The perimeter of a rectangular concrete patio is 34 meters. the area is 70 square meters. what are the dimensions of the patio?

Answers

Answer 1
Final answer:

To find the dimensions of the rectangular patio, use the equations for perimeter and area and solve for length and width.

Explanation:

To find the dimensions of the rectangular patio, we can use the given information about its perimeter and area. Let's assume the length of the patio is L and the width is W.

The perimeter is given as 34 meters, which is equal to 2L + 2W. So, we have the equation 2L + 2W = 34.

The area is given as 70 square meters, which is equal to L * W. So, we have the equation L * W = 70.

We can use these equations to solve for L and W using substitution or elimination method.


Related Questions

Antonio purchased adult and child tickets for the fair. Tickets cost $29.35 for each adult and $17.45 for each child. Let x represent the number of adult tickets purchased and y represent the number of child tickets purchased. Write an expression to represent the total cost of the tickets Antonio purchased.


$29.35y + $17.45x

$29.35x + $17.45y

($29.35 + $17.45)(x + y)

($29.35 - $17.45)(x + y)

Answers

The Correct Answer for your problem is: B

29.35x + 17.45y Is the correct selection. 

The equations y = -0.38x + 56.6 and y = 0.38x + 43.4 represent the percent of men and women, respectively, receiving bachelor's degrees, where x is the number of years since 1968. in approximately what year did the same percent of men and women receive bachelor's degrees?

Answers

Begin by using simultaneous equations to find the values of x and y. 

y=-0.38x+56.6
y=0.38x+43.4 

-0.38x+56.6=0.38x+43.4 
-0.38x-0.38x=-56.6+43.4 
-0.76x=-13.3 
x=-13.3/-0.76 
x=17.5 

y=0.38(17.5)+56.6
y=63.25 

Knowing that the initial year was 1968, add 17.5 years to find to find out when the same percent of men and women received a bachelor's degree. 

1968+17.5= 1985.5 

So, in the year 1985 and half, both men and women got the same number of bachelor's degrees. 

Hope I helped :) 

Does believing in god increases the probability that god does exist

Answers

No.

If he exists then he does. More or less people "believing" doesn't change a fact.

It's like how we can't see all colors and other creatures can see "more" colors than us; and then having us claim they don't exist. Whether we decide to believe there's more colors we can't see or not will not change the fact of whether there IS or ISNT.

KInda if you love him then he loves personally i dont believe in him but thats everyone decision

To which graph does the point (8, −2) belong?

Answers

When you're given a list like that, the easiest way to find the answer is to just test the point in each one! Plug in -2 for y and 8 for x, and see which of the inequalities those values satisfy.

Solve for x.

7(x - 3) = 4(x + 5)

Answers

7(x-3) = 4(x+5)

distribute:

7x-21 = 4x+20

add 21 to both sides

7x = 4x +41

subtract 4x from both sides

3x = 41

divide both sides by 3

x = 41 /3 = 13.67 ( repeating 6's) so it can be 13 2/3 as a fraction

the answer is 13 2/3



find f(-5) if f(x) = ???????

Answers

f(x) = Ιx+1Ι

x = -5

Ι-5Ι = 5

so equation is 5+1

answer is 6

Jeffrey is planning to tile his bathroom. He is taking measurements before he goes to the hardware store to buy the tile. What is the best unit of measure for Jeffrey to use?

Answers

Square feet because it is an ideal unit to measure rooms.

Answer:

i think the answer would be square feet

Step-by-step explanation:


What is the numerator of the fraction equivalent to 25/135 that has a denominator of27

Answers

It's 5 because 5/27 is equal to 25/135

If the decay of 742 mg of an isotope is described by the function A(t)= 742e-0.03t, where t is time in years. Find the amount left after 84 years. Round your answer to the nearest mg. 

Answers

57.701 mg before rounding

Answer:

The amount left after 84 years is 59.70 mg.                        

Step-by-step explanation:

Given : If the decay of 742 mg of an isotope is described by the function [tex]A(t)= 742e^{-0.03t}[/tex], where t is time in years.

To find : The amount left after 84 years?

