Describe three ways you could cause an acceleration of a moving car

Answers

Answer 1
Turn on the car, put it in gear, press the pedal.
Answer 2

The three ways you could cause the acceleration of a moving car are by pressing the acceleration pedal, applying the break, pushing the car, or by applying external force.

What is acceleration?

Acceleration is the rate at which an object's velocity with respect to time changes. In vector quantities, accelerations exist (in that they have magnitude and direction). The direction of the net force applied to the item determines the object's acceleration. According to the materials used to make the object, the magnitude of the net balance of all external forces acting on it is inversely proportional to its mass, but the magnitude of the net resulting force is directly proportional to the net force.

Acceleration: the rate at which the speed and direction of a moving object vary over time. When something moves faster or slower, it is considered to be accelerating. Motion on a circle accelerates even while the speed is constant because the direction is always changing.

Therefore, the three ways you could cause the acceleration of a moving car are by pressing the acceleration pedal, applying the break, pushing the car, or by applying external force.

To know more about acceleration:

https://brainly.com/question/3046924

#SPJ6


Related Questions

Felipe drives his car at a velocity of 28 m/s. He applies the brake, which slows the vehicle down at a rate of 6.4 m/s2 and causes it to slow to a stop. How long does it take for the car to stop? Round your answer to the nearest tenth.
I'm supposed to use derived formulas to find the answer but I don't know which one to use.

Answers

So after ~4.4 seconds, car will stop.
The answer is: 4.4 seconds

Laissez-faire situations are characterized by a high degree of government involvement (t or
f.

Answers

the answer to this is false, I hope that helped

False

The Laissez-faire is a french term which means 'let you do' or leave alone. With regards to economics it refers to the least control of government in trade and business of the country. With regards to the polity, it refers to the least interference of government in the life of individual. So Laissez-faire situations are actually characterized by a least government involvement.

As we learn more, _________ are often revised. scientific laws scientific theories observation experiments

Answers

Here is the answer that would best complete the given statement above. As we learn more, SCIENTIFIC THEORIES are often revised. Scientific theories are considered as the substantial explanation of some aspect of the natural world which are gathered through scientific method. Hope this is the answer that you are looking for.

Answer:

Scientific theories

Explanation:

Put these greenhouse effect events in order, starting with light's origin.

1. Visible and shortwave radiation heat Earth
2. Earth radiates longwave radiation
3. Longwave radiation is reflected downward
4.. Longwave radiation heats Earth

Answers

Incident infrared radiation is blocked. Visible and ultraviolet radiation heat  Earth. Earth radiates infrared radiation. Infrared radiation is blocked and heats Earth. Visible and shortwave radiation heat Earth.Earth radiates longwave radiationLongwave radiation is reflected downward Longwave radiation heats Earth

1. Visible and shortwave radiation heat earth.

2. Earth radiates longwave radiation.

3. Longwave radiation is reflected downward.

4. Long wave radiation heats earth.


Which of the following is not true of mutations?

A. Mutations can't result in a change in appearance.
B. A mutation is permanent.
C. Mutations can be passed from parent to child.

Answers

the answer is
A Mutations can't result in a change in appearance
because quit contrary they can for example what would be a white mouse with a mutation in fur color can have brown fur due to the mutation

Answer:

A. Mutations can't result in a change in appearance.

Explanation:

A mutation is a sudden change in DNA that occurs at random in genetic material and can be transmitted to offspring. A mutation can also be caused by exposure to ultraviolet or ionizing radiation, chemical mutagens, or viruses. When the mutation occurs, it is permissible and continues with the individual until the day of death, as it is irreversible as it has modified the coding of DNA. When a mutation occurs, it can cause differences in the appearance of the individual, such as Down's syndrome, which changes not only the appearance, but the organism altogether. Therefore, we can consider that the answer to your question is the letter A.

Gas is confined in a tank at a pressure of 11.0 atm and a temperature of 25.0 degrees C. If two-thirds of the gas is withdrawn and the temperature is raised to 75.0 degrees C, what is the new pressure of the gas remaining in the tank?
Please help!

