Refrigerator technology now makes it possible to grow and then store food for the winter, as well as ship large amounts of food long distances. How has refrigerator technology changed society? A. Refrigerator technology has helped improve people’s nutrition. B. Refrigerator technology has helped people travel faster. C. Refrigerator technology has allowed people to work throughout the summer. D. Refrigerator technology has helped farmers grow more types of food.

Answers

Answer 1

Answer: A. Refrigerator technology has helped improve people’s nutrition.

Explanation:

Answer 2

Refrigeration technology has been transformative for society by enhancing food preservation, enabling long-distance transportation of fresh produce, and thereby improving overall nutrition and food variety available to people. Correct option is A.

Refrigerator technology has significantly changed society by improving how we store, transport, and consume food. With the advent of refrigeration technology, we're able to preserve the quality and nutritional value of food over longer periods and distances, helping to improve global nutrition levels. It's worth noting that refrigeration technology has also led to a greater variety of food being available to consumers, as produce can now be shipped safely across the world, and stored efficiently for later use.

The correct answer to the question of how refrigerator technology has changed society is A. Refrigerator technology has helped improve people’s nutrition.


Related Questions

Which type of reaction is represented by the generic equation AB + CD AD + CB? combustion decomposition single replacement double replacement

Answers

it is a double replacement

Answer:

Double Replacement

Explanation:

Check all the boxes that describe the electron sea model. It is the simplest metal bonding model. It is the most complicated metal bonding model. Metallic bonding results from the transfer of valence electrons. Metallic bonding results from the sharing of valence electrons. The electrons are delocalized. The electrons are attracted to specific nuclei. The delocalized electrons serve as the glue that keeps the metal atoms together. The electrons that are attracted to specific nuclei serve as the glue that keeps the metal atoms together.

Answers

Final answer:

In the electron sea model, metallic bonding is characterized by delocalized electrons freely moving around the metal ions, serving as a 'glue' that holds the atoms together. This model is known as the simplest metal bonding model.

Explanation:

The electron sea model is a representation of metallic bonding where valence electrons are free to move around, and hence are considered 'delocalized'. This forms a 'sea' of electrons that surrounds the positive metal ions. This model is the simplest metal bonding model, not the most complicated one. It is not characterized by the transfer or sharing of valence electrons (as with ionic or covalent bonding, respectively), but on the free movement of the electrons among a lattice of atomic cores. The delocalized electrons do serve as a kind of 'glue' that holds the metal atoms together, providing the electrical conductivity and malleability characteristic of metals. However, it's incorrect to say these electrons are attracted to specific nuclei - they are collectively interacting with many nuclei.

Learn more about Electron Sea Model here:

https://brainly.com/question/14638762

#SPJ6

Final answer:

The electron sea model describes metallic bonding as a delocalization of valence electrons among metal ions, without specifying attachment to individual atoms. It is the simplest metal bonding model, where the 'sea' of delocalized electrons acts as the glue holding the metal structure together.

Explanation:

The electron sea model is a framework used to describe metallic bonding, where the key characteristics involve the delocalization of valence electrons among metal ions. According to this model, metallic bonding results not from the transfer of electrons, as in ionic bonding, nor solely from the sharing of electrons, as in covalent bonding, but rather from a pooling of electrons resulting in a sea of electrons that are delocalized and free to move around. These delocalized electrons are not attached to any specific atom but are instead shared among many atoms, providing the characteristic malleability and conductivity of metals.

Regarding the options provided, the descriptions that are accurate for the electron sea model are:

It is the simplest metal bonding model.Metallic bonding results from the delocalization, not the sharing or transfer, of valence electrons.The electrons are delocalized.The delocalized electrons serve as the 'glue' that keeps the metal atoms together.

The statements that electrons are attracted to specific nuclei and that they serve as the glue to keep metal atoms together do not represent the electron sea model adequately, as the electrons are not tied to any particular metal ion.

Learn more about Electron Sea Model here:

https://brainly.com/question/14638762

#SPJ3

The process of adding a known amount of solution of known concentration to determine the concentration of another solution is called?

