The lateral area of a right cone which has a base diameter of four units and a height of 10 units is:

Answers

Answer 1

since it has a diameter of 4, then its radius is half that, or 2.

[tex]\bf \textit{lateral area of a cone}\\\\ LA=\pi r\sqrt{r^2+h^2}~~ \begin{cases} r=radius\\ h=height\\ \cline{1-1} r=2\\ h=10 \end{cases}\implies LA=\pi (2)\sqrt{2^2+10^2} \\\\\\ LA=2\pi \sqrt{104}\implies LA\approx 64.076[/tex]

Answer 2

Answer:[tex]A = 64.076\ units^2[/tex]

Step-by-step explanation:

The  lateral area of right cone is calculated by the following formula

[tex]A = \pi r *\sqrt{r^2 +h^2}[/tex]

Where r is the radius of the cone and h is the height

In this case we know that the diameter d of the base is:

[tex]d=2r[/tex]

So the radius is:

[tex]r=\frac{d}{2}\\\\r=\frac{4}{2}\\\\r=2\ units[/tex]

and

[tex]h=10\ units[/tex]

So the area is:

[tex]A = \pi*2 *\sqrt{2^2 +10^2}[/tex]

[tex]A = 64.076\ units^2[/tex]


Related Questions

the length of a rectangle is 6cm longer than its width.
if the perimeter of the rectangle is 32cm, find its area.

Answers

Answer:

A = 55 cm²

Step-by-step explanation:

Here, L = W + 6 cm, and P = 2W + 2L = 2W + 2(W + 6 cm) = 32 cm

Then 2W + 2(W + 6 cm) = 32 cm becomes:

         2W + 2W + 12 cm = 32 cm, or

               4W                   = 20 cm.

Therefore, W = 20 cm / 4  =  5 cm

The area of this rectangle is A = L · W = (5 cm + 6 cm) · (5 cm), or

                                                             A = (11 cm)(5 cm), or A = 55 cm²

Final answer:

The area of the rectangle is calculated by solving for the width using the given perimeter, then finding the length, and finally multiplying the two. The width is 5 cm, the length is 11 cm, and the area is 55 cm².

Explanation:

Let's denote the width of the rectangle as w centimeters. According to the problem, the length of the rectangle is 6 cm longer than its width, so we can express the length as w + 6 cm.

The perimeter of a rectangle is calculated by the formula P = 2l + 2w, where P is the perimeter, l is the length, and w is the width. Given the perimeter is 32 cm, we can write the equation 2(w + 6) + 2w = 32.

Solving this equation:

2w + 12 + 2w = 32

4w = 32 - 12

4w = 20

w = 5 cm

Now that we have the width, we can find the length:

l = w + 6

l = 5 + 6

l = 11 cm

The area of the rectangle is found by multiplying the length by the width, A =[tex]l \(\times\) w[/tex], which gives us:

A = [tex]11 \(\times\) 5[/tex]

A = 55 cm²

The acceleration, a, of an object produced when a force is applied is given by the following formula, where F represents the force acting on the object and m represents the mass of the object.



If a has units of meters per second squared and m has units of grams, what must be the units of F?
A.
meters per second
B.
grams·meters per second squared
C.
grams
D.
grams·meters per second

Answers

I think it’s b I hop

Match the term with the definition

Answers

Answer:

Plane: C) A flat surface that extends infinitively and has no depth; it has length and width

