find the square root of 1.69? show work ...?

Answers

Answer 1
what work? You just need to put the equation on your calculator ^^1.69) = 1.3
Answer 2

The value of the square root of the number 1.69 would be 1.3.

Used the concept of the square root of a number that states that,

The square root of a number is the number that, when multiplied by itself, gives the original number.

Given that the number is,

The square root of 1.69.

Now simplify the number as

The square root of 1.69.

It can be written as,

√1.69

√(1.3)²

= 1.3

Therefore, √1.69 = 1.3

To learn more about square root visit:

https://brainly.com/question/428672

#SPJ6


Related Questions

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

how is a tangent different from a chord

Answers

Answer:

A tangent is a line, ray, or line segment that intersects a circle at exactly one point (called the point of tangency) and contains no points inside the circle. A chord is a segment with both endpoints on a circle. Tangents intersect the circle at one point, while a chord intersects at two.

I've checked this answer, E counted it as correct. Hope this helped!!!

A tangent touches a circle at one point, while a chord connects any two points on the circle's circumference.

A tangent and a chord are both important concepts in geometry, but they have distinct characteristics.

A tangent is a line that intersects a circle at exactly one point, touching the circle's circumference at that point.

It never crosses the circle. Tangents are perpendicular to the radius that intersects the point of tangency.

On the other hand, a chord is a line segment connecting any two points on a circle's circumference. Unlike tangents, chords can intersect the circle at multiple points.

The diameter is a special case of a chord that passes through the center of the circle.

Hence,

Tangents touch a circle at one point, while chords connect two points on a circle's circumference.

To learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ6

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

How do you find the x-intercepts and y-intercepts of trinomials. E.g.(x^2-10x+25) How do you find the x-intercepts and y-intercepts of trinomials. E.g.(x^2-10x+25)

Answers

Final answer:

To find the x-intercepts, set the trinomial equal to zero and solve for x. Substitute x = 0 to find the y-intercept.

Explanation:

To find the x-intercepts of a trinomial, you need to set the trinomial equal to zero and solve for x.

In the example given (x^2-10x+25), you would set the trinomial equal to zero as follows:

x^2-10x+25 = 0

Now, you can factor the trinomial or use the quadratic formula to solve for x. In this case, the trinomial can be factored as (x-5)(x-5) = 0.

So, the x-intercept is x = 5.

The y-intercept can be found by substituting x = 0 into the trinomial. In this case, when x = 0, the trinomial becomes y = 25.

So, the y-intercept is (0, 25).

Over the past year, your friend Maura has been saving up for an epic road trip to travel across the country this summer. Her goal is to squeeze in as many sights as she can with her available budget of $2000.
Give an example of a sound financial decision Maura might make to support this goal. Why is it sound? Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Answers

"Give an example of a sound financial decision Maura might make to support this goal. Why is it sound?"

She could choose to carefully budget her trip and avoid overspending at all costs. This prevents going into debt. She should also save up extra money in the event of an emergency.

Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Not having a plan would be a poor decision on her part. She could end up spending too much and not realize how much money she has left.


I hope I helped!

Use substitution to solve the system
5x+4y=12
Y=2x-10

Answers

ok so do you know the steps for substitution

Substitute the 2x-10 in for I in the first equation:
5x+4(2x-10) =12

Distribute the 4:
5x+8x-40=12

Add 40 to both sides and combine the x terms:
13x=52

Divide by 13:
x=4

Plug the 4 into either equation for the x value:
y=2(4)-10
y=8-10
y=-2

Answer:
X=4
Y=-2

To check you can plug them into either one of the equations.

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

In 2005 at camp at 450 campers five years later the number of campers rose to 750 right now when you're equation that represents the number of campers that attend camp

Answers

Final answer:

To represent the number of campers attending the camp, use the equation y = mx + c, where y represents the number of campers, m represents the rate of increase, x represents the number of years, and c represents the initial number of campers. Using the given information, solve for the rate of increase (m) and initial number of campers (c). Substitute the values in the equation to find the number of campers attending the camp right now.