Answers

Answer:

It is the process in which a known amount of solution of known concentration is added to the concentration of the another solution to determine the concentration of unknown solution.

Explanation:

Answer:

Titration

Explanation:

The functional group for a carboxylic acid is

Answers

Answer: -COOH

Explanation: In general, carboxylic acids are represented by the formula RCOOH, where R is a hydrocarbon group and COOH is the fuctional group.

-

-

The functional group for a carboxylic acid is -COOH.

What is a carboxylic acid?

An organic acid containing a carboxyl group. The simplest examples are methanoic (or formic) acid and ethanoic (or acetic) acid.

Organic acids such as acetic acid all contain a functional group called a carboxyl group. The carboxyl group contains the C=O. of the carbonyl group, with the carbon atom also being bonded to a hydroxyl (−OH) group. The simplest carboxylic acid is acetic acid [tex](CH_3COOH)[/tex]

Hence, the functional group for a carboxylic acid is -COOH.

Learn more about the carboxylic acid here:

https://brainly.com/question/15522377

#SPJ2

Which is a postulate of the kinetic-molecular theory?

Answers

Answer:

Gas particles have a small volume relative to the spaces between them.

Explanation:

The study of chemicals and bonds is called chemistry. There are different types of elements and these are metals and nonmetals.

What is kinetic energy?

The energy formed by the motion of particles is called kinetic energy.

According to the question, the postulates are as follows:-

The particles in a gas are in constant, random motion.The combined volume of the particles is negligible.The particles exert no forces on one anotherAny collisions between the particles are completely elastic.The average kinetic energy of the particles is proportional to the temperature in kelvins.

For more information about kinetic energy, refer to the link:-

https://brainly.in/question/3403229

Energy is released from radioactive elements.


True or False​

Answers

Yes, radioactive decay releases energy

Can you guys pretty please help me with my science

Answers

4.) C.summer

5.) A. new moon

6.) A. One

C) Summer

B) Full Moon

A) One (look up a lunar calendar, those can help with these question)

Hope this helps you :)

Muscles convert chemical energy into

Answers

Muscles convert chemical energy into mechanical energy

Answer:

Mechanical

Explanation:

I did it.

Please help



Rubbing the balloons against the woolen fabric or your hair creates static electricity. This involves negatively charged particles (electrons) jumping to positively charged objects. When you rub the balloons against your hair or the fabric they become negatively charged, they have taken some of the electrons from the hair/fabric and left them positively charged.

What would be a result of this simple static electricity experiment?

A) Both your hair and the balloon would be negatively charged and static would cause them to separate.

B) Rubbing the balloons against the woolen fabric or your hair creates heat energy.

C) Your positively charged hair would be attracted to the negatively charged balloon and would rise up to meet the balloon.

D) Static electricity is the movement of the charged particles between the objects.

Answers

Explanation: I THINK THAT YOUR POSITIVELY CHARGED HAIR WOULD BE ATTRACTED TO THE NEGATIVELY CHARGED BALLOON AND WOULD RISE UP TO MEET BALLOON.

HOPE THIS HELPS....

Answer:

C) Your positively charged hair would be attracted to the negatively charged balloon and would rise up to meet the balloon.

Explanation:

Your positively charged hair would be attracted to the negatively charged balloon and would rise up to meet the balloon. This answer is explained in the prompt.

Which of the following is a physical of a substance

A.Reactivity
B.Hardness
C.Flammability
D.Toxicity

Answers

A quality I would say of a physical substance is hardness

Hardness

it's something you can see and tell without changing the composition of matter

Which of the following terms refers to the existence of large research organizations with researchers working collaboratively in labs throughout the world on a single project?

big science

turbo-charged

relativistic science

principal commitment




Answers

I believe the answer is Big Science.

How many grams of Na2So4 would be formed if 0.75 moles of NaOH reacted?