Perpendicular Lines: B) Two lines that intersect at 90° angles

Parallel Lines: E) Two lines that lie within the same plane and never intersect

Circle: D) A set of all points in a plane that are given distance from a plane

Angle: A) A figure consisting of two rays with a common endpoint

I hope this helps

this is 100% correct

plz mark me brainliest

Use the perfect square method
(3x + 3)^2 = 36

Answers

Factor out the common term; 3

(3(x + 1))^2 = 36

Use the Multiplication Distributive Property; (xy)^a = x^ay^a

3^2(x + 1)^2 = 36

Simplify 3^2 to 9

9(x + 1)^2 = 36

Divide both sides by 9

(x + 1)^2 = 36/9

Simplify 36/9 to 4

(x + 1)^2 = 4

Take the square root of both sides

x + 1 = √4

Since 2 * 2 = 4, the square root of 2 is 2

x + 1 = 2

Break down the problem into these 2 equations

x + 1 = 2

x + 1 = -2

Solve the first equation; x + 1 = 2

x = 1

Solve the second equation; x + 1 = -2

x = -3

Collect all solutions;

x = 1, -3

Using a "15% off" coupon, Dianne saved $12.75 on a new chair for her home office. What was the chair's regular price? How much did she pay?​

Answers

Answer:

The original price was $85

She spent $72.25

Step-by-step explanation:

When x equals the price of the chair:

12.75/15 = x/100

15 x = 1275

x = $85

To find the price she paid:

85 - 12.75 = $72.25

Type the correct answer in the box. If necessary, use / for the fraction bar. A basket contains 14 white eggs, 15 brown eggs, and 11 lemons. Taylor is in a hurry to make breakfast and picks something from the basket at random. The exact probability that Taylor picks an egg from the basket is .

Answers

Answer:

29/40

Step-by-step explanation:

A basket contains 14 white eggs, 15 brown eggs, and 11 lemons. The exact probability that Taylor picks an egg from the basket is;

(14+15)/(14+15+11) = 29/40

Answer:

The exact probability that Taylor picks an egg from the basket is 0.725

Step-by-step explanation:

A basket contains 14 white eggs, 15 brown eggs and 11 lemons.

Total number of items in the basket [tex]=14+15+11= 40[/tex]

Total number of eggs in the basket [tex]=14+15= 29[/tex]

Taylor picks one item at random from the basket.

So, the probability that Taylor picks an egg [tex]=\frac{total\ number\ of\ eggs}{total\ number\ of\ items}=\frac{29}{40}=0.725[/tex]

The average revenue of a TV manufacturing unit is given by r(x)=75x^2-5x^3/2 where x is the number of TVs sold by the firm. Find the total revenue generated by the firm.

Answers

Answer:

The total revenue generated by the firm is:

[tex]P(x) = 75x^3-5x^{\frac{5}{2}}[/tex]

Step-by-step explanation:

The average cost per TV is:

[tex]r(x) =\frac{P(x)}{x}[/tex]

Where x is the number of televisions sold and P is the firm's income for all the televisions sold

In this problem we know the equation r(x).

Then P(x) will be:

[tex]P(x) = x*r(x)[/tex]

Therefore if [tex]r(x)=75x^2-5x^{3/2}[/tex] then

[tex]P(x) = x*(75x^2-5x^{3/2})[/tex]

[tex]P(x) = 75x^{2+1}-5x^{\frac{3}{2}+1}\\\\P(x) = 75x^3-5x^{\frac{5}{2}}[/tex]

Answer:

Px =75x^3-5x^5/2

Step-by-step explanation:

is an isosceles trapezoid below x=

Answers

Answer:13

Step-by-step explanation:

5x+15=7x-11

7x. 7x

2x+15=11

+15 +15

2x =26

———

2

x = 13

A trapezoid is a quadrilateral which is having a pair of opposite sides as parallel and the length of the parallel sides is not equal. The value of x is 13.

What is a Trapezoid?

A trapezoid is a quadrilateral which is having a pair of opposite sides as parallel and the length of the parallel sides is not equal.

In an isosceles trapezoid, the angles formed at the ends of any one of the parallel lines are congruent. Therefore, we can write,

5x+15 =7x-11

15+11=7x-5x

26=2x

x = 13

Hence, the value of x is 13.

Learn more about Trapezoid:

https://brainly.com/question/8643562

#SPJ2

NEED ASAP

A person walks for 100 yards then turns through an angle of 60° and walks another hundred yards. How far is she from her starting point?

