - 12 + 5 = -13 + 5 = -8 \][/tex]

The absolute value of [tex]\(-8\)[/tex] is [tex]\(8\)[/tex], so the numerator becomes [tex]\(8\)[/tex].

Next, we calculate the denominator, which is the magnitude of the normal vector of the line:

[tex]\[ \sqrt{3^2 + (-4)^2} = \sqrt{9 + 16} = \sqrt{25} = 5 \][/tex]

Finally, we divide the absolute value we found in the numerator by the denominator to get the distance:

[tex]\[ \text{Distance} = \frac{8}{5} \][/tex]

Therefore, the distance from the point (-2,3) to the line [tex]\(3x - 4y + 5 = 0\)[/tex] is [tex]\(\frac{8}{5}\)[/tex].

Let R be the region bounded by the following curves. Find the volume of the solid generated when R is revolved about the​ x-axis. Recall that cosine squared x equals one half (1 plus cosine 2 x ). yequalscosine 21 x​, yequals​0, xequals0 Set up the integral that gives the volume of the solid.

Answers

Answer:

Volume of the solid generated = pi2/84 cubic unit

Step-by-step explanation:

The deatiled step and appropriate integration is donw as shown in the attached file.

Final answer:

To find the volume of the solid when the region bounded by the curves is revolved about the x-axis, use the disk method to integrate the cross-sectional areas of the disks formed. The limits of integration are determined by finding the intersection points of the curves. The formula for the cross-sectional area is A = πr^2, where r is the distance from the x-axis to the function y(x).

Explanation:

To find the volume of the solid when the region bounded by the curves is revolved about the x-axis, we can use the disk method. The disk method involves integrating the cross-sectional area of each disk formed by rotating a thin vertical strip of the region about the x-axis. The formula for the cross-sectional area of a disk is A = πr^2, where r is the distance from the x-axis to the function y(x).

First, we need to determine the limits of integration. The curves y = cos(21x) and y = 0 intersect at x = 0 and x = π/42. So we integrate from x = 0 to x = π/42.

The distance from the x-axis to the function y(x) is y(x) = cos(21x). Therefore, the cross-sectional area of each disk is A(x) = π[cos(21x)]^2. To find the volume, we integrate A(x) from x = 0 to x = π/42:

V = ∫0π/42π[cos(21x)]^2 dx

Learn more about Volume of solid generated by revolving a region about the x-axis here:

https://brainly.com/question/33945198

#SPJ3

Astronomers treat the number of stars in a given volume of space as a Poisson random variable. The density in the Milky Way Galaxy in the vicinity of our solar system is one star per 16 cubic light years.
How many cubic light years of space must be studied so that the probability of one or more stars exceeds 0.94?[Round your answer to the nearest integer.]

Answers

Answer:

t = 45 cubic light years to find a star with this certainty.

Step-by-step explanation:

The Poisson random probability equation is given by:

[tex]P(k events in interval t)=\frac{(\lambda t)^{k}e^{-\lambda t}}{k!}[/tex]

λ is the density (1/16 star/cubic light years)t is the parameter in cubic light years

We can use the next equation to quantify how many cubic light years of space must be studied so that the probability of one or more stars exceeds 0.94.

[tex]P(k\ge 1) \ge 0.94[/tex]

[tex]1-f(0)=1-\frac{(\frac{1}{16}*t)^{0}e^{-\frac{1}{16}*t}}{0!}=1-e^{-\frac{1}{16}*t}} \ge 0.94[/tex]

So, here we just need to solve it for t:

[tex]1-e^{-\frac{1}{16}*t}} \ge 0.94[/tex]

[tex]e^{-\frac{1}{16}*t}} \ge 0.06[/tex]

[tex]ln(e^{-\frac{1}{16}*t}}) \ge ln(0.06)[/tex]

[tex]-\frac{1}{16}*t \ge -2.8[/tex]

[tex]t \ge 44.8[/tex]

Therefore t = 45 cubic light years to find a star with this certainty.

I hope it helps you!

To find the volume of space where the probability of encountering one or more stars exceeds 0.94 in the Milky Way, use the inverse of the cumulative distribution function of the Poisson distribution, with the given star density of one per 16 cubic light years, and solve for the volume V such that the probability of zero stars is below 0.06.

In order to solve the problem of how many cubic light years of space must be studied so that the probability of one or more stars exceeds 0.94, we need to use the properties of the Poisson distribution. The Poisson distribution is often used for modeling the number of events in fixed intervals of time or space under certain conditions. If we let λ denote the average number of stars in a given volume, then for our Milky Way Galaxy in the vicinity of our solar system where the density is one star per 16 cubic light years, λ is 1/16 per cubic light year. The probability of finding no stars in a volume V is given by e^{-λV}. To find when the probability of one or more stars exceeds 0.94, we need to find V such that the probability of finding no stars is less than 0.06 (which is 1 - 0.94).

Let's calculate the volume V:

We first solve the inequality e^{-λV} < 0.06 for V.

Taking the natural logarithm of both sides gives us -λV < ln(0.06).

We then solve for V: V > ln(0.06) / -λ.

Substituting λ (1/16) gives us V > ln(0.06) / -(1/16).

Finally, calculate the numeric value and round to the nearest integer to find the minimum volume V that meets the requirement.

By performing these calculations, you can find how many cubic light years of space must be studied so that the probability of one or more stars exceeds 0.94.

A tank with a capacity of 500 gal contains 200 gal of water with 100 lb of salt in solution. Water containing 1 lb of salt per gallon is entering the tank at a rate of 3 gal/min, and the mixture is allowed to flow out of the tank at a rate of 2 gal/min. Set up, but do not solve, the differential equation describing the rate of change in pounds of salt of the mixture before the tank overflows. Please simplify you equation and include all units (Hint: The amount of solution in the tank depends on time).