Solution :

The function of decay of 742 mg of an isotope is given by,

[tex]A(t)= 742e^{-0.03t}[/tex]

We have to find the amount left after 84 years.

i.e. put t=84 in the given function,

[tex]A(84)= 742e^{-0.03\times 84}[/tex]

[tex]A(84)= 742e^{-2.52}[/tex]

[tex]A(84)= 59.701[/tex]

Therefore, The amount left after 84 years is 59.70 mg.

Carly is 3 times her brother's age. The sun of their age is no more than 24 years.

Answers

brothers age = x

 carly's age = 3x

3x +x <=24

4x<=24

x<=24/4 = 6

brothers age is x<=6

 

Carly is 18 and her brother is 6

Solve x + 9 = 18 - 2x

Answers

Add 2x to both sides,
3x+9=18
Subtract 9 from both sides. 3x=9
Divide both sides by 3. 
x=3

The solution to the equation x + 9 = 18 - 2x is x = 3.

What is the solution to the equation?

Given the equation in the question:

x + 9 = 18 - 2x

To solve the equation x + 9 = 18 - 2x, first, collect and combine the x terms on one side of the equation and the constant terms on the other side:

x + 9 = 18 - 2x

Add 2x to both sides of the equation:

x + 2x + 9 = 18 - 2x + 2x

x + 2x + 9 = 18

3x + 9 = 18

Subtract 9 from both sides of the equation:

3x + 9 - 9 = 18 - 9

3x = 18 - 9

3x = 9

Isolate x by dividing both sides by 3:

x = 9/3

x = 3

Therefore, the value of x is 3.

Learn more about equations here: brainly.com/question/14686792

#SPJ6

What is the smallest number greater than 100 that is :
a)divisible by two ?
b)divisible by ten?
c)divisible by four ?

Answers

I'd start by listing out the multiplies of all three past 100, like this:
102, 104, 106, 108, 110, 112, 114, 116, 118, 120, 122, 124, 126, 128, 130
104, 108, 112, 116, 120, 124, 128, 132, 136
110, 120, 130, 140
Now it's just a matter of finding the number that is the same for all three of them, which is 120.

The smallest number greater than 100 divisible by 2 is 102, divisible by ten is 110, divisible by four is 104.

What is Divisibility Test?

It is an easy method of determining the divisibility of a number by a particular divisor, by just observing the number and not actually dividing it.

The number is 100

A smallest number greater than 100 has to be found which is divisible by 2.

All even numbers are divisible by 2, a number which has 0, 2, 4, 6, 8 at its ones position are divisible by 2.

The smallest number from 100 which is divisible by 2 is 102.

A smallest number greater than 100 has to be found which is divisible by 10.

A number is divisible by 10, if it has 0 at its ones position.

The number after 100 which has 0 at its ones position is 110.

A smallest number greater than 100 has to be found which is divisible by 4.

If last two digit of a number forms 00 or are divisible by 4, then the number is divisible by 4.

The smallest number from 100 which is divisible by 4 is 104.

To know more about Divisibility Rule

https://brainly.com/question/10703980

#SPJ5

Which equation best represents the line graphed above?

Answers

x=2 because for any y value the x value is always 2
the answer is y=2. i hope it helps

What is the expanded equivalent of cos(a – b)?

Answers

cos A cos B - sin A sin B
That should be your answer  Hope this helps

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770

A rabbit lure on a greyhound racetrack is set to travel once around the track at 50 feet per second, and then its speed is increased to 65 feet per second for the second loop around the track. If the total time it takes for the lure to go around the track twice is 184 seconds, what is the distance once around the track?

Answers

184 sec = Circumference / 50 fps + Circumference / 65 fps 
184 = 65 Circumference/3250 + 50 Circumference/3250 
184 = 115 Circumflex/3250 
598000 = 115 Circumflex 
Circumflex = 5200 ft
the answer would be 5200ft

Terry bought 2 1/2 dozen chocolate chip cookies. She paid $15 for her purchase. If there were 12 cookies in each dozen, what was the cost per cookie?


$0.17


$0.83


$1.25


$0.50

Answers

Your answer Is $0.50 have a nice day my friend 

2x7+2 ?
What does x =

Answers

The x is the variable so you have to find what the equation equals in order too find out what variable x is.  2 x7+2 = 16. So now x = 16

¿A Sandra qué le gusta hacer los viernes?

A A Sandra le gusta comer papas fritas los viernes.

B A Sandra le gusta comer agua los viernes.

C A Sandra le gusta beber pizza los viernes.