Explanation:

To represent the number of campers attending the camp right now, we can use the equation: y = mx + c, where y represents the number of campers attending the camp, m represents the rate at which the number of campers increase, x represents the number of years since 2005, and c represents the initial number of campers in 2005.

From the information provided, we know that in 2005 there were 450 campers and five years later, in 2010, the number of campers rose to 750. We can use these two points to find the values of m and c.

Using the formula: (y2 - y1) / (x2 - x1) = m, we can calculate the value of m as: (750 - 450) / (2010 - 2005) = 60. Therefore, the rate of increase is 60 campers per year. Now, we can substitute the values of m and c in the equation to find the number of campers attending the camp right now. y = 60x + 450.

Final answer:

The linear equation representing the number of campers attending camp each year, starting from 2005 with 450 campers and increasing by 60 campers per year, is C = 450 + 60t, where C is the number of campers and t is the number of years after 2005.

Explanation:

In 2005, there were 450 campers at a camp. Five years later, the number of campers increased to 750. To represent the growth in the number of campers, we can write a linear equation. Assuming the number of campers increases at a constant rate each year, we first find the rate of increase.

Rate of increase per year = (Number of campers in 2010 - Number of campers in 2005) / (2010 - 2005)

Rate of increase per year = (750 - 450) / (5)

Rate of increase per year = 300 / 5 = 60 campers per year

Let's denote C as the number of campers and t as the number of years after 2005. The equation that represents the number of campers is:

C = 450 + 60t

This equation indicates that starting with 450 campers in 2005, every year there are 60 more campers attending the camp.

Paul plans to put concrete on a rectangular portion of his driveway. The portion is 12 feet long and 6 inches high. The price of concrete is $98 per cubic yard. The total cost of the concrete Paul needs is $108.89. Which of the following is closest to the width of the portion of the driveway on which Paul plans to put concrete?

[1 foot = 12inches; 1 yard = 3 feet]

3 feet

5 feet

8 feet

10 feet

Answers

The width needed is 5 feet.

Answer:

The answer is b. 5 feet

Step-by-step explanation:


Given the equation Square root of 2x plus 1 = 3, solve for x and identify if it is an extraneous solution.

^ I really don't understand this topic, whatsoever. Could someone help?

Answers

The answer is 4.

Square root of 2x plus 1 = 3:
[tex] \sqrt{2x+1} =3[/tex]

Square both sides:
[tex]( \sqrt{2x+1} )^{2} =3^{2} \\ \\ 2x+1=9 \\ 2x = 9 - 1 \\ 2x =8 \\ x = 8:2 \\ x =4 [/tex]

By squaring both sides and solving for [tex]\(x\),[/tex] we find [tex]\(x = 4\)[/tex] as the solution, which is not extraneous upon substitution into the original equation.

To solve the equation [tex]\(\sqrt{2x + 1} = 3\),[/tex] we need to isolate[tex]\(x\).[/tex] Here's how:

1. Square both sides of the equation to eliminate the square root:

[tex]\[ (\sqrt{2x + 1})^2 = 3^2 \][/tex]

[tex]\[ 2x + 1 = 9 \][/tex]

2. Subtract 1 from both sides to isolate [tex]\(2x\)[/tex]:

[tex]\[ 2x = 9 - 1 \][/tex]

[tex]\[ 2x = 8 \][/tex]

3. Divide both sides by 2 to solve for [tex]\(x\)[/tex]:

[tex]\[ x = \frac{8}{2} \][/tex]

[tex]\[ x = 4 \][/tex]

Now, we have [tex]\(x = 4\)[/tex]. To determine if it's an extraneous solution, we need to check if it satisfies the original equation.