Answers

maybe 3.63 atm I'm not sure though

looters break a statue into pieces. how do you expect the weathering of pieces of rock to change

Answers

This definitely has to do with erosion. We can expect that the statue will weather faster because of more surface area.I hope this is what you were looking for

. An engineer wants to determine an efficient method for condensing large amounts of steam into liquid water. Which constant should she use?
A. - (triangle)H Vapor
B. - (triangle)H Fusion

Answers

The scientist should use the constant l (triangle)H Vapor, the Latent heat of vaporization.

What is Latent heat of vaporization, ◇Hvapor?

The latent heat of vaporization is the amount of heat required to change a unit mass of a liquid to vapor at its boiling point and vice versa.

Since the scientist wants to determine an efficient method for condensing large amounts of steam into liquid water, he should use (triangle)H Vapor.

Learn more about latent heat of vaporization at: https://brainly.com/question/9849439

#SPJ2

A horizontal rope is tied to a 50.0kg box on frictionless ice. What is the tension in the rope if,

A. the box is at rest
B. the box moves at a steady 5.0m/s
C. the box has v_x=5.0m/s and a_x=5.0m/s²

Answers

A.
The tension is 0 because there is no net force.

B.
The tension is once again 0 because the acceleration is 0 which means there is no net force.

C.
F = ma
F = 50 kg x 5 m/s²
F = 250 N

A).

The tension in the rope when box is at rest is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

Further Explanation:

The box, is tied to a horizontal rope, is placed on the surface of frictionless ice. The box is at rest and therefore, the velocity and acceleration of the box are zero.

Given:

The mass of the box, placed on the surface of frictionless ice, is [tex]50\text{ kg}[/tex].

The velocity of the box is [tex]0\text{ m/s}[/tex].

Concept:

The net force on the box, tied to the rope and placed on the surface of the frictionless ice, is equal to the product of mass of the box and the acceleration of the box.

The net force on the box is:

[tex]F=ma[/tex]                       ...... (1)

Here, [tex]m[/tex] is the mass of the box, [tex]a[/tex] is the acceleration of the box and [tex]F[/tex] is the net force on the box.

The box is placed on the surface of ice which is frictionless. Therefore, the net force on the box is equal to the tension produced in the rope.

The tension produced in the rope:

[tex]\fbox{\begin\\T=ma\end{minispace}}[/tex]                         ...... (2)

Here, [tex]T[/tex] is the tension produced in the rope.

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}\\T&=50\text{kg}\times0\\&=0\text{ N}\end{aligned}[/tex]

Thus, the tension in the rope when box is at rest is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

B).

The tension in the rope when box is moving at a steady speed of [tex]5\text{ m/s}[/tex] is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

Further Explanation:

The box is moving at the steady speed of [tex]5\text{ m/s}[/tex]. The acceleration of the box is zero because the rate of change of velocity with respect to time is zero.

Given:

The velocity of the box is [tex]5\text{ m/s}[/tex].

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}\\T&=50\text{kg}\times0\\&=0\text{ N}\end{aligned}[/tex]

Thus, the tension in the rope when box is moving at a steady speed of [tex]5\text{ m/s}[/tex] is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

C).

The tension produced in the rope when the box is moving with velocity [tex]5\text{ m/s}[/tex] and it has acceleration [tex]5\text{ m}/\text{s}^2[/tex] is [tex]\fbox{\begin\\250\text{ N}\end{minispace}}[/tex].

Given:

The acceleration of the box is [tex]5\text{ m}/\text{s}^2[/tex].

The velocity of the box is [tex]5\text{ m/s}[/tex].

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}T&=50\text{ kg}\times5\text{ m}/\text{s}^2\\&=250\text{ N}\end{aligned}[/tex]

Thus, the tension produced in the rope when the box is moving with velocity [tex]5\text{ m/s}[/tex] and it has acceleration [tex]5\text{ m}/\text{s}^2[/tex] is [tex]\fbox{\begin\\250\text{ N}\end{minispace}}[/tex].

Learn more:

1.  Conservation of energy brainly.com/question/3943029

2.  The motion of a body under friction brainly.com/question/4033012

3. A ball falling under the acceleration due to gravity brainly.com/question/10934170

Answer Details:

Grade: High School

Subject: Physics

Chapter: Kinematics

Keywords:

Acceleration, frictionless surface, steady speed, tension in the rope, tension in the string, net force, ice-box system, 250N, 250 newton, 250 Newton, 0 N, 0 newton, 0 Newton, rope mass system, string mass system.