Answers

Answer:

[tex]\boxed{\text{53 g }}[/tex]

Explanation:

You don't give the reaction, but we can get by just by balancing atoms of Na.

We know we will need the partially balanced equation with masses, moles, and molar masses, so let’s gather all the information in one place.

M_r:                                 142.04  

             2NaOH + … ⟶ Na₂SO₄ + …  

n/mol:      0.75

1. Use the molar ratio of Na₂SO₄ to NaOH to calculate the moles of NaF.

Moles of Na₂SO₄ = 0.75 mol NaOH × (1 mol Na₂SO₄/2 mol NaOH

= 0.375 mol Na₂SO₄

2. Use the molar mass of Na₂SO₄ to calculate the mass of Na₂SO₄.

Mass of Na₂SO₄ = 0.375 mol Na₂SO₄ × (142.04 g Na₂SO₄/1 mol Na₂SO₄) = 53 g Na₂SO₄

The reaction produces [tex]\boxed{\text{53 g }}[/tex] of Na₂SO₄.

Final answer:

0.75 moles of NaOH would form 0.375 moles of Na2SO4, based on the stoichiometry of the chemical equation provided. The mass of Na2SO4 produced would be 53.25 grams.

Explanation:

The reaction described involves NaOH and amounts to a stoichiometry problem where we determine the amount of a product formed from a given amount of reactant. In the given chemical equation:
4NaOH(aq) + 2S(s) + 302(g) → 2Na2SO4(aq) + 2H₂O(l),
there is a clear stoichiometric relationship between NaOH and Na2SO4. Specifically, 4 moles of NaOH yield 2 moles of Na2SO4, which means 2 moles of NaOH would produce 1 mole of Na2SO4. Given that 0.75 moles of NaOH reacted, they would form half of 0.75 moles of Na2SO4, which is 0.375 moles of Na2SO4. To find the mass in grams, we would need the molar mass of Na2SO4, which is approximately 142 g/mol.

Moles of Na2SO4 formed = (0.75 moles NaOH × 1 mole Na2SO4) / 2 moles NaOH

Mass of Na2SO4 formed = 0.375 moles × 142 g/mol = 53.25 grams.

What is going to happen to the volume of a gas that is put under MORE pressure while keeping the temperature constant?

A)The volume will increase.B)The volume will decrease.C)The volume will fluctuate.D)The volume will remain constant.

Answers

The answer is -B

if temperature and pressure are constant, the number of particles is proportional to the volume. Another way to keep the pressure constant as the volume increases is to raise the average force that each particle exerts on the surface. This happens when the temperature is increased.

Answer:

B, The volume will decrease.

Explanation:

PLEASE HELP ME ASAP PLEASE HELP ASAP!!! PLATO ILL GIVE YOU BRAINLIEST!!!



Describe what happens to a carbon-11 atom when it undergoes positron emission.
^^^^^^^
The decay of a carbon-11 atom (blank1), and this causes it to emit (blank2).

Answers

The decay of a carbon-11 atom decreases the number of protons and increases the number of neutrons and causes it to emit radiations.

An atom is defined as the smallest unit of matter which forms an element. Every form of matter whether solid,liquid , gas consists of atoms . Each atom has a nucleus which is composed of protons and neutrons and shells in which the electrons revolve.

The protons are positively charged and neutrons are neutral and hence the nucleus is positively charged. The electrons which revolve around the nucleus are negatively charged and hence the atom as a whole is neutral and stable due to presence of oppositely charged particles.

When an atom undergoes decay, the number of protons present in the nucleus are decreased and radiations are emitted.

Learn more about atom,here:

https://brainly.com/question/1566330

#SPJ4

The decay of a carbon-11 atom undergoes beta-plus decay (β+ decay)and this causes it to emit emits a positron (β+) and a neutrino (v).

Step 1: Unstable Nucleus

A carbon-11 atom has an unstable nucleus because it contains an excess of protons compared to neutrons. This instability makes it prone to radioactive decay.