Please help!! I’m not sure what formula to use!!

Answers

Answer:

[tex]100\ yd[/tex]

Step-by-step explanation:

we know that

Applying the law of cosines

[tex]c^{2} =a^{2}+b^{2}-2(a)(b)cos(C)[/tex]

In this problem we have

c-----> is the distance from her starting point

[tex]a=100\ yd[/tex]

[tex]b=100\ yd[/tex]

[tex]C=60\°[/tex]

substitute

[tex]c^{2} =100^{2}+100^{2}-2(100)(100)cos(60\°)[/tex]

[tex]c^{2} =10,000+10,000-10,000[/tex]

[tex]c^{2} =10,000[/tex]

[tex]c=100\ yd[/tex]

The sector of a circle with a 12-inch radius has a central angle measure of 60

What is the exact area of the sector in terms of pi

Answers

Answer:

24 π square inches

Step-by-step explanation:

The area of a circule is give by the formula A = π r²

Since we have a angle of 60 degrees, that represent 1/6th of the whole area (60 / 360 degrees).

A circle = π * 12² = 144 π square inches

Area of the portion representing 60 degrees of the circle, can easily be calculated with a cross-multiplication:

[tex]\frac{x}{144\pi } = \frac{60}{360}[/tex]

x = 144 π / 6 = 24 π square inches

The sum of four consecutive odd numbers is 40 what is the greatest of the four numbers

Answers

Answer:

13

Step-by-step explanation:

First find the average the numbers (40 / 4 = 10)

2 are more and 2 are less

7, 9, 11, 13

An odd number can be written as 2n+1, where n is an integer. Four consecutive odd numbers can be written as 2n-3, 2n - 1, 2n + 1 and 2n + 3. Adding these together gives you 8n, which we are told is 40. So n is 5 and the four consecutive odd numbers are 7, 9, 11 and 13.

2. What is the external probability of rolling a 4


3 what is the external probability of getting at least one tail

Answers

Answer:

2. 1- Experimental probability of rolling a 4 = 40%

3. 2- Theoretical probability is 3%  greater than experimental probability.

Step-by-step explanation:

Experimental probability of rolling a 4 = 100 × [tex]\frac{8}{20}[/tex]

                                                                  = 100 × 0.4

                                                                  = 40%

Experimental probability of getting at least one tail  = [tex]\frac{72}{100}[/tex]

                                                                                    = 0.72

Theoretical probability of getting at least one tail  = [tex]\frac{3}{4}[/tex]

                                                                                  = 0.75

Theoretical probability is 3%  greater than experimental probability.

If (-3) exponent -5 = 1/x, what is the value of x?
-243
- 1/243
1/243
243

Answers

Answer:

[tex]\boxed {-243}\\[/tex]

Step-by-step explanation:

[tex]\begin{array}{rclr}(-3)^{-5} & = & \dfrac{1}{x}& &\\(-3)^{5} & = & x &\text{Inverted each side of the equation}\\x & = & \boxed {\textbf{{-243}}}\\\end{array}[/tex]

10 points please help very easy

Answers

Answer:

165 KBS and 750 jump rope

Step-by-step explanation:

What is the volume of the come with radius 5 m and height 6 m ? Express the answer in terms of pi.
A. 35pi m^3
B. 47pi m^3
C. 50pi m^3
D. 63pi m^3

Answers

Answer:

C

Step-by-step explanation:

The volume (V) of a cone is calculated using the formula

V = [tex]\frac{1}{3}[/tex] πr² h

where r is the radius and h the perpendicular height

here r = 5 and h = 6, hence

V = [tex]\frac{1}{3}[/tex] × π × 5² × 6

   = 2π × 25 = 50π m³ → C

The volume of the cone is [tex]\( 50\pi \, \text{m}^3 \).[/tex]

How to get the volume of the cone

The formula for the volume v of a cone is given by:

[tex]\[ V = \frac{1}{3} \times \pi \times r^2 \times h \][/tex]

The variables in the formula are:

r is the radius of the base of the cone.

his the height of the cone.

