Complete the following statement: today, the standard unit of time is defined in terms of

Answers

Answer 1
Today, the standard unit of time is defined in terms of electromagnetic waves emitted by cesium atoms.
Answer 2

Today, the standard unit of time is defined in terms of electromagnetic waves emitted by cesium atoms. The correct option is A.

What are electromagnetic waves?

In physics, electromagnetic radiation is made up of electromagnetic field waves that travel through space carrying electromagnetic radiant energy.

Radio waves, microwaves, infrared, light, ultraviolet, X-rays, and gamma rays are all examples of electromagnetic waves. These waves are all part of the electromagnetic spectrum.

Because of their oscillating electric and magnetic fields, energy waves are referred to as electromagnetic (EM).

Scientists categorize them based on their frequency or wavelength, from high to low frequency, short to long wavelength.

The second is the duration of 9,192,631,770 radiation periods corresponding to the transition between the two hyperfine levels of the cesium 133 atom's ground state.

Thus, the correct option is A.

For more details regarding electromagnetic waves, visit:

https://brainly.com/question/3101711

#SPJ2

Your question seems incomplete, the missing options are:

(a) the electromagnetic waves emitted by cesium atoms.(b) the motion of the moon around the earth.(c) the motion of a precision pendulum.(d) the average solar day.

Related Questions

As we learn more, _________ are often revised. scientific laws scientific theories observation experiments

Answers

Here is the answer that would best complete the given statement above. As we learn more, SCIENTIFIC THEORIES are often revised. Scientific theories are considered as the substantial explanation of some aspect of the natural world which are gathered through scientific method. Hope this is the answer that you are looking for.

Answer:

Scientific theories

Explanation:

Why is a protective apron or lab coat important to use when working with acids?

Answers

It helps protect against harm to skin. For example hydrochloride acid is toxic and it is a good idea to cover up when using or dealing with chemicals of all kinds.

Answer:

c

Explanation:

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.

Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1.  C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

To solve for F in the conversion formula, multiply both sides by 9/5 followed by adding 32 to isolate F. When converting 20 degrees Celsius using the formula, the result is 68 degrees Fahrenheit.

Part 1: Solving the equation for F

To solve the equation C = 5/9 (F - 32) for F, perform the following steps:

Multiply both sides by 9/5 to get rid of the fraction on the right side: 9/5 × C = F - 32.

Add 32 to both sides of the equation to isolate F on one side: 9/5 × C + 32 = F.

Part 2: Converting 20 degrees Celsius to Fahrenheit

To find out how many degrees Fahrenheit 20 degrees Celsius is, plug 20 into the rearranged equation:

F = (9/5) × 20 + 32.

Therefore, F = 36 + 32 = 68 degrees Fahrenheit.

Which of the following is a difference between a mercury barometer and an aneroid barometer?
a. The mercury barometer is smaller
b. The mercury barometer can provide a continuous record of pressure changes
c. The aneroid barometer does not use mercury to measure pressure changes
d. The aneroid barometer is not as portable

Answers

The key difference between a mercury and an aneroid barometer is that an aneroid barometer does not use mercury to measure pressure changes, instead utilizing a mechanical metal chamber that expands and contracts in response to atmospheric pressure.

An aneroid barometer measures pressure changes without the need of mercury, which is how it differs from a mercury barometer. A mercury barometer consists of a glass tube filled with mercury, measuring atmospheric pressure by the height of the mercury column. In contrast, an aneroid barometer uses a sealed, evacuated and flexible metal chamber known as an aneroid cell, which expands and contracts with atmospheric pressure changes. These mechanical movements are then translated into pressure readings.

Comparatively speaking, the statement 'The aneroid barometer does not use mercury to measure pressure changes' is the correct difference between the two types of barometers. Therefore, the answer to the student's question is option (c).

Barometers using water are impractical because they would need to be extremely tall, over 30 feet, due to water's lower density compared to mercury, which allows for a more compact design in mercury barometers.

Which of the following is a balanced equation?

N2 + 3H2 ⇒ 2NH3

3N2 + 3H2 ⇒ 2NH3

N2 + H2 ⇒ 2NH3

Answers

Final answer:

The correct balanced equation is N₂ + 3H₂ ⇒ 2NH3, which represents the chemical reaction where one mole of nitrogen reacts with three moles of hydrogen to produce two moles of ammonia. The coefficients reflect the simplest whole number ratio for the stoichiometry of the reaction.