If you know the components of a vector, what mathematical relationship can be used to find the magnitude of the vector?

Answers

You will always use Pythagoras theorem to find magnitude while given components of vector.
No matter if system that you are observing is 2D or 3D or higher (which is imaginery) pythagoras theorem will be applied.

Formula for determining magnitude is:
[tex]M = \sqrt{x^ + y^2 + z^2 + ...} [/tex]

Number of turms inside square root you take depending on dimension of your system.

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.

Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1.  C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

To solve for F in the conversion formula, multiply both sides by 9/5 followed by adding 32 to isolate F. When converting 20 degrees Celsius using the formula, the result is 68 degrees Fahrenheit.

Part 1: Solving the equation for F

To solve the equation C = 5/9 (F - 32) for F, perform the following steps:

Multiply both sides by 9/5 to get rid of the fraction on the right side: 9/5 × C = F - 32.

Add 32 to both sides of the equation to isolate F on one side: 9/5 × C + 32 = F.

Part 2: Converting 20 degrees Celsius to Fahrenheit

To find out how many degrees Fahrenheit 20 degrees Celsius is, plug 20 into the rearranged equation:

F = (9/5) × 20 + 32.

Therefore, F = 36 + 32 = 68 degrees Fahrenheit.

Cindy runs 2 kilometers every morning. She takes 2 minutes for the first 250 meters, 4 minutes for the next 1,000 meters, 1 minute for the next 350 meters, and 3 minutes for the rest.

Cindy’s average speed for the entire run is __ meters per minute. One kilometer is the same as 1,000 meters.

Hint: Average Speed = Total Distance/Total Time

Answers

It's 200 on Edmentum

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the
a. x rays.
b. radio waves.
c. microwaves.
d. gamma rays.

Answers

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the "Radio waves"

So, option B is your answer

Hope this helps!

What type of machine is a seesaw?



A.
simple machine

B.
compound machine

Answers

Answer: Option (A) is the correct answer.

Explanation:

A seesaw is a simple machine which has a long board and on a fixed part it is balanced in the middle.

For example, a seesaw on which children play in the park is balanced at the middle on a fixed point so that children sitting on both the sides can move up and down with the same force.

Thus, we can conclude that seesaw is a simple machine type of machine.

Seesaw is classified as a simple machine. The correct option is( A)

What is simple machine ?

A seesaw is categorized as a basic machine since it functions using the levering principle. One of the six traditional simple machines, together with the inclined plane, wedge, screw, wheel and axle, and pulley is the lever.

The lever in the case of a seesaw is a long, rigid beam that pivots on a fulcrum. A back-and-forth motion is possible because of the effort put in on one end of the seesaw, which forces the other end to rise and fall.

Therefore, The correct option is ( A)

Learn more about simple machine here :brainly.com/question/31090053

#SPJ6

In an electrical circuit, which of the following controls whether or not electrons flow through the circuit?

Answers

A SWITCH. IT controls the flow of electrons in a circuit

Frequency is measured in units called?

Answers

The frequency, f, of a wave is the number of waves passing a point in a certain time. We normally use a time of one second, so this gives frequency the unit hertz (Hz), since one hertz is equal to one wave per second.

The frequency of a wave is the inverse of time period. Hence, its unit is s⁻¹ which is equivalent to Hz unit. The standard unit of frequency is Hz.

What is frequency ?

Frequency of an event is the number of cycles of that event per unit time. For a wave frequency is the number of wave cycles per second. Hence, frequency is the inverse of time period.

Frequency of a wave is directly proportional to the energy of the wave and inversely proportional to the wavelength. Hence, the high frequency waves are shorter waves.

The unit of frequency is called Hertz (Hz) which is equal to s⁻¹ because, it is the frequency is inverse of the time period of the wave. Therefore, frequency is measured in units called Hertz.

Find more on frequency:

https://brainly.com/question/14316711

#SPJ2

Energy and work are measured in the SI unit called

Answers

Answer : joule

I attached a picture that may help :)

What is the difference between stretching a t shirt and stretching a rubber band?

