Final answer:
Heterogeneous mixtures can be separated by physical means such as filtration, which removes solids from liquids, or distillation, which separates components based on boiling points. Chromatography is another method used for separating complex mixtures like inks based on differential adsorption.
Explanation:
Heterogeneous mixtures are characterized by a non-uniform composition and can often be separated by simple physical means. One common method of separation is filtration, which uses a barrier to separate solid particles from a liquid. For instance, sand in water can be separated by passing the mixture through filter paper, which allows water to pass through while retaining the sand particles.
Another separation technique is called distillation, which relies on the differences in boiling points of substances to separate a homogeneous mixture into its components. For example, when distilling a saltwater solution, the water, being more volatile, evaporates first and is collected after condensation, leaving the salt behind.
Moreover, chromatography is a technique used to separate mixtures based on the differential adsorption of compounds to a medium. It is often employed to separate complex mixtures such as inks, where different ink components travel at various speeds through a medium, resulting in separation.
The ester below can be separated into phenol and an acetate salt, via saponification: heating the ester with a strong base, such as sodium hydroxide, will produce phenol and sodium acetate. the two chemicals can then be separated by heat and filtration.
a. calculate the unsaturation number of the ester above.
b. calculate the molecular weight of the ester above
If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.
If 50% of radioactive element remains after 4000 years what what is the half life
moles of hydrogen in 9.15×10−2 mol C4H10
A chemist dissolves of pure barium hydroxide in enough water to make up of solution. calculate the ph of the solution. (the temperature of the solution is .) be sure your answer has the correct number of significant digits.
The pH of a 4.5 × 10^-4 M Ba(OH)2 solution is calculated by first determining the hydroxide ion concentration, which is doubled due to the two hydroxide ions provided by Ba(OH)2, and then calculating the pOH followed by subtracting from 14 to get the pH value of approximately 10.95.
Explanation:Calculating the pH of Barium Hydroxide Solution
For the calculation of the pH of a 4.5 × 10-4 M barium hydroxide (Ba(OH)2) solution, it is crucial to consider that barium hydroxide is a strong base which dissociates fully in water. As Ba(OH)2 provides two moles of hydroxide ions for each mole of the substance dissolved, the hydroxide ion concentration will be twice the concentration of Ba(OH)2, which is 9 × 10-4 M (2 × 4.5 × 10-4 M).
To find the pOH of the solution, we take the negative logarithm of the hydroxide ion concentration: pOH = -log (9 × 10-4) = 3.045757491. To find the pH, subtract the pOH from 14: pH = 14 - 3.045757491, which simplifies to approximately pH = 10.95. This is a basic solution, as expected from barium hydroxide.
In laboratory settings, remember to use proper safety precautions, the correct form of chemicals, accurate measuring tools, and the appropriate methods to adjust the pH of solutions, such as adding acid or base. Moreover, for precise results, correctly label solutions and calibrate equipment such as pH meters as necessary.
how many protons are in Uranium -242?
Which of these statements about enzymes is true?
a.) enzymes increase the rate of a reaction by decreasing the gibbs free energy change of the reaction.
b.) enzymes decrease the rate of a reaction by increasing the gibbs free energy change of the reaction.
c.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction.
d.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction and the gibbs free energy change of the reaction.
e.) enzymes do not change the rate of a reaction?
Enzymes increase the rate of a reaction by decreasing the activation energy required for the reaction but do not change the Gibbs free energy change of the reaction. Option C is correct.
Among the statements about enzymes, the true one is that enzymes increase the rate of a reaction by decreasing the activation energy of the reaction. Enzymes are biological catalysts that specifically bind to substrates and help convert them to products more efficiently by lowering the energetic barrier, which is the activation energy required for the reaction to proceed.
However, it is important to note that while enzymes do lower the activation energy, they do not alter the Gibbs free energy change (AG) of the reaction. The Gibbs free energy change is a thermodynamic property that determines the spontaneity of a reaction and remains unchanged regardless of whether enzymes are present.
Hence, C. is the correct option.
A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?
What is the angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ( SCN− ) ion?
Answer:
Angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ion[tex]SCN^-[/tex] is 180°.
Explanation:
The hybridization of carbon atom is sp hybridized. The shape of the sp hybridized carbon is linear which means that angle between sulfur carbon a bond and carbon nitrogen bond is 180 °.
Where as [tex]sp^3[/tex] hybridized carbon has tetrahedral shape with an angle of 109.5°.
Where as [tex]sp^2[/tex] hybridized carbon has trigonal planar with an angle of 120°.
4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place
To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.
In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.
what is the definition of tributary
A tributary is a smaller stream or river that flows into a larger one, contributing to its volume and influencing its navigability, ecosystem, and flooding potential.