Given a cone with radius r = 5 meters and height h = 6 meters, substitute these values into the formula:

[tex]\[ V = \frac{1}{3} \times \pi \times (5^2) \times 6 \]\[ V = \frac{1}{3} \times \pi \times 25 \times 6 \]\[ V = \frac{1}{3} \times \pi \times 150 \]\[ V = 50 \pi \][/tex]

Therefore, the volume of the cone is [tex]\( 50\pi \, \text{m}^3 \).[/tex]

there are 7 circles in a row. there are 3 rows complete story​

Answers

Wym is this multiplication

what makes n true 1/2 (n+4)=6

Answers

Answer: N=8

Step-by-step explanation: So 1/2*4=2 then you know that you need 4 to get to six because you already have two. Then 8/2=4 so N=8.

1/2(8+4)=6

4+2=6

6=6

Hope this helped!!!!!

Final answer:

To find the value of n that satisfies the equation 1/2 (n+4)=6, multiply both sides by 2 and subtract 4 from both sides to get n=8.

Explanation:

The student's question asks for the solution to the algebraic equation: 1/2 (n+4)=6. To solve for n, follow these steps:

Multiply both sides of the equation by 2 to get rid of the fraction: n + 4 = 12.Subtract 4 from both sides to isolate n: n = 12 - 4.Simplify the equation to find the value of n: n = 8.

Therefore, the value of n that makes the equation true is 8.

The Wall Street Journal reporter the biggest music comeback in 2014 was vinyl records. Nearly 8 million vinyl were sold in 2014, mostly to younger markets. If there were 15 vinyl record factories pressing records in the United States in 2014, and only 2/3 remain operational in 2015, how many factories closed down?

Answers

Answer:

5 factories closed

Step-by-step explanation:

In 2014 there were 15 operating factories.

We know that of those 15 factories only 2/3 remain operative.

If only 2/3 remain operational this means that 1/3 of them closed.

To calculate the number of factories that closed we must multiply the initial number of operative factories by 1/3.

This is:

[tex]15 * \frac{1}{3} = \frac{15}{3} = 5[/tex].

5 factories closed

Write the number which is exactly a third of the way from 2.6 to 3.5. Please explain how you get the answer.Thanks

Answers

3.5-2.6=0.9

0.9÷3=0.3

2.6+0.3=2.9

answer is 2.9

If I were to use the distributive property to simplify 3(10+15x) would you multiply 3 times 10 and add 15x to it?

Answers

Answer:

No!

The answer is 30 + 45x   See below. Very important question.

Step-by-step explanation:

No!

If you do that, you are violating the properties of the distributive property.

You must multiply both sides of the plus sign by 3

3(10 + 15x) = 3*10 + 3*15x

3(10 + 15x) = 30 + 45x

A roll of fabric was 120 inches long. A customer bought 3 feet of the fabric.

How many feet of fabric were remaining?

Answers

The 7 feet of fabric were remaining.

To solve this problem step by step:

1. Convert the length of the roll of fabric from inches to feet.

  - 120 inches ÷ 12 inches/foot = 10 feet

2. Subtract the length purchased by the customer from the total length of the roll.

  - 10 feet - 3 feet = 7 feet

So, the customer bought 3 feet of fabric, leaving 7 feet remaining.

1. To convert inches to feet, we know that there are 12 inches in a foot. So, we divide the length of the fabric in inches by 12 to get the length in feet.

  - 120 inches ÷ 12 inches/foot = 10 feet

2. Next, we subtract the length purchased by the customer (3 feet) from the total length of the roll (10 feet) to find out how much fabric remains.

  - 10 feet - 3 feet = 7 feet

Therefore, the customer bought 3 feet of fabric, leaving 7 feet remaining.

Complete question:

A roll of fabric was 120 inches long. A customer bought 3 feet of the fabric.