Substitute [tex]\(x = 4\)[/tex] into the original equation:

[tex]\[ \sqrt{2(4) + 1} = 3 \][/tex]

[tex]\[ \sqrt{9} = 3 \][/tex]

[tex]\[ 3 = 3 \][/tex]

Since the equation holds true, [tex]\(x = 4\)[/tex]is a valid solution, not an extraneous one.

Therefore, the solution to the equation [tex]\(\sqrt{2x + 1} = 3\) is \(x = 4\),[/tex]and it is not an extraneous solution.

What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

Are the graphs of −5y=2x+3 and y=25x+4 parallel, perpendicular, or neither?

Answers

parallel graphs have the same slope. perpendicular has opposite reciprocal slopes. These equations have slopes of -2/5 and 25 so they are neither.

The graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

What is a linear equation?

It is defined as the relation between two variables, if we plot the graph of the linear equation we will get a straight line.

If in the linear equation, one variable is present, then the equation is known as the linear equation in one variable.

It is given that:

The system of equations is:

 −5y=2x+3 and y=25x+4

The slope of parallel graphs is the same. The reciprocal slopes of a perpendicular are opposite.

These equations are neither because they have slopes of 25 and -2/5.

Thus, the graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

Learn more about the linear equation here:

brainly.com/question/11897796

#SPJ3


If x = a + bi and y = –a – bi, x + y = 0

Answers

That would be the inverse property of addition. When you add the opposite of a number to that number, your sum will be zero. -a is the opposite of a and -bi is the opposite of bi. When you add x + y (aka the opposites) your total is absolutely nothing!  

Answer:

inverse property

Suppose f(π/3) = 3 and f '(π/3) = −7,
and let
g(x) = f(x) sin x
and
h(x) = (cos x)/f(x).
Find the h'(x)

Answers

Final answer:

To find h'(x), differentiate the function h(x) = (cos x)/f(x) using the product rule.

Explanation:

To find h'(x), we need to differentiate the function h(x) = (cos x)/f(x).

First, let's find the derivative of cos x, which is -sin x.

Next, we need to find the derivative of f(x). Since f(π/3) = 3 and f '(π/3) = −7, we know the slope of the tangent line at x = π/3 is -7.

Using the product rule, we can now differentiate h(x) = (cos x)/f(x) as follows:

h'(x) = [f(x)(-sin x) - cos x(f '(x))]/[f(x)]^2

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

108/250 in simplest form in a whole number.

Answers

You cannot express 108/250 in a whole number but it can be simplified to 54/125

Solve the equation.

6 = 2(x + 8) - 5x

A. 2/3
B. 3 1/3
C. - 2/3
D. -3 1/3

Answers

I hope this helps you
6=2x+16-5x
6=(2x-5x)+16
6-16=2x-5x
-10=-3x
X=10/3

Laura was making a recipe that said the ingredients were for 6 people, but she needed to make it for 8 people. the recipe called for 2 2/3 cups of milk and 1/4 cup oil. how many of these liquid ingredients did she need for 8 people?

Answers

3 cups of milk and 2/4 cups of oil

Answer:

[tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

Step-by-step explanation:

Cups of milk for 6 people = [tex]2 \frac{2}{3} =\frac{8}{3}[/tex]

Cups of milk for 1 people = [tex]\frac{\frac{8}{3}}{6}=\frac{4}{9}[/tex]

Cups of milk for 8 people = [tex]\frac{4}{9} \times 8= \frac{32}{9}[/tex]

Cups of oil for 6 people = [tex]\frac{1}{4}[/tex]

Cups of oil for 1 people = [tex]\frac{\frac{1}{4}}{6}= \frac{1}{24}[/tex]

Cups of oil for 8 people = [tex]\frac{8}{24}=\frac{1}{3}[/tex]

Hence [tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

Josephine started a business selling cosmetics. She spent $4500 to obtain her merchandise, and it costs her $200 per week for general expenses. She earned $550 per week in sales. What is the minimum number of weeks it will take for Josephine to make a profit? Write an inequality to model the problem.