D A Sandra le gusta beber galletas los viernes.

Answers

I think the answer is A it makes the most sense. 
A states that "Sandra likes to eat fries on fridays."

B states that Sandra likes to eat water on fridays? (makes no sense)
C states that Sandra likes to drink pizza on fridays? (again makes no sense)
D states that Sandra likes to drink cookies on fridays? (NO SENSE)
Best answer choice is A.
La respuesta correcta es A: A Sandra le gusta comer papas fritas los viernes. Es el unico respuesta que es lógico. La traducción para la frase es: Sandra likes to eat french fries on Friday. 

Triangle A′B′C′ is the image of triangle ABC after a dilation. What is the scale factor of the dilation?

Answers

Unfortunately, I can't really explain it that well, but AB is 6, and A'B' is 2.
6 / 3 = 2
BC is 3, and B'C' is 1.
3 / 3 = 1
Therefore the dilation factor would be 1/3.

Hope this helps! :)

Let n be a nonzero integer. find a domain on which f (x) = (1 − xn)1/n coincides with its inverse. hint: the answer depends on whether n is even or odd.

Answers

I believe that the correct equation given is:

f(x) = (1-x^n)^(1/n)

 

From this, we can say that:

 

When n is an odd number then f(x) is cubic root function. The domain is (-infinite, +finite) 
When n is an even number then f(x) is sqrt root function. The domain is (0, +finite) 

what is the value for x (5x+15) (3x-3)

Answers

Final answer:

The value of x in the expression (5x+15) (3x-3) is 15x^2 + 30x - 45.

Explanation:

The expression (5x+15) (3x-3) represents the multiplication of two binomials. To find the value of x, we can use the distributive property to simplify the expression:

Multiply the terms within the first set of parentheses: 5x * 3x = 15x^2.Multiply the terms within the second set of parentheses: 5x * -3 = -15x.Multiply the terms between the parentheses: 15 * 3x = 45x.Multiply the constant terms within the parentheses: 15 * -3 = -45.

Putting it all together, we have 15x^2 - 15x + 45x - 45. Combining like terms, the expression simplifies to 15x^2 + 30x - 45.

So, the value for x in the given expression is 15x^2 + 30x - 45.

A sealed rectangular box measuring 8 x 6 x 18 contains 864 sugar cubes, each measuring 1 x 1 x 1. How many sugar cubes are touching the box?

Answers

Final answer:

A total of 456 sugar cubes touching the box.

Explanation:

To calculate the number of sugar cubes touching the box, we must consider the cubes that lie along each face of the box without double-counting the cubes that touch corners and edges.

The box dimensions are 8 x 6 x 18 inches, and each sugar cube is 1 x 1 x 1 inch.

For the top and bottom faces (6 x 18), we have

6*18 = 108 sugar cubes touching the box on each face, totaling 216 for both the top and bottom.

For the front and back faces (8 x 18), since we must exclude the top and bottom rows, we have

(8-2) x (18-2) = 6 x 16 = 96 sugar cubes for one face and 192 for both.

For the sides (8 x 6), excluding the top and bottom rows again, we have

(8-2) x (6-2) = 6 x 4 = 24 sugar cubes on one side and 48 in total for the two sides.

Adding all these together, we get 216 (top and bottom) + 192 (front and back) + 48 (sides) = 456 sugar cubes touching the box.

Remember, this method assumes a single layer of sugar cubes is in direct contact with the inside surface of the box.

What is the slope of a line that is perpendicular to the line that goes through (5,4) and (-2,-3)?

Answers

First, let us solve for the slope of the line which it intersects with:

m’ = (y2 – y1) / (x2 – x1)

m’ = (-3 – 4) / (-2 – 5)

m’ = 1

 

The slope of the perpendicular line is the negative reciprocal, therefore:

m = - 1 / m’

m = - 1 / 1

m = -1

 

So the slope of the line is -1.

Can someone please help me with math

Answers

1 meter is 3.3 ft.....so 70 meters is (70 * 3.3) = 231 ft.....so ft per second is 231 ft per second

at 2 seconds.....231 * 2 = 462 ft

What's 4.50+4.50+2.39+2.39+1.99? What's the answer minus 25?? pls halp meh '-'

Answers

4.50+4.50=9.00=9
+
2.39+2.39=4.78
+
1.99
=
15.77

15.77-25=-9.23

I brought 1 1/4 lbs of grapes. 2 1/2 lbs of cherries and 2lbs of bananas. How much total pounds of fruit did i buy?