Explanation:

The balanced chemical equation among the given options is N₂ (g) + 3H₂ (g) ⇒ 2NH3 (g). This reflects the stoichiometry of the reaction where each nitrogen molecule (N₂) reacts with three hydrogen molecules (3H₂) to form two molecules of ammonia (2NH3). The coefficients indicate the mole ratio needed for the reaction to occur, which is also demonstrated through models showing the combination of gas volumes following the reaction stoichiometry. Alternatively, the equation 3N2 + 9H2 → 6NH3 is not balanced at the simplest ratio. After dividing each coefficient by the greatest common factor (3), the previous balanced equation is obtained, which is the preferred simplified form. This balanced equation can be used to establish an equilibrium in a sealed container, showcasing the relationship between changes in the concentrations of the species involved, as determined by the stoichiometry.

Final answer:

The balanced chemical equation for the synthesis of ammonia from nitrogen and hydrogen is N₂ (g) + 3H₂ (g) → 2NH3 (g), which follows the stoichiometric ratio of 1:3:2.

Explanation:

The balanced equation for the reaction between nitrogen (N₂) and hydrogen (H₂) to form ammonia (NH₃) is N₂ (g) + 3H₂ (g) → 2NH3 (g). This equation satisfies the law of conservation of mass, meaning that the number of atoms for each element is the same on both the reactant and product sides of the equation. One mole of nitrogen gas reacts with three moles of hydrogen gas to yield two moles of ammonia gas, indicating a mole ratio of 1:3:2, respectively. The equation shows ammonia molecules are produced from nitrogen and hydrogen molecules in a 2:3 ratio, reflecting the stoichiometry of the reaction.

A wave has a wavelength of 45 meters and a period of 9.0 seconds. What is the frequency of the wave?

Answers

frequency is the reciprocal of period

f = 1/9 = 0.11 Hz

Answer: The correct answer is 0.11 Hz.

Explanation:

The relation between frequency of the wave and time period is as follows;

[tex]f=\frac{1}{T}[/tex]

Here, f is the frequency of the wave and T is the time period.

Here, the frequency is inversely proportional to the time period.

It is given in the problem that a wave has a wavelength of 45 meters and a period of 9.0 seconds.

Calculate the frequency of the wave.

[tex]f=\frac{1}{T}[/tex]

Put T= 9 s.

[tex]f=\frac{1}{9}[/tex]

f=0.11 Hz

Therefore, the frequency of the wave is 0.11 Hz.

Which of the following processes is most affected by pressure?
A. freezing
B. boiling
C. melting Which of the following processes is most affected by pressure?
A. freezing
B. boiling
C. melting

Answers

Answer:

The answer is: B. boiling.

Explanation:

The value of the melting and boiling points are affected by the value of the atmospheric pressure.

The Celsius degree is the unit corresponding to the melting and boiling temperatures of water at 1 atm pressure. Celsius: Melting 0 ℃, Boil 100 ℃.

When a food is frozen at normal atmospheric pressure, its temperature drops to 0 ° C, at which time the water begins to turn into ice.

Normally, the atmospheric pressure that exists at sea level is taken as a reference. There it takes a value of 1 atmosphere.

Therefore, although the pressure is 1 atmosphere for all processes, the one that needs more temperature is the Boiling, which is 100 ° C.

The answer is: B. boiling.

At the beginning of a basketball game, a referee tosses the ball straight up with a speed of 4.6 m/s. A player cannot touch the ball until after it reaches its max height and begins to fall down. What is the minimum time that a player must wait before touching the ball?

Answers

Final answer:

The minimum time a player must wait before touching the basketball after it has been tossed straight up by the referee is approximately 0.469 seconds, which is the time taken for the ball to reach its maximum height.

Explanation:

The student is asking about the time it takes for an object (a basketball in this case) to reach its maximum height when thrown vertically upwards. This situation can be analyzed using the equations of motion under constant acceleration due to gravity. Since gravity will be slowing down the ball until it stops and starts falling, we can use the initial velocity and the acceleration due to gravity to find the time taken to reach the maximum height.

Using the equation v = u + at, where v is the final velocity (0 m/s at the maximum height), u is the initial upward velocity (4.6 m/s), a is the acceleration due to gravity (-9.8 [tex]m/s^2[/tex]), and t is the time in seconds, we can solve for t. Here, the negative sign for acceleration indicates that gravity is acting opposite to the direction of the initial velocity.