Explanation:The definition of a tributary is a stream or river that flows into a larger stream, river, or lake. These smaller watercourses contribute to the flow of the larger one, which is often referred to as the mainstem or parent river. Tributaries do not flow directly into the sea. They provide additional water volume to their parent river, which can then affect the river's ability to navigate, its ecosystem, and potential for flooding. For example, the Missouri River is a tributary of the Mississippi River because it flows into it.
How many hydrogen atoms are in 2.80 mol of ammonium sulfide?
Answer : The number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]
Explanation : Given,
Moles of hydrogen atoms = 2.80 mole
As we know that, the formula of ammonium sulfide is, [tex](NH_4)_2S[/tex]. In ammonium sulfide, there are 2 atoms of nitrogen, 8 atoms of hydrogen and 1 atom of sulfur.
Now we have to calculate the number of hydrogen atoms.
As, 1 mole of [tex](NH_4)_2S[/tex] contains [tex]8\times 6.022\times 10^{23}[/tex] number of hydrogen atoms.
So, 2.80 mole of [tex](NH_4)_2S[/tex] contains [tex]2.80\times 8\times \times 6.022\times 10^{23}=134.89\times 10^{23}[/tex] number of hydrogen atoms.
Therefore, the number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]
How many dots would a lewis dot structure for neon have?
Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?
At which stage does a gas form in a gas formation reaction?
the reactants stage
the product stage
the liquid stage
the solid stage
Answer: b
Explanation:
Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.
Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.
How many grams of CO2 are used when 7.0 g of O2 are produced?
The question cannot be answered as posed because a specific chemical reaction and balanced equation are needed to relate the masses of O2 and CO2.
Explanation:To answer how many grams of CO2 are used when 7.0 g of O2 are produced, we assume the process is a typical combustion or respiration reaction, where CO2 is generated from O2, or vice versa. The balanced chemical equation for the combustion of carbon would typically be C + O2 → CO2. However, since we are given the mass of O2 produced, and not the mass of a carbon-containing fuel that reacts, we cannot proceed to calculate the mass of CO2 without additional information on the specific reaction involved, including the stoichiometry that defines the mass relationship between O2 and CO2. Therefore, we must have a balanced equation or a known reaction to relate the masses of O2 and CO2 produced in order to provide a specific answer.
Learn more about Chemical Reaction Stoichiometry here:https://brainly.com/question/30415532
#SPJ12
9.62 grams of [tex]\( \text{CO}_2 \)[/tex] are used when 7.0 grams of [tex]\( \text{O}_2 \)[/tex] are produced.
One common reaction where [tex]\( \text{O}_2 \)[/tex] is produced and [tex]\( \text{CO}_2 \)[/tex] is consumed is photosynthesis:
[tex]\[ 6 \text{CO}_2 + 6 \text{H}_2\text{O} \rightarrow \text{C}_6\text{H}_{12}\text{O}_6 + 6 \text{O}_2 \][/tex]
From this balanced equation, we see that 6 moles of [tex]\( \text{CO}_2 \)[/tex] produce 6 moles of [tex]\( \text{O}_2 \)[/tex]. This means that 1 mole of [tex]\( \text{CO}_2 \)[/tex] produces 1 mole of[tex]\( \text{O}_2 \).[/tex]
Step-by-Step Solution:
1. Determine the molar mass of [tex]\( \text{O}_2 \)[/tex]:
[tex]\[ \text{Molar mass of O}_2 = 2 \times 16.00 \text{ g/mol} = 32.00 \text{ g/mol} \][/tex]
2. Calculate the moles of \( \text{O}_2 \) produced:
[tex]\[ \text{Moles of O}_2 = \frac{7.0 \text{ g}}{32.00 \text{ g/mol}} = 0.21875 \text{ moles} \][/tex]
3. Use the stoichiometry from the balanced equation:
From the balanced equation, the mole ratio between[tex]\( \text{CO}_2 \) and \( \text{O}_2 \) is 1:1.[/tex]
Therefore, the moles of [tex]\( \text{CO}_2 \)[/tex] used is the same as the moles of [tex]\( \text{O}_2 \)[/tex]produced:
[tex]\[ \text{Moles of CO}_2 = 0.21875 \text{ moles} \][/tex]
4. Determine the molar mass of [tex]\( \text{CO}_2 \)[/tex] :
[tex]\[ \text{Molar mass of CO}_2 = 12.01 \text{ g/mol} + 2 \times 16.00 \text{ g/mol} = 44.01 \text{ g/mol} \][/tex]
5. Calculate the grams of \( \text{CO}_2 \) used:
[tex]\[ \text{Grams of CO}_2 = \text{Moles of CO}_2 \times \text{Molar mass of CO}_2 \][/tex]
[tex]\[ \text{Grams of CO}_2 = 0.21875 \text{ moles} \times 44.01 \text{ g/mol} = 9.62 \text{ g} \][/tex]
A gas mixture is made by combining 8.2 g each of ar, ne, and an unknown diatomic gas. at stp, the mixture occupies a volume of 19.44 l.what is the molar mass of the unknown gas
~Hey guys, can somebody answer this for me, thanks :) ~
The average distance between Earth and Mars is about 2.08*10^8 km. How long would it take to transmit television pictures from Mars to Earth?