Step 2: Positron Emission

During positron emission, a process that stabilizes the nucleus, the following occurs:

Proton Transformation: A single proton within the carbon-11 nucleus undergoes a transformation.Positron Creation: A positron (β+), which is an antiparticle to an electron with the same mass but positive charge, is created.Neutrino Emission: To conserve momentum and angular momentum, an uncharged neutrino (v) is also emitted along with the positron.

Why do theories and model change over time?

Answers

The first model of the atom was developed by JJ Thomson in 1904, who thought that atoms were composed purely of negatively charged electrons. This model was known as the 'plum pudding' model

Final answer:

Scientific theories and models change over time due to new evidence and experimentation, leading to more accurate predictions and descriptions of natural phenomena. The dynamic nature of science, such as in phylogenetic modeling in biology, necessitates continual revision and refinement of theories. This iterative process propels scientific discovery and understanding.

Explanation:

Why Theories and Models Change Over Time

The development of scientific theories and models is an iterative process, continually influenced by new data and experiments. As scientists observe nature more meticulously, they gather evidence that may either corroborate or challenge existing theories. The predictive ability of models plays a crucial role in their validity; precise models enable accurate descriptions and predictions about natural phenomena. For instance, Albert Einstein's general theory of relativity radically improved our understanding of gravity, leading to predictions and the eventual discovery of black holes.

In fields like biology, the concepts of phylogenetic modeling have undergone significant change. Scientists propose new models as new research provides insights into the relationships between organisms, showcasing the dynamic nature of scientific study. Ultimately, a theory must withstand rigorous testing, and when new evidence warrants, theories are refined or replaced to incorporate this newfound understanding.

The pathway from data to scientific discovery is often directed by the models, theories, and laws that scientists construct. These not only assist in analyzing collected data, but also guide researchers to novel discoveries, furthering the cycle of scientific progress.

2. Which process is occurring in this photograph of a glacier?

A. Melting
B. Calving
C. Abrasion
D. Plucking

Answers

Final Answer:

The process occurring in the photograph of the glacier is Calving, where chunks of ice break off from the glacier's edge, forming icebergs in bodies of water.

B. Calving

Explanation:

Glacial calving is the process captured in the photograph of the glacier. Calving occurs when chunks of ice break off from the glacier's edge, forming icebergs in bodies of water. This process is primarily driven by the glacier's continuous movement and the mechanical stress caused by its own weight. Calving is a significant contributor to ice loss from glaciers and plays a crucial role in the dynamics of glacier systems.

In the photograph, the presence of large ice blocks breaking away from the glacier's terminus is a clear indication of calving. This process is influenced by a combination of factors, including the glacier's size, ice temperature, and the surrounding environment. As the glacier advances, the ice at its terminus experiences pressure and tension, eventually leading to the fracturing and separation of ice chunks. The resulting icebergs contribute to the redistribution of glacial ice and have implications for sea level rise.

Understanding the specific glacial processes at play, such as calving, is vital for assessing the impact of climate change on glacier dynamics and predicting potential consequences for sea level and environmental systems. Monitoring and studying such phenomena contribute to a more comprehensive understanding of Earth's changing landscapes.

Full Question:

2. Which process is occurring in this photograph of a glacier?

A. Melting

B. Calving

C. Abrasion

D. Plucking

Consider the transmutation reaction shown
10/5 B + 1/0 n -> 7/3 Li + 4/2 He
Which statement best describes the reaction?
A) When boron-10 is struck by neutrons, it produces lithium-7 and an alpha particle.
B) When boron-10 gives off an alpha particle, it also forms a neutron and lithium-7.
C) When lithium-7 absorbs an alpha particle, it forms boron-10 and a neutron.
D) When lithium-7 gives off an alpha particle, it also forms a neutron and boron-10.
plZ help <3

Answers

Answer: A

When Boron-10 is struck by neutrons, it produces Lithium-7 and an alpha particle.