Substituting the known values, we get:

0 = 4.6 m/s - (9.8 [tex]m/s^2[/tex] × t)

t = 4.6 m/s / 9.8 [tex]m/s^2[/tex]

t = 0.469 seconds (rounded to three decimal places)

This is the time for the ball to reach the peak of its motion. To find the minimum time that a player must wait before touching the ball, we just consider this time, since the ball starts to fall immediately after reaching its maximum height.

Gas is confined in a tank at a pressure of 11.0 atm and a temperature of 25.0 degrees C. If two-thirds of the gas is withdrawn and the temperature is raised to 75.0 degrees C, what is the new pressure of the gas remaining in the tank?
Please help!

Answers

maybe 3.63 atm I'm not sure though

When our bodies get warmed up, _____________ increases to the muscles that need it.

Answers

Oxygenated blood is increased to the working muscles for an increase production of ATP

Two charged particles Q1 and Q2 are a distance r apart with Q2=5Q1.Compare the forces they exert on one another when F1 is the force Q2 exerts on Q1 and F2 is the force Q1 exerts on Q2

a)F2=-5F1
b)F2=5F1
c)F2=F1
d)F2=-F1

Answers

Final answer:

The forces that two charged particles exert on each other are equal in magnitude and opposite in direction, so F2 = -F1, where F2 is the force Q1 exerts on Q2, and F1 is the force Q2 exerts on Q1.

Explanation:

When two charged particles Q1 and Q2, with Q2 being 5 times the charge of Q1, are separated by a distance r, the force they exert on each other can be determined using Coulomb's law. According to Coulomb's law, the magnitude of the force between two point charges is directly proportional to the product of the charges and inversely proportional to the square of the distance between them. Since Q2 is 5 times Q1, we have Q2 = 5Q1. However, the force that Q2 exerts on Q1 (F1) is equal in magnitude and opposite in direction to the force that Q1 exerts on Q2 (F2) due to Newton's third law of motion, which states that every action has an equal and opposite reaction.

Therefore, the correct answer to the question is F2 = -F1. This indicates that the forces are equal in magnitude but opposite in direction. The negative sign simply denotes the opposite direction of the force, not that the magnitude of the force is negative.

Final answer:

According to Coulomb's law and Newton's third law, two charged particles exert forces of equal magnitude but opposite directions on each other, so if Q2 = 5Q1, then F2 = -F1.

Explanation:

When considering two charged particles exerting forces on each other, it's important to apply Coulomb's law, which states that the force between two point charges is directly proportional to the product of the magnitudes of the charges and inversely proportional to the square of the distance between them. Additionally, Newton's third law of motion tells us that for every action, there is an equal and opposite reaction. This means that if a charge Q2 exerts a force F1 on Q1, then Q1 must exert a force F2 of equal magnitude but in the opposite direction on Q2.

Given that Q2 = 5Q1 and they are a distance r apart, Coulomb's law would indicate that the magnitudes of the forces each charge exerts on the other (F1 and F2) would be equal. Thus, the correct answer is F2 = -F1, where the negative sign indicates the forces have opposite directions.

In an electrical circuit, which of the following controls whether or not electrons flow through the circuit?

Answers

A SWITCH. IT controls the flow of electrons in a circuit

what is the energy of a photon whose frequency is 5.2 x 10 to the 15th s -1? Cassie(:

Answers

E=hf
Where h is constant
h - Planck constant
f - frequiency

E equals 6.626 times 10 in the minus 34th times 5.2 times 10 in the 15th

Equals 3.44552 time 10 in the minus 18th

A 0.150 kg ball on the end of a 1.10 m long cord (negligible mass)is swung in a vertical circle..

(a) what is the minimum speed the ball must have at the top of its arc so that the ball continues moving in a circle?
calculate the tension in the cord at the bottom of the arc assuming the ball is moving at twice the speed of part (a) ...?