Answers

Answer:

dQ/dt = 3 - 2Q/(t+200), Q(0) = 100

Step-by-step explanation:

The rate of change dQ/dt describes the amount of salt in the tank at a given time, this rate of change can be express as rate-in minus the rate-out and those individual rates can be expressed as the rate at which liquid enters or leaves the tank (gal/min) by the amount of salt entering or leaving the tank at a given time (lb/gal).

Rate-in: the amount of liquid entering the tank per minute remains constant at 3 gal/min, and the amount of salt per gallon remains constant as well at 1 lb/gal, therefore, the rate-in is r1 = 3 gal/min * 1 lb/gal = 3 lb/minRate-out: the amount of liquid leaving the tank per minute remains constant at 2 gal/min but the amount of salt per gallon does not because the concentration of the salt is constantly changing due to the entering and leaving liquid, to calculate the variable amount of salt per gallon we divide the amount of salt in the tank Q at a given time by the volume of liquid at given time, this volume can be calculated as the initial content of liquid (200 gal) plus the net amount of liquid entering the tank (liquid entering the tank minus liquid leaving it) multiplied by time, the volume at a given time is ((3 gal/min - 2 gal/min)*t + 200 gal), therefore, the rate-out is r2 = 2 gal/min * Q/(t*(1 gal/min)+200)

Collecting everything said:

dQ/dt = r1 - r2 = 3 lb/min - 2 gal/min * Q/(t*(1 gal/min)+200)

Note:

The units are really important when solving the equation As you can see from our result the amount of solution in the tank depends on the timeThe initial condition Q(0) = 100 describe the amount of salt at t = 0 and is fundamental to solve the differential equation

what is the difference between a composite number and a prime number?​

Answers

Answer:

Step-by-step explanation:

Prime numbers are numbers that are divisible by itself and '1'. This means prime numbers are numbers with just two factors while composite numbers are numbers that are divisible by more than two numbers, that is they have more than 2 factors.

Example of prime numbers are 5,7,11 etc. We see that these numbers are only divisible by themselves and by '1' while examples of composite numbers are 10, 15, 20, etc. We clearly see that these numbers have more than 2factors.

Prime numbers are divisible by only 2 numbers: 1 and themselves.

Composite numbers have 3 or more factors.

Hope this helps!

#HaveAnAmazingDay

[tex]GraceRosalia[/tex]

~Just a joyful teen

5. Two vertices of a triangle lie at (4, 0) and (8, 0). The perimeter of the triangle is 12 units. What are all the possible locations of the third vertex? How do you know you have found them all? Can you determine which of these vertices will produce a triangle with the largest area?

Answers

Final answer:

The possible locations of the third vertex of the triangle with a perimeter of 12 units, given two vertices at (4, 0) and (8, 0), are (12, 0) and (0, 0). The vertex at (0, 0) will produce a triangle with the largest area equals to 8 square units.

Explanation:

Possible Locations of Third Vertex:

To find the possible locations of the third vertex of the triangle, we need to consider the perimeter of the triangle. Given that the perimeter is 12 units and two vertices are located at (4, 0) and (8, 0), we can deduce that the third vertex must lie on the line segment between these two points.

Calculating the Third Vertex:

Since the distance between the two given vertices is 8 - 4 = 4 units, the remaining distance to achieve a perimeter of 12 units would be 12 - 4 = 8 units.

Therefore, the possible locations of the third vertex are (4 + 8, 0) = (12, 0) or (8 - 8, 0) = (0, 0).

Determining the Largest Area:

To determine which vertex would produce a triangle with the largest area, we need to consider the base and the height of the triangle. Since both the possible vertices lie on the x-axis, the base would be the same for both triangles, which is 4 units.

The height of the triangle can be determined by finding the distance between the base and the y-coordinate of the third vertex. If the third vertex is (12, 0), the height would be 0 units. If the third vertex is (0, 0), the height would be 4 units.

Therefore, the triangle with the third vertex at (0, 0) would produce the largest area, which is equal to 1/2 * base * height = 1/2 * 4 * 4 = 8 square units.

The possible locations of the third vertex of the triangle form a line segment parallel to the x-axis and symmetric about the y-axis, extending from (4, 3) to (8, -3) or from (4, -3) to (8, 3). The triangle with the largest area will be the one where the third vertex is directly above or below the midpoint of the line segment joining the first two vertices, at either (6, 3) or (6, -3).

Given two vertices of a triangle at (4, 0) and (8, 0), the distance between them is the length of the line segment joining them, which is 8 - 4 = 4 units. Since the perimeter of the triangle is 12 units, the sum of the lengths of the other two sides must be 12 - 4 = 8 units.

Let's denote the third vertex as (x, y). The distance from (4, 0) to (x, y) is one side of the triangle, and the distance from (8, 0) to (x, y) is the other side. Using the distance formula, we have:

[tex]\[ \sqrt{(x - 4)^2 + y^2} + \sqrt{(x - 8)^2 + y^2} = 8 \][/tex]

To simplify the problem, we can look for points where the sum of the distances to the two fixed points is 8 units. Since the two given vertices are on the x-axis, the third vertex must be such that its x-coordinate is between 4 and 8 (inclusive) to form a triangle.

For the y-coordinate, we know that the sum of the distances from the third vertex to the two fixed points is 8 units. If we consider the case where y = 0, the third vertex would be on the x-axis, which would not form a triangle. Therefore, y must be non-zero.

Let's consider the two sides of the triangle formed by the third vertex and the two fixed points. The lengths of these sides can be thought of as the radii of two circles, one centered at (4, 0) and the other at (8, 0), both with a radius of 4 units (since each circle's radius is half the sum of the lengths of the two sides not on the x-axis).

The third vertex must lie on the intersection of these two circles. Since the circles are of equal radius and their centers are 4 units apart, they will intersect in two points, which will be equidistant from the line segment joining the first two vertices.