This is done to control the number of neutrons available to interact with Boron to control the overall reaction rate

Answer:

Option A                          

Explanation:

The reaction:

¹⁰B + ¹n  →  ⁷Li + ⁴He

Correspond to a boron neutron capture therapy, which is used for treating malignant tumors and extracutaneous melanomas.

In the reaction, the boron-10 captures the neutrons and undergoes nuclear fission to produce nuclei lithium-7 and alpha particles (nuclei ⁴He) than can kill the tumor cells.        

Hence, the correct answer is option A) when boron-10 is struck by neutrons, it produces lithium-7 and an alpha particle.

I hope it helps you!    

what element has beryl emeralds and aquamarine?

Answers

Answer:

Pure Beryl is colorless.

Explanation:

The wide range of impurities cause the diverse amount of colors and many varieties. The green color in emerald is usually caused by traces of the element chromium, and the blue color of aquamarine usually by iron.

The element that beryl, emeralds, and aquamarine have in common is beryllium.

Beryl is a mineral composed of beryllium aluminum cyclosilicate (Be3Al2Si6O18). When beryl is pure and green in color due to traces of chromium and sometimes vanadium, it is known as emerald, which is a precious gemstone. On the other hand, when beryl is blue to blue-green in color due to traces of iron, it is known as aquamarine, another valuable gemstone.

A solution contains 100 mg/mL of a drug, and the recommended dose is 50 mg/lb. once a day. How much solution would be needed for one dose to be administered to a 20 kg patient?


A. 2.2 L
B. 220 mL
C. 22 L
D. 22 mL

Answers

Answer:20 kg * 2.2 lb/kg * 50 mg/lb * 1mL/100mg = 22 mL

Explanation:

Answer:

The correct answer is option (D) 22mL

Explanation:

Solution:

Given:

liquid concentration = 100mg/mL

weight = 20kg

dosage = 50mg/lb

converting the dosage from mg/lb to mg/kg, we have

1kg = 2.2046lb

therefore, dosage = 50mg * 2.2046/kg = 110.23mg/kg

The required solution can be obtained using the formula below

Dose = weight in kg * dosage in mg/kg ---------------1

liquid dose = dose/liquid concentration----------------2

Substituting into equation 1, we have

Dose = 20kg * 110.23mg/kg =  2204.6mg

For liquid dose, substitute into equation 2

Liquid dose = 2204.6mg/100mg/mL

                                       22. 046mL

Approximately 22mL

Therefore, 22mL is needed to be administered to the 20kg patient

                                       

I’ll give brainlyiest (sorry if I spelled it wrong) to first correct answer

Answers

Answer:

Dependent variable

Hope this helps :)

Have a great day !

5INGH

Brainliest please

Explanation:

Temperature as the average kinetic energy of a gas increases.

A.)stay the same

B.)increase

C.)decrease

Answers

Answer:

Option B

Explanation:

We know that if the temperature of a gas increaseas, then the kinetic energy and the average speed increases too. For that reason, the correct answer is option B).

Answer: The correct answer is Option B.

Explanation:

Average kinetic energy is defined as the average of the kinetic energies of all the particles present in a system. It is determined by the equation:

[tex]K=\frac{3RT}{2N_A}[/tex]

where,

K = Average kinetic energy

R = Gas constant

T = Temperature of the system

[tex]N_A[/tex] = Avogadro's number

From the above relation, it is visible that kinetic energy is directly related to the temperature of the system. So, if average kinetic energy of the system increases, it means that temperature also increases and vice-versa.

Hence, the correct answer is Option B.

The natural source of acidity in rain water is _____.

carbonic acid
sulfuric acid
nitric acid
all of the above

Answers

Answer:

carbonic acid

Explanation:

Carbonic acid refers to the natural existent acid in our atmosphere which is produced when water reacts with water vapor and it makes rain naturally acid. As a result, rainwater is always acidic. On the other hand, acid rain occurs when precipitation contains a higher than normal acidity  and a pH lower than 5.0.