Answers

First, add the whole numbers together:
1 + 2 + 2 = 5
Now, add the fractions together:
1/4 = 2/8
1/2 = 4/8
2/8 + 4/8 = 6/8 or 3/4
Add your two amounts together to get:
5 3/4 lbs of fruit

Hope this helps!! :)
1 + 2 + 2 = 5

1/4 + 1/2

1/4 + 2/4 = 3/4

The answer will be 5 3/4

Hope I helped

identify the like terms 3x,4y,4z,5x

Answers

the like terms are 5x and 3x because they both are apart of the x family !

Please help!
This graph shows the amount of rain that falls in a given amount of time.


What is the slope of the line and what does it mean in this situation?


Select from the drop-down menus to correctly complete each statement

The slope of the line is ___

This means that ___ mm of rain falls every ___

Answers

the slope is 5/2. count up 5 then go right 2. this means that 5 mm of rain falls every 2 hrs

To find the slope, we use the formula for slope,

[tex]m=\frac{y_{2}-y_{2}} {x_{2}-x_{1}}[/tex]

Letting the point (2,5) be [tex](x_{1},y_{1})[/tex] and the point (4,10) be [tex](x_{2},y_{2})[/tex].

Now plugging in these values in the formula for slope, we get,

[tex]m=\frac{10-5}{4-2} =\frac{5}{2}[/tex]. The slope is [tex]\frac{5}{2}[/tex].

This basically means 5 mm of rain falls in every 2 hours, or 2.5 mm of rain falls every hour ([tex]\frac{5}{2} =2.5[/tex])


ANSWER: Slope is [tex]\frac{5}{2}[/tex] and 5 mm of rain falls every 2 hours.

A measurement is given as the length of an onion cell is 0.4mm to the nearest tenth of a millimeter. Find the minimum & maximum possible measurements

Answers

The least number which approximates to 0.4mm to the nearest tenth is 0.35 while the largest number which approximates to 0.4mm to the nearest tenth is 0.449

Therefore, the minimum & maximum possible measurements are 0.35 and 0.449 respectively.
0.35mm-0.45mm The actual length of the onion cell must be something that rounds to .4mm. Anything lower than 0.35mm would be closer to .3mm and anything over .45 would be closer to .5mm.

Solve and justify each step
SHOW WORK

Solve: -4(n+5)>3n+8

Answers

-4n-20>3n+8

-7n-20>8

-7n<28
n<-4
Other Questions
the volume of a box is 1344 cubic inches. how many cubic inches are in one cubic foot? what is the volume of the box in cubic feet? What landform is 0 to 500 feet above sea level? Herpes can be passed via oral sex. True or False During the Lewis and Clark expedition, what happened during the expedition?A.Sacagawea and her child helped smooth relations with American Indians.B.the explorers found a water route from the Atlantic to the Pacific.C.the explorers ignored the natural world and focused on American Indians.D.many skilled people of the frontier helped to smooth relations with American Indians. How does fever help protect the body from pathogens is? In the necklace how did Mathilde's actions beliefs or interactions with others develop the conflict in the story? During meiosis, genetic recombination may occur more than once through the process of ____________________, resulting in an increase in genetic variability. A)transcription B)crossing over C)allele sequencing D)frameshift mutation With ______, books don't have to be printed on paper to be distributed. Whats 40% in fraction For a store contest, four out of every 65 people who visit the store will receive a free DVD. If 455 people visit the store, how many DVDs were given away Can please help me with this worksheet What are two key characteristics of a good scientific investigation? During the first phase of the American Revolution, most major battles took place near the cities of Boston, New York, and Philadelphia. Why would controlling this region have been an important goal for both sides in the war? images observed under the light microscope are reversed and inverted . explain what this meand Why did gender divisions of labor emerge during the industrial revolution? What was the purpose of Franklin Roosevelt's WPA How is a pair of molecular orbitals formed? how did Europeans change life in the Americas write the polynomial in standard form. Then name the polynomial based on its degree and the number of terms. 6-2x^3-3x+6x^3 When a pair of enantiomers is treated with a single (pure) enantiomer of another compound, the resulting mixture is? Steam Workshop Downloader