To find these points, we can set up the following system of equations based on the distance formula:

[tex]\[ (x - 4)^2 + y^2 = 16 \][/tex]

[tex]\[ (x - 8)^2 + y^2 = 16 \][/tex]

The line segment joining these two points, (6, 3) and (6, -3), represents all possible locations of the third vertex. This line segment is parallel to the x-axis and symmetric about the y-axis, and it extends from (4, 3) to (8, -3) or from (4, -3) to (8, 3), depending on which side of the x-axis the third vertex is located.

To find the vertex that produces the largest area, we note that for a given base length (which is fixed at 4 units in this case), the area of a triangle is maximized when the height is maximized. The height is maximized when the third vertex is directly above or below the midpoint of the base, which is at (6, 0). Therefore, the third vertex should be at either (6, 3) or (6, -3) to produce the triangle with the largest area. The area of this triangle is 1/2 * base * height = 1/2 * 4 * 3 = 6 square units.

We have found all possible locations of the third vertex because any point outside the line segment joining (6, 3) and (6, -3) would result in a perimeter greater than 12 units, and any point inside would result in a perimeter less than 12 units. Thus, the line segment from (4, 3) to (8, -3) or from (4, -3) to (8, 3) represents the complete set of solutions for the third vertex that satisfy the given perimeter constraint.

Holiday Inn would like to estimate the satisfaction level of its customers. A sample of 25 hotels were selected and the customers at these locations were asked to rate their experience on a scale of 1-10. Based on this sample data, Holiday Inn will draw a conclusion about the satisfaction level of their customers. This is an example of using _____________.

Answers

Answer:

The answer to the question is

Inferential statistics

Step-by-step explanation:

Inferential statistics is used to make informed conclusions about a population that cannot be completely sampled due to the population size.

With Inferential statistics, it is possible to make predictions or inferences from available data. It involves collecting data from a random sample of individuals within the population concerned and make generalizations about the entire population from those samples.

Answer: The answer to the question is

Inferential statistics

Step-by-step explanation:

Inferential statistics is used to make informed conclusions about a population that cannot be completely sampled due to the population size.

With Inferential statistics, it is possible to make predictions or inferences from available data. It involves collecting data from a random sample of individuals within the population concerned and make generalizations about the entire population from those samples.

Whats an explicit rule for this? 1, -4, -9, -14, etc. Write an explicit formula for the nth term an.

Answers

Answer:

-5n + 6

Step-by-step explanation:

It goes up in the - 5 times tables and you have to add 6 to get the real answer.

Find the difference between numbers to find the n. (-5n bit)

List the Octal and Hexadecimal numbers from 16 to 32. Using A and B as the last two digits (A representing a value of 10 and B representing a value of 11), list the numbers from 8 to 28 in base 12.

Answers

Answer:

  see attached

Step-by-step explanation:

The attached list shows base-10 numbers in the left column, followed by their equivalents in base 8, base 16, and base 12.

Counting is done in the usual way: when you come to the last digit of the particular base, you increment the next digit to the left, and start over.

Final answer:

The Octal numbers from 16 to 32 and the Hexadecimal numbers from 16 to 32 are listed. Additionally, numbers from 8 to 28 are provided in base 12 system, where A and B are two last digits representing 10 and 11 respectively.

Explanation:

The Octal numbers from 16 to 32 are as follows: 20, 21, 22, 23, 24, 25, 26, 27, 30, 31, 32, 33, 34, 35, 36, 37, 40.

The Hexadecimal numbers from 16 to 32 are: 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 1A, 1B, 1C, 1D, 1E, 1F, 20.

For base 12 numbers from 8 to 28, where A stands for 10 and B for 11, they are: 8, 9, A, B, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 1A, 1B, 20, 21, 22, 23.

Learn more about Number Systems here:

https://brainly.com/question/32035615

#SPJ3

If you use a 95% confidence level in a two-tail hypothesis test, what will you decide about your Null Hypothesis if the computed value of the test statistic is Z = 2.57? Why?

Answers

Answer:

z_{calc}=2.57[/tex]

Since is a two-sided test the p value would be:  

[tex]p_v =2*P(z>2.57)=0.0101[/tex]  

If we compare the p value and the significance level given [tex]\alpha=0.05[/tex] we see that [tex]p_v<\alpha[/tex] so we can conclude that we have enough evidence to reject the null hypothesis, so we can conclude that the true mean is different from [tex]\mu_o[/tex] at 5% of signficance.  

Step-by-step explanation:

Data given and notation  

[tex]\bar X[/tex] represent the sample mean

[tex]\sigma[/tex] represent the population standard deviation

[tex]n[/tex] sample size  

[tex]\mu_o [/tex] represent the value that we want to test  

Confidence = 95% or 0.95

[tex]\alpha=1-0.95=0.05[/tex] represent the significance level for the hypothesis test.  

z would represent the statistic (variable of interest)  

[tex]p_v[/tex] represent the p value for the test (variable of interest)  

State the null and alternative hypotheses.  

We need to conduct a hypothesis in order to check if the mean is equal to an specified value [tex]\mu_o [/tex], the system of hypothesis would be:  

Null hypothesis:[tex]\mu =\mu_o[/tex]  

Alternative hypothesis:[tex]\mu \neq \mu_o[/tex]  

Since we know the population deviation, is better apply a z test to compare the actual mean to the reference value, and the statistic is given by:  

[tex]z=\frac{\bar X-\mu_o}{\frac{\sigma}{\sqrt{n}}}[/tex] (1)  

z-test: "Is used to compare group means. Is one of the most common tests and is used to determine if the mean is (higher, less or not equal) to an specified value".  