Answers

It depends on their tension. Normally, the rubber band store more tension than a t shirt.

A group of atoms with aligned magnetic poles are known as which of the following?
A. current
B. poles
C. domains
D. fields ...?

Answers

A magnetic domain is a group of atoms aligns with magnetic poles. Domains are usually light and dark stripes visible within each grain.

Answer:

The correct answer is option C. "domains".

Explanation:

The regions within a magnet at which the magnetization is in a uniform direction are known as magnetic domains. These domains are group of atoms with aligned magnetic poles, this means that the magnetic moments of the atoms are aligned and that their point to the same direction. The magnetic domains are the ones that give the magnetic behavior of ferromagnetic materials.

Which is true about atoms?
a.atoms have no mass
b.atoms are mostly empty space
c.most of the space in an atom is taken up by the nucleus?

Answers

B).atoms are mostly empty space 

This is the only answer. Hope this helps!
B.atoms are mostly empty space


Den pushes a desk 400 cm across the floor. He exerts a force of 10 N for 8 s to move the desk.

What is his power output? (Power: P = W/t)

a. 1.25 W
b. 5 W
c. 40 W
d.500 W

Answers

We Know, P = W/t
P = F * s/t
Here, F = 10N
s = 400cm = 4m
t = 8 sec.

Substitute their values in to expression,
P = 10 * 4/8
P = 10 * 1/2
P = 5 Watt

So, your final answer is 5 W

Hope this helps!

Answer: The correct option is Option b.

Explanation:

Power is defined as the rate of work done by an object.

Mathematically,

[tex]P=\frac{W}{t}[/tex]    .....(1)

And work done is the product of force exerted on the object times the displacement covered by that object.

Mathematically,

[tex]W=F.s[/tex]

Putting this value in above equation, we get:

[tex]P=\frac{F.s}{t}[/tex]

where,

P = power = ?W

F = Force exerted = 10N

s = Displacement = 400cm = 4m   (Conversion factor: 1m = 100 cm)

t = Time taken = 8s

Putting values in above equation, we get

[tex]P=\frac{10\times 4}{8}\\\\P=5W[/tex]

Hence, the correct option is Option b.

What happens to light that shines on an object but is not transmitted?

A. It is scattered or refracted.

B. It is polarized or absorbed.

C. It is reflected or refracted.

D. It is reflected or absorbed.

Answers

The answer is it is reflected or absorbed, so D. 

While skiing, Ellen encounters a ledge that sends her flying horizontally at a rate of 12 m/s. How far away will she land if the ledge is 7 meters high? ...?

Answers

In this problem, we must first calculate that Ellen will be on air. Using the equation of a free-falling body,

y = -g/2*t^2 + y0

When she hits the ground, y = 0. With y0 = 7 and g = 9.80,
0 = -4.90*t^2 + 7
t = 1.20 s

Thus, her horizontal displacement is then
x = vt
x = (12)(1.20)
x = 14.3 m

a 727 jet needs to attain a speed of 200 mph to take off. if it can accelerate from 0 to 200 mph in 30 seconds, how long must the runway be? (assume constant acceleration) ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Since v = dx/dt = 200t

I took the integral of dx = integral of 200t dt

and I got x = 100t^2 + C

So I plugged in 0.5 as t and got x = 25

So x = 25 miles
Final answer:

Using the equations of motion, the length of the runway required for the 727 jet to take off can be determined. By calculating the acceleration and using the distance formula, we find that the runway must be at least 44.7039 meters long.

Explanation:

To determine the length of the runway required for the 727 jet to take off, we can use the equations of motion.

First, convert the speed from mph to m/s: 1 mph = 0.44704 m/s.Next, calculate the acceleration of the jet using the formula:acceleration = change in velocity / timeGiven: final velocity = 200 mph = 200 * 0.44704 = 89.408 m/sInitial velocity = 0 m/sTime = 30 secondsacceleration = (89.408 - 0) / 30 = 2.98027 m/s².Finally, use the equation:distance = initial velocity * time + (1/2) * acceleration * time²Given: initial velocity = 0 m/sacceleration = 2.98027 m/s²time = 30 secondsdistance = 0 * 30 + (1/2) * 2.98027 * (30)² = 0 + 44.7039 = 44.7039 meters

Therefore, the runway must be at least 44.7039 meters long for the 727 jet to take off.