Answer:

Carbonic acid

Explanation:

Hello,

In this case, due to the increasing concentration of carbon dioxide in the atmosphere, when it rains, the following chemical reaction occurs between water and carbon dioxide:

[tex]CO_2+H_2O\rightarrow H_2CO_3[/tex]

Whose product is known as carbonic acid and it is the natural source of acidity in acid rain.

Regards.

solid phosphorus (P4) burns in excess oxygen gas to produce phosphorus oxide(P4O10)

1. if 63.01 g of phosphorus is used what mass of p4O10 is produced?

Answers

Answer: 141,95 g

Explanatin:M phosphorus = 124,9 g/moln= 63,01/ 124,9=0,5 (mol)P4 + 5O2 -->  P4O101      :      5     :      10,5   ->   2,5 ->     0,5   (mol) M P4O10 = 283,9 g/molm P4O10 = n.M = 0,5 . 283,9= 141,95 ( g) i hope that this will help (cause i not really good at english but i quite good at chemical :}}  )

Which of the following is most chemically like sulfur

Answers

Answer:

Sulfur belongs to the chalcogen family. Other members of the family are oxygen, selenium, tellurium, and polonium. These elements make up Group 16 (VIA) of the periodic table. The periodic table is a chart that shows how chemical elements are related to each other.

The term chalcogen comes from two Greek words meaning "ore forming." An ore is a naturally occurring mineral used as a source for an element. Many ores are compounds of a metal and oxygen or a metal and sulfur. Compounds that contain two elements, one of which is sulfur, are called sulfides. For example, a beautiful gold-colored mineral is called pyrite, or "fool's gold," because it looks so much like real gold. Pyrite is iron sulfide (FeS 2 ).

Sulfur was known to ancient peoples. Its physical and chemical properties are very distinctive. It often occurs as a brilliant yellow powder. When it burns, it produces a clear blue flame and a very strong odor.

SYMBOL

S

ATOMIC NUMBER

16

ATOMIC MASS

32.064

FAMILY

Group 16 (VIA)

Chalcogen

PRONUNCIATION

SUL-fur

Sulfur, also spelled as sulphur, is a very important element in today's world. Its most important use is in the manufacture of sulfuric acid (H 2 SO 4 ). There is more sulfuric acid made than any other chemical in the world. It has an enormous number of important uses.

Discovery and naming

Sulfur must have been well known to ancient peoples. They sometimes referred to it as brimstone. Sulfur sometimes occurs in bright yellow layers on the top of the earth. It has a sharp, offensive odor. When it burns, it gives off a strong, suffocating smell. The odor is like that produced when a match is struck.

The Bible mentions brimstone in a number of places. For example, Sodom and Gomorrah were two towns destroyed by God for the wicked ways of their citizens: "The Lord rained upon Sodom and upon Gomorrah brimstone and fire."

But ancient people certainly did not think about sulfur the way modern chemists do. In fact, they used the word "element" to talk about anything that was basic. Ancient Greek philosophers, for example, thought that everything consisted of four elements: earth, fire, water, and air. Other philosophers thought there were only two elements: sulfur and mercury.

But early thinkers were often confused as to what they meant by the word "sulfur." They often were talking about anything that burned and gave off large amounts of smoke. To them, "sulfur" was really a "burning substance." It took centuries for scientists to identify sulfur as an element.

Explanation:

The most chemically similar element like sulfur is oxygen.

What is the most similar element to sulfur?

Oxygen is the most similar element to sulfur.

Let's see the similarity between oxygen and sulfur:

Atomic radius:

Sulfur - 0.88

Oxygen - 0.48

Ionic radius:

Sulfur -  1.84

Oxygen - 1.40

Electronegativity:

Sulfur (2.5) is less electronegative than oxygen, (3.4)

They have the same number of electrons in their outermost cell.

Thus, oxygen is most similar to sulfur.

Learn more about sulfur, here:

https://brainly.com/question/2116588

Elements in group 15 will electrons to obtain a noble gas structure. How many electrons will the element gain or lose in order to obtain a noble gas structure?

Answers

Answer:

Elements in group 15 will gain electrons and it will gain 3 electrons to obtain a noble gas structure.