Calculate the statistic  

We can replace in formula (1) and we got a value calculated let's say [tex] z_{calc}=2.57[/tex]

P-value  

Since is a two-sided test the p value would be:  

[tex]p_v =2*P(z>2.57)=0.0101[/tex]  

Conclusion  

If we compare the p value and the significance level given [tex]\alpha=0.05[/tex] we see that [tex]p_v<\alpha[/tex] so we can conclude that we have enough evidence to reject the null hypothesis, so we can conclude that the true mean is different from [tex]\mu_o[/tex] at 5% of signficance.  

For a 95% confidence level in a two-tail hypothesis test, if the computed Z-value is 2.57, you would reject the null hypothesis, as the value lies outside the critical z-scores of ±1.96, indicating statistical significance.

If you use a 95% confidence level in a two-tail hypothesis test, the critical z-scores are ±1.96.

This means that if the computed test statistic falls beyond these values (either less than -1.96 or greater than +1.96), we reject the null hypothesis.

In the scenario where the computed value of the test statistic is Z = 2.57, it is greater than +1.96. Therefore, under these conditions, you will reject the null hypothesis.

The reason for this decision stems from the test statistic lying outside the range of values considered to be consistent with the null hypothesis at the 95% confidence level.

The absolute value of 2.57 is greater than 1.96, indicating that the observed effect is statistically significant, and the likelihood of observing such a result if the null hypothesis were true is less than 5% (which is the alpha level of 0.05 associated with a 95% confidence level).

This indicates that there is sufficient evidence to support the alternative hypothesis over the null hypothesis in a two-tailed test.

Consider purchasing a system of audio components consisting of a receiver, a pair of speakers, and a CD player. Let A1 be the event that the receiver functions properly throughout the warranty period. Let A2 be the event that the speakers function properly throughout the warranty period. Let A3 be the event that the CD player functions properly throughout the warranty period. Suppose that these events are (mutually) independent with P(A1) = 0.91, P(A2) = 0.85, and P(A3) = 0.77.(a) What is the probability that at least one component needs service during the warranty period?(b) What is the probability that exactly one of the components needs service during the warranty period?

Answers

Answer:

(a) Probability that at least one component needs service during the warranty period = 0.4044.

(b) Probability that exactly one of the components needs service during the warranty period = 0.3419.

Step-by-step explanation:

Given A1 be the event that the receiver functions properly throughout the warranty period.

A2  be the event that the speakers function properly throughout the warranty period.

A3 be the event that the CD player functions properly throughout the warranty period.

Also P(A1) = 0.91, P(A2) = 0.85, and P(A3) = 0.77.

Now P(A1)' means that the receiver need service during the warranty period which is 1 - P(A1) = 1 - 0.91 = 0.09.

Similarly,P(A2)' =1 - P(A2) =1 - 0.85 =0.15  and  P(A3)' =1 - P(A3)=1 - 0.77 = 0.23

Note: The ' sign on the P(A1) represent compliment of A1 or not A1.

(a) The probability that at least one component needs service during the warranty period = 1 - none of the component needs service during the warranty period

And none of the component needs service during the warranty period means that all the three components functions properly during the warranty period .

So, Probability that at least one component needs service during the warranty period = 1 - P(A1) x P(A2) x P(A3) = 1 - (0.91 x 0.85 x 0.77) = 0.4044.

(b) Now to find the Probability that exactly one of the components needs service during the warranty period, there would be three cases for this:

Receiver needs service and other two does not need during the warranty period.Speaker needs service and other two does not need during the warranty period.CD player needs service and other two does not need during the warranty period.

And we have to add these three cases to calculate above probability.

Probability that exactly one of the components needs service during the warranty period = P(A1)' x P(A2) x P(A3) + P(A1) x P(A2)' x P(A3) + P(A1) x  P(A2) x P(A3)'

                         = 0.09 x 0.85 x 0.77 + 0.91 x 0.15 x 0.77 + 0.91 x 0.85 x 0.23

                         = 0.3419.

Answer:

(a) P (At least one component needs service) = 0.404

(b) P (Either component A₁ or A₂ or A₃) = 0.997

Step-by-step explanation:

Given:

[tex]A_{1}=[/tex] Event that the receiver functions properly throughout the warranty period.

[tex]A_{2}=[/tex] Event that the speakers function properly throughout the warranty period.

[tex]A_{3}=[/tex] Event that the CD player functions properly throughout the warranty period.

[tex]P(A_{1})=0.91,\ P(A_{2})=0.85\ and\ P(A_{3})=0.77[/tex]

(a)

Compute the probability that at least one component needs service during the warranty period:

P (At least one component needs service) = 1 - P (None of the one component needs service)

= 1 - {P ([tex]A_{1}[/tex]) × P ([tex]A_{2}[/tex]) × P ([tex]A_{3}[/tex])}

[tex]=1 - (0.91\times0.85\times0.77)\\=1-0.595595\\=0.404405\\\approx0.404[/tex]

Thus, the probability that at least one component needs service during the warranty period is 0.404.

(b)

Compute the probability that exactly one of the components needs service during the warranty period, i.e. P (Either A₁ or A₂ or A₃):

[tex]P(A_{1}\cup A_{2}\cup A_{3})=P(A_{1})+P(A_{2})+P(A_{3})-P(A_{1}\cap A_{2})-P(A_{2}\cap A_{3})-P(A_{3}\cap A_{1})+P(A_{1}\cap A_{2}\cap A_{3})\\=P(A_{1})+P(A_{2})+P(A_{3})-[P(A_{1})\tmes P(A_{2})]-[P(A_{2})\tmes P(A_{3})]-[P(A_{3})\tmes P(A_{1})] +[P(A_{1})\tmes P(A_{2})\times P(A_{3})]\\=0.91+0.85+0.77-(0.91\times0.85)-(0.85\times0.77)-(0.77\times0.91)+(0.91\times0.85\times0.77)\\=0.996895\\\approx0.997[/tex]

Thus, the probability that exactly one of the components needs service during the warranty period is 0.997

The position of a particle moving along a coordinate line is s = √63 + 6t , with s in meters and t in seconds. Find the rate of change of the particle's position at t = 3 sec.