Answers

For any body to move in a circle it requires the centripetal force (mv^2)/r. In this case a ball is moving in a vertical circle swung by a mass less cord. At the top of its arc if we draw its free body diagram and equate the forces in radial direction to the centripetal force we get it as T +mg =(mv^2)/r T is tension in cord m is mass of ball r is length of cord (radius of the vertical circle) To get the minimum value of velocity the LHS should be minimum. This is possible when T = 0. So minimum speed of ball v at top =sqrtr(rg)=sqrt(1.1*9.81) = 3.285 m/s In the second case the speed of ball at top = (2*3.285) =6.57 m/s Let us take the lowest point of the vertical circle as reference for potential energy and apllying the conservation of energy equation between top & bottom we get velocity at bottom as 9.3m/s. Now by drawing the free body diagram of the ball at the bottom and equating the net radial force to the centripetal force T-mg=(mv^2)/r We get tension in cord T=13.27 N

Answer:

[tex]v = 3.28 m/s[/tex]

Explanation:

At the top position of the arc if ball continue in its circular path then we can say that tension force must be zero at that position for the minimum value of the speed.

So we will have

[tex]T + mg = \frac{mv^2}{R}[/tex]

so if minimum speed is required to complete the circle T = 0

[tex]0 + mg = \frac{mv^2}{R}[/tex]

so we will have

[tex]v = \sqrt{Rg}[/tex]

again we will have

[tex]v = \sqrt{1.10\times 9.81}[/tex]

[tex]v = 3.28 m/s[/tex]

Felipe drives his car at a velocity of 28 m/s. He applies the brake, which slows the vehicle down at a rate of 6.4 m/s2 and causes it to slow to a stop. How long does it take for the car to stop? Round your answer to the nearest tenth.
I'm supposed to use derived formulas to find the answer but I don't know which one to use.

Answers

So after ~4.4 seconds, car will stop.
The answer is: 4.4 seconds

What is the difference between stretching a t shirt and stretching a rubber band?

Answers

It depends on their tension. Normally, the rubber band store more tension than a t shirt.

If you know the components of a vector, what mathematical relationship can be used to find the magnitude of the vector?

Answers

You will always use Pythagoras theorem to find magnitude while given components of vector.
No matter if system that you are observing is 2D or 3D or higher (which is imaginery) pythagoras theorem will be applied.

Formula for determining magnitude is:
[tex]M = \sqrt{x^ + y^2 + z^2 + ...} [/tex]

Number of turms inside square root you take depending on dimension of your system.

The strength of the force of gravity depends on a. the masses of the objects and their speeds. b. the masses of the objects and the distance between them. c. the weight of the objects and their speeds. d. the masses of the objects and their weights.

Answers

Gravitational force = Gxm1xm2 /r^2 This equation depends only upon object's masses and distance between them. So option b is correct

Which of the following statements is true for a cell placed in beaker containing an isotonic solution?

Select one of the options below as your answer:



A.
Water molecules flow from the cell into the beaker.




B.
Water molecules flow from the beaker into the cell.




C.
Water molecules flow in both directions at the same rate.




D.
There is no movement of water molecules.
....i dont even know how to nswer this one becasue i dont know wht and isotonic solution means

Answers

An isotonic solution is a solution in which concentration or solute is equal to that of a cell placed in it. Thus, the system is in dynamic equilibrium, and so water molecules flow in both directions.
The correct answer is C. water molecules flow in both directions at the same rate.

a 727 jet needs to attain a speed of 200 mph to take off. if it can accelerate from 0 to 200 mph in 30 seconds, how long must the runway be? (assume constant acceleration) ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Since v = dx/dt = 200t

I took the integral of dx = integral of 200t dt

and I got x = 100t^2 + C

So I plugged in 0.5 as t and got x = 25

So x = 25 miles
Final answer:

Using the equations of motion, the length of the runway required for the 727 jet to take off can be determined. By calculating the acceleration and using the distance formula, we find that the runway must be at least 44.7039 meters long.

Explanation:

To determine the length of the runway required for the 727 jet to take off, we can use the equations of motion.

First, convert the speed from mph to m/s: 1 mph = 0.44704 m/s.Next, calculate the acceleration of the jet using the formula:acceleration = change in velocity / timeGiven: final velocity = 200 mph = 200 * 0.44704 = 89.408 m/sInitial velocity = 0 m/sTime = 30 secondsacceleration = (89.408 - 0) / 30 = 2.98027 m/s².Finally, use the equation:distance = initial velocity * time + (1/2) * acceleration * time²Given: initial velocity = 0 m/sacceleration = 2.98027 m/s²time = 30 secondsdistance = 0 * 30 + (1/2) * 2.98027 * (30)² = 0 + 44.7039 = 44.7039 meters