A.)550w > 4500 + 200w

b.)200w > 4500 + 550w

c.) 550w < 4500 + 200w

d.)200w 4500 + 550w
...?

Answers

Answer:

a

Step-by-step explanation:

Final answer:

Josephine will need at least 13 full weeks to start making a profit. The correct inequality that models this economic scenario is 550w > 4500 + 200w.

Explanation:

The minimum number of weeks it will take for Josephine to make a profit in her cosmetics business can be determined by setting up an inequality where the total earnings must be greater than the sum of the initial investment and the running costs. We define w as the number of weeks. Josephine earns $550 per week, so her earnings after w weeks are 550w. The initial investment is $4500 and the weekly expense is $200, so the total expenses after w weeks are 4500 + 200w. To make a profit, the earnings must be greater than the expenses:

550w > 4500 + 200w

To solve for w, we need to collect like terms:

550w - 200w > 4500

350w > 4500

Dividing both sides by 350:

w > 4500 / 350

w > 12.86

This means Josephine will need to work for at least 13 full weeks to make a profit.

five less than a number is at least -28 written as an inequality.

Answers

I believe it would be (if x was the number):
x - 5 ≥ -28. Hope this helps!
Final answer:

To write the inequality 'five less than a number is at least -28' in mathematical symbols, we need to assume the number is 'x' and express 'five less than a number' as 'x - 5'. We then represent 'at least -28' as '≥ -28'. By combining these expressions, we get the inequality x - 5 ≥ -28. To solve it, we add 5 to both sides to isolate the variable 'x' and obtain x ≥ -23.

Explanation:

To write the inequality, we need to translate the phrase 'five less than a number is at least -28' into mathematical symbols. Let's assume the number is represented by 'x'. 'Five less than a number' can be written as 'x - 5'. The phrase 'at least -28' means the number has to be greater than or equal to -28, which can be written as '≥ -28'.

Putting it together, the inequality is: x - 5 ≥ -28.

To solve this inequality, we can add 5 to both sides to isolate the variable 'x'. This gives us: x ≥ -28 + 5, which simplifies to x ≥ -23.

Learn more about Writing an inequality with given conditions here:

https://brainly.com/question/32122011

#SPJ2

The area of a rectangle is 70 square inches and the length of the rectangle is 3 inches longer than the width.

The area of a rectangle is found by multiplying the length times the width.

Which equation models this situation?

w(w+3)=70w(w+3)=70

w + 3 = 70

3w = 70

w + 3w = 70

Answers

Final answer:

The correct equation to model the rectangle's area where the length is 3 inches more than the width and the area is 70 square inches is W(W + 3) = 70, which simplifies to W^2 + 3W = 70.

Explanation:

The student is asking for the correct equation to model a rectangle's area where the length (L) is 3 inches more than the width (W), and the area is 70 square inches. To find an equation that models the situation, we need to express L in terms of W. Since L is 3 inches more than W, we can write L as W + 3. The area (A) of a rectangle is found by multiplying the length by the width, so A = L x W.

Therefore, the equation that models this situation is W(W + 3) = 70. To see why, let's insert the expression for L into the area formula:

A = L x W = (W + 3) x W

This simplifies to:

A = W^2 + 3W

Since we know the area A is 70 square inches, we substitute and get the equation:

W^2 + 3W = 70

Which is the correct model for the given situation.

1. Miguel tosses a coin three times. which diagram represents the sample space of the three tosses?

Answers

The only diagram that has the possibility that each coin toss could come up H or T is answer "c."

Tree diagram can be used to represent the sample space. The correct option is option C.

What is a tree diagram?

In probability, a tree diagram can be used to represent the sample space. Tree diagrams represent a series of independent events or conditional probabilities.

As it is given that the coin is tossed three times, therefore, the number of stages in the tree diagram will be three, where each time the coin is tossed will result in either heads or tails.

Now, the tree diagram of the coins can be drawn as shown below.

Further, comparing it with our diagram, the only possible option is option c where the number of levels in the tree is three and each toss result in either heads or tails.