How many feet of fabric were remaining?

After 7 years, what is the total amount of a compound interest investment of an initial
principal of $1685 at a rate of 4.3% compounded quarterly?

A. 1942.18
B.373,709.25
C.2461.55
D.2273.13

Answers

Answer:

Option D. $2273.13

Step-by-step explanation:

we know that    

The compound interest formula is equal to  

[tex]A=P(1+\frac{r}{n})^{nt}[/tex]  

where  

A is the Final Investment Value  

P is the Principal amount of money to be invested  

r is the rate of interest  in decimal

t is Number of Time Periods  

n is the number of times interest is compounded per year

in this problem we have  

[tex]t=7\ years\\ P=\$1,685\\ r=0.043\\n=4[/tex]  

substitute in the formula above  

[tex]A=\$1,685 (1+\frac{0.043}{4})^{4*7}=\$2,273.13[/tex]  

 

Let me know the answer plz

Answers

Answer:

J

Step-by-step explanation:

Find the common ratio r of the geometric sequence then multiply a term by r to obtain the next term

r = [tex]\frac{a_{2} }{a_{1} }[/tex] = [tex]\frac{6}{-36}[/tex] = - [tex]\frac{1}{6}[/tex]

The next 3 terms are

[tex]\frac{1}{6}[/tex] × - [tex]\frac{1}{6}[/tex] = - [tex]\frac{1}{36}[/tex]

- [tex]\frac{1}{36}[/tex] × - [tex]\frac{1}{6}[/tex] = [tex]\frac{1}{216}[/tex]

[tex]\frac{1}{216}[/tex] × - [tex]\frac{1}{6}[/tex] = - [tex]\frac{1}{1296}[/tex]

Answer:

J. [tex]-\frac{1}{36}[/tex], [tex]\frac{1}{216}[/tex], [tex]-\frac{1}{1296}[/tex]

Step-by-step explanation:

We are given the following geometric sequence and we are to find its 8th term:

[tex]-36, 6, -1, \frac{1}{6},...[/tex]

Here [tex]a_1=-36[/tex] and common ratio [tex](r) = \frac{-1}{6}=\frac{-1}{6}[/tex].

The formula we will use to find the next three terms is:

nth term = [tex]a_1 \times r^{(n-1)}[/tex]

5th term = [tex]-36 \times \frac{-1}{6}^{(5-1)}[/tex]  = [tex]-\frac{1}{36}[/tex]

6th term = [tex]-36 \times \frac{-1}{6}^{(6-1)}[/tex]  = [tex]\frac{1}{216}[/tex]

7th term = [tex]-36 \times \frac{-1}{6}^{(7-1)}[/tex]  = [tex]-\frac{1}{1296}[/tex]

Use the quadratic formula to solve for the roots in the following equation. 4x 2 + 5x + 2 = 2x 2 + 7x – 1

Answers

Answer:

So, The roots are [tex]x= \frac{1+\sqrt{5}i}{2} \,\, and \,\,x= \frac{1-\sqrt{5}i}{2}[/tex]

Step-by-step explanation:

[tex]4x^2 + 5x + 2 = 2x^2 + 7x - 1[/tex]

We need to solve the equation to find the roots using quadratic formula.

The quadratic formula is:

[tex]x=\frac{-b\pm\sqrt{b^2-4ac}}{2a}[/tex]

Rearranging the above equation:

[tex]4x^2 -2x^2+ 5x-7x + 2+1 =0[/tex]

[tex]2x^2 -2x + 3 =0[/tex]

Where a =2 , b=-2 and c =3 Putting values in quadratic equation and solving:

[tex]x=\frac{-b\pm\sqrt{b^2-4ac}}{2a}\\x=\frac{-(-2)\pm\sqrt{(-2)^2-4(2)(3)}}{2(2)}\\x=\frac{2\pm\sqrt{4-24}}{4}\\x=\frac{2\pm\sqrt{-20}}{4}\\\sqrt{-20} \,\,can\,\,be\,\, written\,\, as\,\, 2\sqrt{-5}\\ x=\frac{2\pm2\sqrt{-5}}{4}\\x=\frac{2+2\sqrt{-5}}{4} \,\, and \,\, x=\frac{2-2\sqrt{-5}}{4}\\x=\frac{2(1+\sqrt{-5})}{4} \,\, and \,\, x=\frac{2(1-\sqrt{-5})}{4}\\ x=\frac{1+\sqrt{-5}}{2} \,\, and \,\, x=\frac{1-\sqrt{-5}}{2}\\As \,\,we\,\, know\,\, \sqrt{-1} = i \\[/tex]

[tex]x= \frac{1+\sqrt{5}i}{2} \,\, and \,\,x= \frac{1-\sqrt{5}i}{2}[/tex]

So, The roots are [tex]x= \frac{1+\sqrt{5}i}{2} \,\, and \,\,x= \frac{1-\sqrt{5}i}{2}[/tex]

Answer:

these numbers go in the spaces. short and simple.

1 5

2 2

mark brainliest please!

Step-by-step explanation:

I need help for number 7 please please

Answers

Answer:

They averaged 79 km per hour

Step-by-step explanation:

To find the average distance, take the kilometers and divide by the hours

1106 km/  14 hours

79 km / hours

They averaged 79 km per hour

79

79x14 is 1106. hope this helps

43 plus what equals 112

Answers

The number that when added to 43, would give the result of 112 can be found to be 69.

How to find the number ?

To find the number that, when added to 43, equals 112, you can use algebraic reasoning.

Let's represent the unknown number with the variable "x". The equation can be set up as:

43 + x = 112

To solve for "x," we need to isolate it on one side of the equation.

First, subtract 43 from both sides of the equation:

43 + x - 43 = 112 - 43

The 43 on the left side cancels out:

x = 112 - 43

Simplifying the right side of the equation:

x = 69

Find out more on addition at https://brainly.com/question/31055008

#SPJ6

Final answer:

To solve the equation 43 + x = 112, subtract 43 from both sides to isolate 'x'. The value of 'x' is 69.

Explanation:

To find the number that, when added to 43, equals 112, we can use algebra. Let's use the variable 'x' to represent the unknown number. So, the equation is 43 + x = 112.

To isolate 'x', we need to move 43 to the other side of the equation.

By subtracting 43 from both sides, we get x = 112 - 43. Evaluating the subtraction, we find that x = 69.

I have to find the volume and the surface area of a cereal box.
12 inches tall
8 inches wide
please show all your work

Answers

Answer:

Volume: 8x1x12=96 inches^3

Surface area: 8x1x2=16

1x12x2=24

8x12x2=192

the total surface is: 16+24+192=232 inches^2

12 in tall * 8 in wide = 96 in area. You need a third value to find a volume.

How to write 3.499 an Expanded Form and Word Form? PLEASE HELP ME

Answers

(3 x 1 ) + (4 x 0.1) + (9 x 0.01) + ( 9 x 0.001)

OR

3 + 0.4 + 0.09 + 0.009

Three and four hundred ninety-nine thousandths

Hope this helped!

Please need help badly. If the area of BAC=8, what is the area of EDF

Answers

Answer:im not sure but if im correct the answer should be 6

Step-by-step explanation:im assuming this cause if 8/4 is 2 then take the 2 and times it with the 3

Answer:

Area of ΔEDF = 4.5 in²

Work shown image:

Find the equation of the line that is perpendicular to y=-2/3x and contain the point (4,-8)

Answers

Answer:

y = 3/2x - 14.

Step-by-step explanation:

The slope of the perpendicular line  is - 1 / -2/3

= 3/2.

Using the point slope form y-y1 = m(x-x1):

y - (-8) = 3/2(x - 4)

y + 8 = 3/2x - 6

y = 3/2x - 14.