Answers

Answer:

0.33 m/s

Step-by-step explanation:

Given,

s = √(63+6t)..................... Equation 1

s' = ds/dt

Where s' = rate of change of the particles position.

Differentiating equation 1,

s = (63+6t)¹/²

s' = 6×1/2(63+6t)⁻¹/²

s' = 3(63+6t)⁻¹/²

s' = 3/√(63+6t)........................ Equation 2

At t = 3 s,

Substitute the value of t into equation 2

s' = 3/√(63+6×3)

s' = 3/√(63+18)

s' = 3/√(81)

s' = 3/9

s' = 0.33 m/s.

Hence the rate of change of the particles position = 0.33 m/s

Answer:

ds/dt = 0.33 m/s

Therefore, the rate of change of the particle's position at t = 3 sec is 0.33 m/s

Step-by-step explanation:

Given;

The position function of the particle.

s(t) = √(63+6t)

The rate of change of the particle's position = ds/dt = s(t)'

Using function of function rule.

Let u = 63+6t

s = √u

ds/dt = du/dt × ds/du

du/dt = 6

ds/du = 0.5u^(-0.5) = 0.5/u^(0.5) = 0.5/(63+6t)^(0.5)

ds/dt = 6 × 0.5/(63+6t)^(0.5)

ds/dt = 3/(63+6t)^(0.5)

At t = 3sec

ds/dt = 3/(63+6(3))^(0.5) = 3/9

ds/dt = 0.33 m/s

Therefore, the rate of change of the particle's position at t = 3 sec is 0.33 m/s

Which requires that the brakes of a car do the most amount of work? 1. None of these 2. Slowing down from 50 km/h to rest 3. Both require the same work 4. Slowing down from 100 km/h to 50 km/h 5. Not enough information is given

Answers

Answer:

4. Slowing down from 100 km/h to 50 km/h

Step-by-step explanation:

The work done by car is given as the change in the kinetic energy of the car. Mathematically,

W = ΔK

where

W = work done by the brakes.

ΔK = Change in kinetic energy.

Kinetic Energy is given as:

[tex]K = \frac{1}{2}mv^{2}[/tex]

Case 1: The car goes from 50 km/h to 0 km/h

ΔK = [tex]K_{f} - K_{i}[/tex]

ΔK =  [tex](\frac{1}{2}*50^{2}*m) - (\frac{1}{2}*0^{2}*m)[/tex]

ΔK = 1250m J

W = 1250m J

Case 2: The car goes from 100 km/h to 50 km/h

ΔK = [tex]K_{f} - K_{i}[/tex]

ΔK = [tex](\frac{1}{2}*100^{2}*m) - (\frac{1}{2}*50^{2}*m)[/tex]

ΔK = 5000m - 1250m

ΔK = 3750m J

W = 3750m J

Note: Mass of the car is constant.

Hence, slowing down from 100 km/h to 50 km/h requires the brakes to do more work, precisely 3 times more work [tex](3750m/1250m = 3)[/tex]

Final answer:

The work done by car brakes is greatest when slowing down from 100 km/h to 50 km/h, as more kinetic energy needs to be dissipated compared to slowing down from 50 km/h to rest.

Explanation:

The question pertains to the work done by brakes when slowing down a car. The work done to slow a car down is directly related to the car's kinetic energy, which depends on the square of its velocity. Therefore, slowing down from a higher speed requires more work, as it involves dissipating a larger amount of kinetic energy. Specifically, the work done by the brakes on a car slowing down from 100 km/h to 50 km/h is greater than the work required for a car slowing down from 50 km/h to rest. This is because the kinetic energy at 100 km/h is four times greater than at 50 km/h due to kinetic energy's dependence on the square of velocity (KE = 1/2 mv²).

Find the proportion of observations (±0.0001) from a standard Normal distribution that falls in each of the following regions. In each case, sketch a standard Normal curve and shade the area representing the region.
(a) z gif.latex?%5Cleqslant ?2.34:
(b) z gif.latex?%5Cgeqslant ?2.34:
(c) z > 1.74:
(d) ?2.34 < z < 1.74:

Answers

Answer:

a) We can use the following excel code to find it:"=NORM.DIST(-2.34,0,1,TRUE)"

[tex] P(Z \leq -2.34)=0.0096[/tex]

b) [tex] P(Z \geq -2.34)= 1-P(X \leq -2.34)= 1-0.0096=0.9904[/tex]

c) We can use the following excel code: "=1-NORM.DIST(1.74,0,1,TRUE)"

[tex] P(Z > 1.74)= 1-P(X \leq 1.74)=0.0409[/tex]

d) We can use the following excel code: "=NORM.DIST(1.74,0,1,TRUE)-NORM.DIST(-2.34,0,1,TRUE)"

[tex] P(-2.34<Z < 1.74)= P(Z<1.74)-P(Z<-2.34)=0.959-0.0096=0.949[/tex]

Step-by-step explanation:

Previous concepts

Normal distribution, is a "probability distribution that is symmetric about the mean, showing that data near the mean are more frequent in occurrence than data far from the mean".

The Z-score is "a numerical measurement used in statistics of a value's relationship to the mean (average) of a group of values, measured in terms of standard deviations from the mean".  