Which of the following statements is true for a cell placed in beaker containing an isotonic solution?

Select one of the options below as your answer:



A.
Water molecules flow from the cell into the beaker.




B.
Water molecules flow from the beaker into the cell.




C.
Water molecules flow in both directions at the same rate.




D.
There is no movement of water molecules.
....i dont even know how to nswer this one becasue i dont know wht and isotonic solution means

Answers

An isotonic solution is a solution in which concentration or solute is equal to that of a cell placed in it. Thus, the system is in dynamic equilibrium, and so water molecules flow in both directions.
The correct answer is C. water molecules flow in both directions at the same rate.

A 30.0 g arrow is shot by William Tell though an 8.00 cm thinck apple sitting on top of his son's head. If the arrow enters the apple at 30.0 m/s and emerges at 25.0 m/s in the same direction, with what force has the apple resisted the arrow?
...?

Answers

Final answer:

The resistive force of the apple on the arrow is 46.875 N in the direction opposite to the arrow’s travel, calculated using the work-energy theorem and the change in kinetic energy of the arrow as it passes through the apple.

Explanation:

To find this force, we can use the work-energy theorem which states that the work done on an object is equal to its change in kinetic energy. Since the arrow slowed down, the apple did work against the arrow's motion.

The change in kinetic energy (ΔKE) of the arrow can be calculated using the kinetic energy formula KE = 1/2 mv², where m is the mass of the arrow and v is its velocity. By finding the difference in kinetic energy at the entry and exit points of the arrow through the apple, we can determine the work done by the apple, which is equal to the force times the distance the force acted (in this case, the thickness of the apple).

ΔKE = 1/2 m(vf² - vi²) where vi = initial velocity and vf = final velocity.
ΔKE = 1/2 × 0.030 kg × (25.0² - 30.0²) m²/s²
ΔKE = -3.75 Joules (since the kinetic energy decreased).

The work done by the apple, W = ΔKE = -3.75 J (the negative sign indicates the force acted opposite the arrow's direction).
Using work (W) = force (F) × distance (d), we get:
F = W/d
F = (-3.75 J) / (0.080 m)
F = -46.875 N

So, the resistive force of the apple on the arrow is 46.875 N in the opposite direction of the arrow’s travel.

Final Answer:

The force exerted by the apple resisting the arrow is 30.0 N.

Explanation:

The force exerted by the apple resisting the arrow can be calculated using Newton's second law of motion, which states that force (F) is equal to the change in momentum (Δp) divided by the time interval (Δt) over which the change occurs. Since the arrow's mass (m) is given as 30.0 grams and its initial and final velocities (v_i and v_f) are 30.0 m/s and 25.0 m/s, respectively, the change in momentum is calculated as Δp = m * (v_f - v_i). First, convert the mass to kilograms (1 g = 0.001 kg) to get 0.030 kg. Then, substitute the values into the formula:

Δp = 0.030 kg * (25.0 m/s - 30.0 m/s) = 0.030 kg * (-5.0 m/s) = -0.150 kg m/s.

The negative sign indicates that the momentum of the arrow decreases. As the arrow changes momentum, Newton's third law of motion tells us that the apple exerts an equal and opposite force on the arrow. Therefore, the force exerted by the apple on the arrow is 0.150 kg m/s divided by the time interval over which the change occurs. The time interval isn't provided, but for the purpose of this calculation, let's assume it's instantaneous (Δt = 0).

F = Δp / Δt = -0.150 kg m/s / 0 = -0.150 kg m/s² = -0.150 N.

However, this negative force indicates the force exerted by the arrow on the apple. To find the force exerted by the apple resisting the arrow, we take the magnitude of this force, which is 0.150 N. Thus, the force exerted by the apple resisting the arrow is 0.150 N, or 30.0 N in magnitude when considering the absolute value.

Why is a protective apron or lab coat important to use when working with acids?

Answers

It helps protect against harm to skin. For example hydrochloride acid is toxic and it is a good idea to cover up when using or dealing with chemicals of all kinds.