Answer:

y = [tex]\frac{3}{2}[/tex] x - 14

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

y = - [tex]\frac{2}{3}[/tex] x ← is in this form

with slope m = - [tex]\frac{2}{3}[/tex]

Given a line with slope m then the slope of a line perpendicular to it is

[tex]m_{perpendicular}[/tex] = - [tex]\frac{1}{m}[/tex] = - [tex]\frac{1}{-\frac{2}{3} }[/tex] = [tex]\frac{3}{2}[/tex], hence

y = [tex]\frac{3}{2}[/tex] x + c ← is the partial equation of the perpendicular line

To find c substitute (4, - 8) into the partial equation

- 8 = 6 + c ⇒ c = - 8 - 6 = - 14, so

y = [tex]\frac{3}{2}[/tex] x - 14 ← equation of perpendicular line

Other Questions
Plz help, its for my CFE in physical science honors.Glen is explaining the relationship between the wavelength and frequency of electromagnetic radiation to his friend, Harold. Which of the following would be a correct explanation of this relationship?A. All electromagnetic waves have the same frequency, but different wavelengthsB. If a wave has a long wavelength, it will have a low frequency. C. If a wave has a low frequency, it will have an equally low wavelength. D. The frequency of a wave is not related to its wavelength. Which statement best explains why women's rights activist were dissatisfied with the fifteenth amendment ? Lucky Jack wins the lottery! He deposits $100,000 in an account that earns 4% interest compounded continuously. How much money is in the account at the end of 5 years?A)$120,357B)$122,140C)$125,620D)$225,820 In the diagram, the radius of the outer circle is 2x cm andthe radius of the inside circle is 6 cm. The area of theshaded region is 200cm.What is the value of x? If the mean of six numbers is 41 and if one is removed the mean will be 46 what is the number being removed analyze the foot of the following phrase. pushy peoplenumber of feet: 4,2,1,3type of feet: anapestic, dactylic, trochaic, iambic Which table represents exponential growth? Which of the following statements are true? Check all that apply. View Available Hint(s) Check all that apply. The average speed of gas molecules decreases with decreasing temperature. The kinetic energy of a molecule cannot determine its speed. All the gas molecules in a sample cannot have the same kinetic energy. The average kinetic energy of gas molecules decreases with decreasing temperature. There are gas molecules that move slower than the average. Consider the chemical equations shown here.P4(s) + 3O2(g) P4O6(s) H1 = -1,640.1 kJP4O10(s) P4(s) + 5O2(g) H2 = 2,940.1 kJWhat is the overall enthalpy of reaction for the equation shown below?Round the answer to the nearest whole number.P4O6(s) + 2O2(g) --> P4O10(s) You need to determine the total distance each hiker will hike.And Determine the number off gallons of water each hiker will bring.ExplainUse picture PLEASE HELP ASAP!!! CORRECT ANSWER ONLY PLEASE!!!A politician wants to see what people in her district think about tax cuts. Which procedure would be a good way of conducting a survey? 15. A geologist discovers a sample of fine-grained rock made up of very small crystals. Based on its physical appearance, what can the geologist conclude about the rock? The Interstate Highway System influenced all of the following except the location ofA)IndustryB)The number of fast-food restaurantsC)The cost of carsD)The health of cities solve this equation for x 0.95 = log x Of all the baseball caps in a store. 2/3 of the caps are blue. Of all the blue baseball caps. 4/7 are on sale. What fraction of the baseball caps in the store are blue and on sale Evaluate -3x3-4x for x= -1.17-1 Need help with this circumference question Select the functions that have a value of 0. sin270 cos90tan0csc(-180)cos(-90) cot270 the end points of AB are A(2,3) and B(8,1). The perpendicular bisector of AB is CD, and point C lies on AB. The length of CD is square root of 10 units. the coordinates of point C are? the slope of CD is? the possible coordinates of point D are ____ and ? The relationship of width to height for a picture is called Steam Workshop Downloader