Part a

We want to find this probability:

[tex] P(Z \leq -2.34)[/tex]

And we can use the following excel code to find it:"=NORM.DIST(-2.34,0,1,TRUE)"

[tex] P(Z \leq -2.34)=0.0096[/tex]

Part b

We want to find this probability:

[tex] P(Z \geq -2.34)[/tex]

And for this case we can use the complement rule:

[tex] P(Z \geq -2.34)= 1-P(X \leq -2.34)[/tex]

And using the result from part a we got:

[tex] P(Z \geq -2.34)= 1-P(X \leq -2.34)= 1-0.0096=0.9904[/tex]

Part c

We want to find this probability:

[tex] P(Z > 1.74)[/tex]

And for this case we can use the complement rule:

[tex] P(Z > 1.74)= 1-P(X \leq 1.74)[/tex]

And we can use the following excel code: "=1-NORM.DIST(1.74,0,1,TRUE)"

[tex] P(Z > 1.74)= 1-P(X \leq 1.74)=0.0409[/tex]

Part d

We want to find this probability:

[tex] P(-2.34<Z <1.74)[/tex]

And for this case we can find this probability with this difference:

[tex] P(-2.34<Z < 1.74)= P(Z<1.74)-P(Z<-2.34)[/tex]

And we can use the following excel code: "=NORM.DIST(1.74,0,1,TRUE)-NORM.DIST(-2.34,0,1,TRUE)"

[tex] P(-2.34<Z < 1.74)= P(Z<1.74)-P(Z<-2.34)=0.959-0.0096=0.949[/tex]

Final answer:

The given z-scores correspond to various portions of a standard Normal distribution. Using a standard Normal distribution table, the proportions for the respective regions are derived as: z <= -2.34 is approximately 0.0094, z >= -2.34 is approximately 0.9906, z > 1.74 is approximately 0.0409, -2.34 < z < 1.74 is approximately 0.9497.

Explanation:

To answer your question, let's use the standard Normal distribution table which provides the proportion of observations less or equal to a particular z-score (for the values of z <= 0 and z >= 0).

For z <= -2.34: The proportion is simply the value associated with -2.34 in the standard Normal distribution table, which is approximately 0.0094.For z >= -2.34: This is equivalent to 1 minus the proportion of z <= -2.34, so it will be 1 - 0.0094 = 0.9906.For z > 1.74: Using similar approach, we get 1 minus the value associated with 1.74, which will be approximately 1 - 0.9591 = 0.0409.For -2.34 < z < 1.74: Here, we need to subtract the value of z <= -2.34 from the value of z <= 1.74. So, the proportion is 0.9591 - 0.0094 = 0.9497.

Please remember that these proportions represent the areas under the curve (or the total probability) that the z-score will fall within the outlined regions.

Learn more about Standard Normal Distribution here:

https://brainly.com/question/30390016

#SPJ3

what is the relationship between the point (4,7) and the vector [4,7]? Illustrate with a sketch.

Answers

The vector [4,7] represents the direction from the origin to the point (4,7). It has the same numerical values for both x and y components.

In mathematics,

A point represents a specific location in space, while a vector represents both magnitude and direction.

However, when the components of a vector match the coordinates of a point, we can say that the vector points from the origin to that specific point.

So in this case,

The vector [4,7] can be thought of as pointing from the origin (0,0) to the point (4,7).

It's like an arrow starting from the origin and ending at the point (4,7).

To learn more about vectors visit:

https://brainly.com/question/12937011

#SPJ12

The point (4,7) marks a specific location in the Cartesian coordinate system, while the vector [4,7] represents a direction and magnitude from the origin to the point. In a graphical representation, a vector is drawn as an arrow from the origin to the point, showing displacement, while a point is just a dot marking a location.

The relationship between the point (4,7) and the vector [4,7] is that the point can represent a location in a two-dimensional space, while the vector can represent both direction and magnitude from the origin (0,0) to that point. If we draw a Cartesian coordinate system, the point (4,7) would be the location where the x-coordinate is 4 and the y-coordinate is 7. The vector [4,7], on the other hand, would be represented as an arrow starting from the origin and ending at the point (4,7), effectively showing movement or displacement.In a sketch, you would see the origin, a dot at (4,7), and an arrow starting from the origin and pointing towards the dot, illustrating dependence of y on x. Moreover, the length of this arrow would be proportional to the magnitude of the vector, which in this case can be calculated using the Pythagorean theorem.It is important to note that different vectors can end at the same point, whereas a point has a fixed location. In vector addition or subtraction (like when dealing with forces on a particle), vectors are often combined or resolved into components, whereas points simply mark locations where these processes can be visually interpreted.

An early-warning detection system for aircraft consists of four identical radar units operating independently of one another. Suppose that each has a probability of 0.95 of detecting an intruding aircraft. When an intruding aircraft enters the scene, the random variable of interest is X, the number of radar units that do not detect the plane. Is this a binomial experiment?

Answers

Answer:

Yes, the given experiment is a binomial experiment.

Step-by-step explanation:

The conditions of the binomial experiment are

1. The trails are independent.

2. There are two possible outcomes i.e. success or failure.

3. The probability of success p remains constant on each trail.

4. The experiment is repeated fixed number of times n.

When an intruding aircraft enters the scene, the random variable X, the number of radar units that do not detect the plane indicates binomial experiment because

1. The four identical radar units are independent of each other.

2. There are two possible outcomes i.e. radar will detect the plane or radar will not detect the plane.

3. The probability of not detecting the plane p=0.05 remains constant on each trial. Here the probability of success is the probability of not detecting the plane can be calculated as

The probability of not detecting the plane=1- probability of detecting the plane

4. The experiment consists of four radar units i.e. n=4.

A machine set to fill soup cans with a mean of 20 ounces and a standard deviation of 0.11 ounces. A random sample of 15 cans has a mean of 20.04 ounces. Should the machine be reset?

A. Yes, the probability of this outcome at 0.080, would be considered unusual, so the machine should be reset
B. No the probability of this outcome at 0.358 would be considered usual, so there is no problem
C. No, the probability of this outcome at 0.080, would be considered usual, so there is no problem
D. Yes, the probability of this outcome at 0.920 would be considered unusual, so the machine should be reset

Answers

Answer:

C. No, the probability of this outcome at 0.080, would be considered usual, so there is no problem

Step-by-step explanation:

To solve this problem, it is important to know the Central Limit Theorem and the Normal probability distribution.