Answer:

c

Explanation:

what is the energy of a photon whose frequency is 5.2 x 10 to the 15th s -1? Cassie(:

Answers

E=hf
Where h is constant
h - Planck constant
f - frequiency

E equals 6.626 times 10 in the minus 34th times 5.2 times 10 in the 15th

Equals 3.44552 time 10 in the minus 18th

Which of the following is a difference between a mercury barometer and an aneroid barometer?
a. The mercury barometer is smaller
b. The mercury barometer can provide a continuous record of pressure changes
c. The aneroid barometer does not use mercury to measure pressure changes
d. The aneroid barometer is not as portable

Answers

The key difference between a mercury and an aneroid barometer is that an aneroid barometer does not use mercury to measure pressure changes, instead utilizing a mechanical metal chamber that expands and contracts in response to atmospheric pressure.

An aneroid barometer measures pressure changes without the need of mercury, which is how it differs from a mercury barometer. A mercury barometer consists of a glass tube filled with mercury, measuring atmospheric pressure by the height of the mercury column. In contrast, an aneroid barometer uses a sealed, evacuated and flexible metal chamber known as an aneroid cell, which expands and contracts with atmospheric pressure changes. These mechanical movements are then translated into pressure readings.

Comparatively speaking, the statement 'The aneroid barometer does not use mercury to measure pressure changes' is the correct difference between the two types of barometers. Therefore, the answer to the student's question is option (c).

Barometers using water are impractical because they would need to be extremely tall, over 30 feet, due to water's lower density compared to mercury, which allows for a more compact design in mercury barometers.

The strength of the force of gravity depends on a. the masses of the objects and their speeds. b. the masses of the objects and the distance between them. c. the weight of the objects and their speeds. d. the masses of the objects and their weights.

Answers

Gravitational force = Gxm1xm2 /r^2 This equation depends only upon object's masses and distance between them. So option b is correct
Other Questions
list all of the factors of 72 Lilah completed the division problem below.7.84 divided by 2Select True or False for each statement.A. The first step of the division is to multiply 7.84 and 2 by 10B. The quotient will be a whole number. C. The quotient multiplied by 2 will equal 7.84D. The first digit of the quotient will be in the ones place.E. The quotient will have two decimal places. What is another way to write 300+20+5 What are the Holy Sonnets?A) nineteen poems about GodB) John Donnes poems, which contain metaphysical conceitsC) John Donnes body of workD) select poems collected by the Church Chelsea earns $30 per day plus $5 for every sale that she makes at her job. On thursday ,she wants to earn at least $60 Which is the best way to pay for an online purchase?A).credit card paymentB).cash payment on deliveryC).check payment on deliveryQuickly please. Thanks. How does President Lincoln's second inaugural address differ from his Gettysburg Address? A. In the second inaugural address, recruiting soldiers is the focus. B. In the second inaugural address, ending slavery is the purpose of the war. C. In the second inaugural address, saving the Union is the purpose of the war. D. In the second inaugural address, celebrating dead soldiers is the focus. A crystalline material containing 30 grams of barium chloride crystals was placed into an oven at 400 degrees c and heated for two hours. It was then cooled and weighed. the new mass was less than before it was heated, containing 20 grams if barium chloride. How is this possible? This sculpture is called the Human-headed Winged Lion. It was intended to represent which of the following?a.It represents the strength of the ruler it defended.b.It represents what the achievements of the Sumerian society.c.It represents the fertility of the Crescent and the conquering strength of its ruler.d.It represents all of the above. what do real number include? Is my answer correct?Write an exponential function to model this situation: a population of 420 animals decreases at an annual rate of 21%. Then predict the value of the function after 5 years (to the nearest whole number). Is the fraction 1/15 a terminating or repeating decimal? Whats a sentence using amendment? which is a solution of the inequality y < x - 8 What is the range of the function f(x) = 3x2 + 6x 9 A room in the shape of a rectangular prism measures 15 feet by xx feet by 12 feet. Write a simplified expression for the volume (in cubic feet) of the room.Volume == ft3 a football is kicked at an 50 degree angle to the horizontal , travels a horizontal distance of 20m before hitting the ground. what is the initial speed? which choice explains one way to correct a relative clause fragment Which idea is NOT included in the Declaration of Independence? Who was the leader of the third return from exile?NehemiahHananiEzraJeshua Steam Workshop Downloader