Explanation:

A noble gas structure is obtained when it completes a full octet around the atom. Meaning it has 8 electrons in its outer shell.

Group 15 is also known as Group 5A or the Nitrogen group. The nitrogen group have 5 valence electrons. Now something to remember about gaining and losing electrons. When the outershell is more than half full, it is more likely to attract electrons to itself. When the outershell is less than half full, it is more likely to lose electrons.

So in the case of group 15, which has 5, it is closer to 8, so it will gain an electron. To complete the octet, it will need 3 more electrons.

How do you solve this

Answers

Answer:

Explanation:

You simply have to multiply it by the molar mass =

m = 50mol SnSO4 x 214.773 g/mol

m = 10.738 g SnSO4

Answer:

Mass of 50 moles of tin(II) sulfate is 10,738 grams.

Explanation:

[tex]n=\frac{m}{M}[/tex]

Where:

n = moles of compound

m = mass of compound

M = molar mass of the compound

Moles of tin(II) sulfate , n= 50 moles

Molar mass of tin (II) sulfate , M= 214.77 g/mol

m = n × M

[tex]m=50 moles \times 214.77 g/mol=10,738 g[/tex]

Mass of 50 moles of tin(II) sulfate is 10,738 grams.

as a sample of a radioactive element decays, its half-life ?​

Answers

Answer:

C stays the same

Explanation:

As a sample of a radioactive element decays, its half-life: remains the same.

What is a nuclear reaction?

A nuclear reaction can be defined as a type of reaction in which the nucleus of an atom of a radioactive element is transformed by being joined (fusion) or split (fission) with the nucleus of another atom.

In Chemistry, the half-life of a sample of a radioactive element would remain the same even as it experiences a decay of its sub-particles.

Read more on half-life here: https://brainly.com/question/26689704

When the pressure that a gas exerts on a sealed container changes from 811 mm Hg to 415 mm Hg, the temperature changes from 33.0°C to _ °C?

Answers

Answer:

-116.42°C

Explanation:

According to pressure law which states that the pressure of a fixed mass of a gas is directly proportional to its absolute temperature at constant volume.

Therefore;

P1/T1 = P2/T2

P1 = 811 mmHg

P2 = 415 mmHg

T1 = 33°C + 273°C = 306 K

Therefore;

T2 = P2T1/P1

    = (415 × 306)/ 811

    = 156.58 K

Therefore; temperature = 156.58 - 273 = -116.42°C

Answer:

-116.42°C

Explanation:

How many grams of NaHCO3 would you need to react with 6 moles of H2SO4?
The balanced chemical equation is:
H2SO4(aq) + 2 NaHCO3 (s) —-> Na2SO4 (aq) + 2 CO2 (g) + 2 H2O

Answers

Answer:

[tex]\boxed{\text{1000 g}}[/tex]

Explanation:

We know we will need a balanced equation with masses, moles, and molar masses, so let’s gather all the information in one place.

M_r:                           84.01  

              H₂SO4 + 2NaHCO₃ ⟶ Na₂SO₄ + 2CO₂ + 2H₂O

n/mol:         6

1. Use the molar ratio of NaHCO₃ to calculate the moles of NaHCO₃.

[tex]\text{Moles of NaHCO$_{3}$ = 6 mol H$_{2}$SO$_{4}$} \times \dfrac{\text{2 mol NaHCO$_{3}$}}{\text{1 mol H$_{2}$SO$_{4}$}}\\=\text{12 mol NaHCO$_{3}$}[/tex]

2. Use the molar mass of NaHCO₃ to calculate the mass of NaHCO₃.

[tex]\text{Mass of NaHCO$_{3}$ = 12 mol NaHCO$_{3}$} \times \dfrac{\text{84.01 g NaHCO$_{3}$}}{\text{1 mol NaHCO$_{3}$}}\\\\= \text{1000 g NaHCO$_{3}$}[/tex]

You must use [tex]\boxed{\textbf{1000 g}}[/tex] of NaHCO₃.

help please

Isabella was standing directly below a power line, and her compass failed to give an accurate reading.