Central Limit Theorem

The Central Limit Theorem estabilishes that, for a random variable X, with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], a large sample size can be approximated to a normal distribution with mean [tex]\mu[/tex] and standard deviation [tex]\frac{\sigma}{\sqrt{n}}[/tex]

Normal Probability Distribution

Problems of normally distributed samples can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the zscore of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the pvalue, we get the probability that the value of the measure is greater than X.

When a probability is unusual?

A probability is said to be unusual if it is higher than 0.95 or lower than 0.05.

In this problem, we have that:

[tex]\mu = 20, \sigma = 0.11, n = 40, s = \frac{0.11}{\sqrt{15}} = 0.0284[/tex]

Should the machine be reset?

What is the probability of a mean of 20.04 or higher?

This is 1 subtracted by the pvalue of Z when X = 20.04. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{20.04 - 20}{0.0284}[/tex]

[tex]Z = 1.41[/tex]

[tex]Z = 1.41[/tex] has a pvalue of 0.92.

So the probability of this outcome is 1-0.92 = 0.08 = 8%.

8% is still an usual probability.

So the correct answer is:

C. No, the probability of this outcome at 0.080, would be considered usual, so there is no problem

Final answer:

The sample mean of 20.04 ounces can be calculated using the z-score formula to determine if the machine should be reset. The probability of obtaining this sample mean is extremely close to 1, indicating it is likely to occur by random chance. Therefore, the machine does not need to be reset.

Explanation:

To determine if the machine should be reset, we can calculate the probability of obtaining a sample mean of 20.04 ounces or higher, assuming the machine is still set to the mean of 20 ounces. We can use the z-score formula to standardize the sample mean. The formula is z = (x - μ) / (σ / sqrt(n)), where x is the sample mean, μ is the population mean, σ is the standard deviation, and n is the sample size. Plugging in the values, we have z = (20.04 - 20) / (0.11 / sqrt(15)) = 5.45.

Next, we can find the probability associated with this z-score using a z-table or a calculator. From the z-table, we find that the probability is approximately 0.99999999.

Since the probability is extremely close to 1, which means it is very likely to occur by random chance, we can conclude that the sample mean of 20.04 ounces is not significantly different from the mean of 20 ounces. Therefore, there is no need to reset the machine.

Learn more about Probability here:

https://brainly.com/question/32117953

#SPJ3

Find the sample space for the experiment.
You select two marbles (without replacement) from a bag containing two red marbles, two blue marbles, and one yellow marble. You record the color of each marble.

Answers

Answer:

5

Step-by-step explanation:

The sample space is considered to be the total number of possibilities in a given sample or study. Here we are told that the bag contains two red marbles, two blue marbles, and one yellow marble. So the sample space is 5, the total number of marbles available and possible in a selection

Final answer:

The sample space for selecting two marbles without replacement from a bag with two red, two blue, and one yellow marble consists of the pairs RR, RB, RY, BR, BB, BY, YR, YB.

Explanation:

When we are picking two marbles without replacement from a bag containing two red marbles, two blue marbles, and one yellow marble, we are dealing with a probabilistic experiment. To find the sample space of this experiment, we need to list all possible pairs of marbles that could result from this process.



Here are the possible combinations without replacement:

Yellow and Blue (YB)



Note that combinations like Red and Blue (RB) and Blue and Red (BR) are distinct since the marbles are drawn one after the other. With this comprehensive listing, we have fulfilled the task of defining the sample space, which consists of the following pairs: RR, RB, RY, BR, BB, BY, YR, YB.

Under what conditions might it make better sense to use a linear function rather than a quadratic or cubic function that fits a few data points more​ closely?

Answers

Answer:

Step-by-step explanation:

When data points are plotted between two variables, seeing the scatter plot we can form idea about the curve which is close to all points.

In other words, using least squares method, the curve of best fit would be the curve which has squares of deviations form the observed points a minimum

Thus conditions are

i) The scatter plot suggests a linear relationship

ii) Pearson correlation coefficient has value near to 1 or -1 suggesting linearlity

iii) There seems to be constant increase of y for unit increase in x

Under the above linear line fits

In all the other cases, quadratic or cubic function fits well.

Assume that 200 births are randomly selected and 6 of the births are girls. Use subjective judgment to describe the number of girls as significantly​ high, significantly​ low, or neither significantly low nor significantly high. Choose the correct answer below. A. The number of girls is neither significantly low nor significantly high. B. The number of girls is significantly low. C. The number of girls is significantly high.

Answers

Answer:

B. The number of girls is significantly low.

Step-by-step explanation:

Given that 200 births are randomly selected and 6 of the births are girls.

Normally we expect 50% of births to be boys and 50% girls.  If it is not exactly 50% atleast near to 50% we expect

But here out of 200 births, only 6 births are girls.

This means percentage of girls birth= [tex]\frac{6}{200} =0.03[/tex]=3%

while that of boys is 97%

This is a very unbalanced figure posing danger to the future generations.

B. The number of girls is significantly low.

Final answer:

The number of girls out of 200 randomly selected births is significantly low.

Explanation:

The number of girls out of a randomly selected group of 200 births is 6. To determine if this number is significantly high or low, we can use statistical methods. To do this, we can calculate the expected number of girls using probability. Assuming a 50% probability of having a boy or a girl, the expected number of girls would be 200 * 0.5 = 100. Comparing the observed number of girls (6) to the expected number (100), we can see that the number of girls is significantly low.

Learn more about Significance of Number of Girls here:

https://brainly.com/question/32444628

#SPJ3

A writer makes on average one typographical error every page. The writer has landed a 3-page article in an important magazine. If the magazine editor finds any typographical errors, they probably will not ask the writer for any more material. What is the probability that the reporter made no typographical errors for the 3-page article? Use the Poisson distribution and round your answer to 4 decimal places.

Answers

Answer:

The probability that the reporter made no typographical errors for the 3-page article is 0.7165.