Hence, the correct option is option C.


Learn more about Tree Diagram:

https://brainly.com/question/3269330

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

Suppose a local vendor charges $2 per hot dog and that the number of hot dogs sold per hour is given by
x(t) = −4t^2 + 20t + 64,
where t is the number of hours since 10 AM,
0 ≤ t ≤ 4.
Find an expression for the revenue per hour R as a function of x?

Answers

 simply,  R(x)=2x as a function of x.

A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B
Other Questions
The length of a rectangle is 4/5 feet. The width is 5/8 feet. How much greater is the length of the rectangle than the width?A.)7/40 feetB.)1/5 feetC.)3/20 feetD.)1/3 feet the actual distance between 2 cities is 135 km. the map scale is 1 cm : 100 km. find the map distance In a triangle, the second angle is twice the measure of the first, and the third angle is three times the measure of the second. Find the measure of the third angle.A. 20 degreesB. 30 degreesC. 120 degreesD. 180 degrees true or false? writers might choose to use outlines in sentence or paragraph form when they want to include specific examples or reasons in their outlines. which set of numbers is arranged in order from least to greatest?a. 0.35, 1/5,2/3,-0.7b. -0.7, 0.35, 1/5, 2/3c. -0.7, 1/5, 0.35, 2/3d. 1/5, 0.35, 2/3, -0.7 Wxyz is a parallelogram. name an angle congruent to xyz When a covalent bond forms between two atoms how many atoms have a full outer shell of electrons?A. oneB. twoC. ZeroD. It depends on what the atoms are 1.What was the most important consequence of the Louisiana Purchase?It provided for the future growth of the United States.It gave the United States a vast worthless wilderness.It eliminated the threat of the French west of the Mississippi River.It gave the United States all the territory that made up the first 48 states.2.What was the purpose of the Lewis and Clark expedition?to explore Californiato explore the Mississippi Riverto explore the Louisiana Purchaseto explore the land between the Appalachian Mountains and the Mississippi River Round each number to the nearest tenth. what is the best estimate for the difference of 264.72 128.49? a.137 b.136.3 c.136.2 d.130 Sean has trouble remembering all the geometry formulas. What can he do to make sure he doesn't forget these formulas during his tests?1.preview the test to see the types of questions asked2.read the directions for each part of his test carefully3.write the formulas somewhere on his test when he gets it4.focus on his favorite type of test question formats first A scout group is setting up a tent at camp. Because rain is predicted, the scouts decide to build a fly, or rain cover, over the tent. The fly will be 12 feet high and 16 feet wide. The scouts are building the frame for the fly with poles slanted to meet over the top of the tent. What is the minimum length of the poles needed to support the fly? A scientist is working with 0.9m of gold wire. How long is the wire in millimeters? A physicist wants to examine the characteristics of the new material the physicist will most likely do so by what method?A survey a group of people B perform fieldwork in a remote location C perform laboratory experimentsD make observations of an ecosystemPLEASE EXPLAIN ANSWER The half-life of a radioactive element is 1250 years. What percent of atoms remain after 7500 years? A file type that allows a document to be read on most computers is a _____. Vanessa deposited money into a bank account that earned 1.25% simple interest each year. After 1/2 year, she had earned $5.00 in interest on the account. If no other money was deposited into or withdrawn from the account, how much was her initial deposit bioelectrical impedance analysis is a method of measuring the opposition to the flow of an electrical signal through the body fluids mainly found in muscle and fatA trueB false Regular hexagon ABCDEF is inscribed in a circle with a radius of 2 units. Find measure of central angle AGFapothem a=GHside length s=perimeter P=hexagon area A= A friend rewrote the expression 5(x 2) as 5x 2.write a few sentences to your friend explaining the error. then rewrite the expression 5(x 2) correctly Jessie and Nathan went out to eat. Their lunch cost $17.98. If they give the waitress a 17% tip, how much was their total cost? Steam Workshop Downloader