How could she explain why her compass was not working?

A

A compass works with a magnetic field, and the electric current running through the lines above it would interfere with the magnetic field.


B

The compass works because of an electric field, and the electric current running through the lines above would interfere with the electric field.


C

The compass works because of a gravitational field, and the magnetic current running through the lines above would interfere with the gravitational field.


D

A compass works because of a magnetic field, and the magnetic current running through the power lines above it would interfere with the magnetic field below it.

Answers

a compass works with magnetic field the answer is d

Other Questions
Some1 help me out on this And if you cant just give me your best opinionWhen reading a text, which of the following is usually a sign that an object is a symbol?Characters pay a lot of attention to the object(s). The object is always mentioned in a song. The object is only mentioned once in passing. The object is never mentioned. What is the length of the third side of the window frame below?(Figure is not drawn to scale.)A picture of a right triangular window frame is shown. The longest side has length labeled as 39 inches. The height of the frame is labeled as 36 inches. 15 inches 27 inches 25 inches 32 inches What were the goals/policies of the Johnson administration and how did they impact the nation Which statements describe the use of gamma rays to treat cancer? Check all that apply.Gamma rays have low energy and a source must be placed in the body.Gamma rays are absorbed by only the cancer cells.High-energy gamma rays are directed at a tumor from outside of the body.Gamma rays kill cancer cells in a tumor.Gamma rays are applied to a large area of the body. Jane entered her artworks in a state competition. Her art scores from 7 judges are listed. 9,9,8,7,9,6,8 what is Janes mean score? A.6 B.7 C. 8 D.9 When you use the distance Formula you are building a right triangle whose ____ connects two given points.... I NEED HELP ASAP I WILL GIVE BRAINLIST !!!!!!!!!Assignment water and oceans graphic organizer exploration k12 1. Where does the energy that causes evaporation come from2. What role does gravity play in the water cycle?3. Describe the flow of one molecule of water through the water cycle, beginning in the ocean. suppose that one student is randomly selected during lunch time. what is the experimental probability if students the brought lunch from house is 55 and students that order school lunch is 45 Which two of these sentences are in passive voice if dy/dt=-10e^-t/2 and y(0)=20 what is the value of y(6) A land rush happened in Oklahoma in the 1890s thanks to the discovery of which mineral? A. gold B. gypsum C. lead D. zinc Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct What would the charge be on an ion of boron (B)? If Johnny has twice more bottles of dish soap than Carolyn, and Carolyn has 20 more bottles of dish soap than Mr. White, how many bottles of dish soap does Johnny have if Mr. White has 35 bottles of dish soap? Using the properties of exponents and logarithms, find the value of x in 19+2 in x=25 What are two reasons that the development of the Model T was important?It was the first car to be manufactured on a moving chassis assembly line.It was the first vehicle model to be manufactured in the United States. was the largest, fastest, and the most luxurious car of the twentieth century.It was affordable and enabled average Americans to own a car. Jimi Hendrixs version of the "Star Spangled Banner" is quite poignant because obviously he feels patriotic about his country, but there are some underlying themes if you listen carefully. The destructive explosions on the guitar are a protest to the war in Vietnam, and his sadness for innocent lives being lost is represented by the "taps" theme at 2:40. He also plays part of the melody in a minor key ("our flag was still there") to represent that although he loves his country, he recognizes that there are some things that need fixing and healing in order to move forward. The performance of this at Woodstock in 1969 must have been a very moving moment. Through all the craziness, guitar soloing and sounds of destruction, Hendrix makes the National Anthem still hold true. The question is Does Hendrix actually play the whole National Anthem (sing the lyrics in your head as he plays to find out)? In the field of health science, what characteristics are employers not looking for?diligenceintelligenceportabilityreliability For which triangle is the length of the hypotenuse an INTEGER? drama that are broken in smaller pieces are called Steam Workshop Downloader