Step-by-step explanation:

For Poisson Distribution:

p(k:λ) = [(λ^k)(e^-λ)]/k!

where k is the number of outcomes and λ is the rate at which the outcomes occur.

λ=np

where n=number of errors on one page

           p=probability that an error appears on a given page in the 3 page article

From the question we have n=1 and p=1/3. Computing these values:

λ=np

λ=1 x 1/3

λ=1/3

The question is asking for the probability that no error occurs in the 3-page article i.e. k=0. Using the Poisson formula mentioned above:

P(0:1/3) = (1/3)^0 e^(-1/3)/(0!)

            = (1)(0.7165)/1

P(0:1/3) = 0.7165

The probability that the reporter made no typographical errors for the 3-page article is 0.7165.

Final answer:

Using the Poisson distribution, the probability that a reporter makes no typographical errors in a 3-page article is estimated to be approximately 4.98%.

Explanation:

The probability of a reporter not making any typographical errors in a 3-page article can be calculated using the Poisson distribution. The Poisson distribution is commonly used for estimating the probability of a certain number of rare events occurring in a specified time or space.

The Poisson probability formula is P(x; μ) = (e^-μ) * (μ^x) / x!, where:
x = number of successes that result from the experiment
μ = average rate of success
e = mathematical constant approximately equal to 2.71828.

Plugging the given values into the formula gives us: P(0; 3) = (e^-3) * (3^0) / 0!. After simplifying this equation, we get an answer of approximately 0.0498 or 4.98% (rounded to four decimal places).

Therefore, the probability that the reporter made no typographical errors in the 3-page article is approximately 4.98%.

Learn more about Poisson distribution here:

https://brainly.com/question/33722848

#SPJ11

Other Questions
Which expression is equivalent to 5(8z) What mass of Na2CrO4 is required to precipitate all of the silver ions from 73.6 mL of a 0.150 M solution of AgNO3? Is this equation an infinite solution, no solution, or one solution?? 36-7x=-7(x-5) is A common theme in the Asian culture is the emphasis on harmony and collectivism, as a result, the ________ form of decision making is typically used. A. top-down B. decentralizedC. centralized D. committee E. autocratic In the context of debates over the origins of knowledge, Rene Descartes is to John Locke as ________ is to _______. Do you guys now how to estimate 69.58. Which legal right is not given to people under age 18?A) right to an attorneyB) right to be tried as a juvenile regardless of the crimeC) right to cross examine witnessesD) right to remain silent During the 1990s worker productivity growth spiked as computers and the internet were introduced to many businesses for the first time. How did this affect the natural unemployment rate? Consider the following statement: "I examined the statistics for our basketball teams wins last year and found that, when the third team played more, the winning margin increased. If the coach played the third team more, we would win by a bigger margin." Evaluate this statement. which lands did the french imperialists claim in 1884 Which link is missing from this food chain?O decomposerO herbivoreo producerO consumer Mauricio, a project manager at a reputed firm, has been assigned to handle a new project that the firm has received. This project involves a lot of scheduling that has to be handled by Mauricio. Mauricio estimates that the first module of the project could be completed in as few as 15 days or could take as many as 25 days, but most likely will require 20 days. Determine the expected task duration. which of the following phrases would represent this expression x/3 3)A triangle has all integer side lengths and two of those sides have lengths 9 and 16. Consider the altitudes to the three sides. What is the largest possible value of the ratio of any two of those altitudes Express your answer as a balanced chemical equation. Identify all of the phases in your answer.1. Li(s)+N2(g)Li3N(s)2. TiCl4(l)+H2O(l)TiO2(s)+HCl(aq)3. NH4NO3(s)N2(g)+O2(g)+H2O(g)4. Ca3P2(s)+H2O(l)Ca(OH)2(aq)+PH3(g)5. Al(OH)3(s)+H2SO4(aq)Al2(SO4)3(aq)+H2O(l)6.AgNO3(aq)+Na2SO4(aq)Ag2SO4(s)+NaNO3(aq)7. C2H5NH2(g)+O2(g)CO2(g)+H2O(g)+N2(g) A single penny is 1.52 mm thick. The distance to the next nearest star other than our own (Alpha Centauri) is 4.22 light-years. If it were possible to stack one mole of pennies, how many times would the stack go between the earth and Alpha Centauri? Use the unit factoring method to determine the answer and show your work. You will need to find or look up the appropriate conversion factors to solve the problem. Your answer should be in scientific notation and have the correct number of significant figures in order to get full credit. (Please note that the text editing functions/buttons below for this essay question allows you to show exponents by using the button show as "x2"in the controls. To use it type the number followed by the exponent such as 104, highlight the 4 and hit the x2 button and you will end up with 104 as the result) Janelle ate 82% of the pie. What fraction of the pie remained On a public ballot, a state legislature places a question relating to legalization of marijuana for medicinal use. In addition, the legislature passes a law that bans corporations from advertising in favor of or opposing the ballot question. The basis for this ban is to ensure that corporations do not have too much influence on the voters. Is the ordinance constitutional?a.Yes, because commercial speech has only partial First Amendment protection.b.No, because it concerns a question on a public ballot.c.Yes, because the government is advancing a substantial government interest.d.No, because the ban includes advertising that may not be protected by the First Amendment.e.No, because the government has banned politically oriented commercial speech. Which of the following is true of both starch and cellulose? a. They are both polymers of glucose. b. They are geometric isomers of each other. c. They can both be digested by humans. d. They are both used for energy storage in plants. e. They are both structural components of the plant cell wall. Jennifer has been diagnosed with spinocerebellar degeneration. The first stage of the disease involves tremors and unsteady gate. In the later stages, she will be unable to stand, walk, and will be uncoordinated in her movements. This disease probably affects the __________ part of the brain.a) hippocampusb) amygdalac) cerebellumd) cerebral cortex Steam Workshop Downloader