The time required by an electromagnetic wave having a speed equal to that of light to travel a distance of 2.08 × 10⁸ km is 693. 3 seconds.
What is transmission of waves?Transmission of wave is the movement of waves from one medium to the other. Waves are the propagation of energy or matter. Waves are associated with certain wavelength and frequency.
The speed of an electromagnetic wave is equal to the speed of light, that is 3 × 10⁵ m/s. The time taken by a wave to cover a distance is dependant on the distance and air resistance.
It is given that the distance between moon and earth is 2.08 × 10⁸ km. The speed of light energy is 3 × 10⁵ m/s. Thus the time to cover this distance is calculated as follows:
Time = distance / speed
= 2.08 × 10⁸ km / 3 × 10⁵ m/s
= 693.3 seconds.
Hence, the television pictures from mars will take 693.3 seconds to reach earth.
To find more about electromagnetic waves, refer the link below:
https://brainly.com/question/3101711
#SPJ2
Which of the following is the correct formula for barium (II) sulfate?
What role does the oxidation agent play in a redox reaction
what location on earth experiences the least change in the number of daylight hours throughout the year?
what does an atomic number represent atom? 20 PIONTS TO WHO EVER ANSWERS PLS HELP
A)number of protons
B)number of electrons
C)number of neutrons
D)number of protons and neutrons
A child goes to the kitchen sink to rinse the glass from which he just drank grape juice. as the water runs into the glass, the juice residue turns from ppurple to light blue what is happening
If the formula for a compound is represented by X2Y3 and the charge on the Y ion is -2, what is the charge in the X ion?
If a feather and an iron bar is released from a same height in a room without any air resistance, which one(s) will impact the ground first.
A) neither one, because without air resistance gravity is absent
B) iron bar
C) both
D) feather
Both a feather and an iron bar will impact the ground at the same time if released from the same height in a room without air resistance, demonstrating that gravity causes all objects to fall with the same acceleration, disregarding their mass.
Explanation:If a feather and an iron bar are released from the same height in a room without any air resistance, both the feather and the iron bar will impact the ground at the same time. The correct answer is C) both. This outcome occurs because in the absence of air resistance, all objects fall at the same rate due to gravity. This phenomenon was famously demonstrated on the Moon by astronaut David R. Scott in 1971, where, despite the Moon's lower gravitational acceleration of 1.67 m/s² compared to Earth's 9.81 m/s², both a hammer and a feather were shown to fall at the same rate when dropped from the same height. This validates that acceleration due to gravity is constant and does not depend on the mass of the objects involved.
Learn more about Free-fall in a vacuum here:https://brainly.com/question/28228808
#SPJ3
Look up the first ionization energies of silver and manganese; which of these two elements would you call more metallic based on the way we define it in this book?
The ionization energies are related to metallic character. The elements which have low ionization energies tend to behave more metallic. The first ionization energy is the best indication of whether an element behaves as a metal or nonmetal. It can also be used to compare the metallic character of two metals. The ionization energy of manganese is 717 kJ/mol and that of silver is 731 kJ/mol. The ionization energy ionization energy of manganese is smaller than that of silver so it can easily lose electron and undergo chemical reaction. The ionization energy of silver is more therefore it will take time to lose electron and undergo oxidation. Hence, as per the book, manganese is more metallic than silver
Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.
The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.
Explanation:The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.
Learn more about Organic Compound Structure here:https://brainly.com/question/35316125
#SPJ3
which state of matter undergoes changes in volume most easily?
Gas is the state of matter that can most easily undergo changes in volume. The freely moving particles of gas adapt to take up the entire volume and shape of any container it is kept in.
Explanation:The state of matter that undergoes changes in volume most easily is gas. This is because gaseous substances have the most dispersed particles among the three fundamental states of matter (solids, liquids, and gases). These particles move freely, occupying the complete shape and volume of the container in which they are kept. Thus, any change in the container's size will in-turn affect the volume of the gas. For instance, if we inflate a balloon with gas and then deflate it, the gas volume adjusts in line with the balloon's volume changes.
Learn more about State of Matter
https://brainly.com/question/31659891
#SPJ6