Therefore, the runway must be at least 44.7039 meters long for the 727 jet to take off.

can someone check my answer thanks ! 2.The ability to do work or cause change is called A.velocity. B.energy.(I PICK B.) C.transfer. D.friction. 3.Which type of energy is demonstrated by a person jogging?
A.electrical energy B.nuclear energy C.electromagnetic energy D.kinetic energy(I PICK D) 4.Which is the type of energy available in food? A.electromagnetic B.gravitational C.chemical(I PICK C) D.kinetic 5.Dan does 188.0 J of work raking leaves. If the rake does 128.0 J of work, what is the efficiency of the rake?
A.68.1 percent(I PICK A) B.147.0 percent C.60.0 percent D.316.0 percent 6.Which type of energy transformation is taking place when natural gas is used to heat water?
A.chemical energy into thermal energy(I PICK A) B.thermal energy into mechanical energy C.mechanical energy into electromagnetic energy D.electromagnetic energy into chemical energy 7.The energy associated with the motion and position of an object is called
A.kinetic energy. B.potential energy. C.gravitational potential energy. D.mechanical energy.(I PICK D) ****I ACTUALLY HAD 2 CHOICES FOR 7 SO MY OTHER ANSWER IS A*****

Answers

Answer:

2. B. energy

3. D.kinetic energy

4. C. chemical

5. A.68.1 percent

6. A.chemical energy into thermal energy

7. D.mechanical energy

Explanation:

2. Energy is  the ability of matter to produce work in the form of movement, light, heat, etc.

3.  The kinetic energy of a body is that energy it possesses due to its movement.

4 .Chemical energy is the energy stored in the bonds of chemical compounds (atoms and molecules).

5. Efficiency can be calculated as (128J/188J)*100= 68%

6. Chemical energy is defined in item 4 and thermal energy is a type of energy that bodies possess when exposed to the effect of heat. It is precisely what produces that the atoms that make up the molecules are in constant motion either moving or vibrating.

7. Mechanical energy is the energy that bodies present because of their movement (kinetic energy), and their situation with respect to another body, usually the earth.

Final answer:

All your selected answers are correct. The ability to do work is energy, a person jogging has kinetic energy, energy in food is chemical, the rake has 68.1 percent efficiency, natural gas heating water is a chemical to thermal energy transformation process, and motion and position of an object relate to mechanical energy.

Explanation:

Yes, you are correct with your answers. The ability to do work or cause change is indeed called B.energy. A person jogging demonstrates D.kinetic energy as they are in motion. The type of energy available in food is C.chemical energy which is stored and can be transformed into other energy forms our body needs. With the work done raking leaves, if Dan does 188.0 J of work and the rake itself does 128.0 J of work then the efficiency of the rake would be (128.0 / 188.0) * 100 = 68.1 percent, hence, it is A.68.1 percent. The transformation of energy taking place when natural gas is used to heat water is A. Chemical energy into thermal energy. Finally, the energy associated with the motion and position of an object falls under D. mechanical energy, although if considering only the motion aspect, it is indeed A. Kinetic energy.

Learn more about Energy here:

https://brainly.com/question/36891624

#SPJ6

Cindy runs 2 kilometers every morning. She takes 2 minutes for the first 250 meters, 4 minutes for the next 1,000 meters, 1 minute for the next 350 meters, and 3 minutes for the rest.

Cindy’s average speed for the entire run is __ meters per minute. One kilometer is the same as 1,000 meters.

Hint: Average Speed = Total Distance/Total Time

Answers

It's 200 on Edmentum

The gravitational force between the Sun (mass = 1.99 × 1030 kg) and Mercury (mass = 3.30 × 1023 kg) is 8.99 × 1021 N. How far is Mercury from the Sun?

Answers

The answer is B - 6.98 x 10^7 km

Answer : Distance, d=6.98 × 10⁷ Km

Explanation :

Given that,

Mass of the sun, m₁ = 1.99 × 10³⁰ kg

Mass of Mercury, m₂ = 3.30 × 10²³ kg

Gravitational force between the sun and mercury, F = 8.99 × 10²¹ N

According to Universal law of gravitation,

[tex]F=G\dfrac{m_1m_2}{d^2}[/tex]

d is the distance of mercury from the sun

[tex]d=\sqrt{\dfrac{Gm_1m_2}{F}}[/tex]

[tex]d=\sqrt{\dfrac{6.67\times 10^{-11}\times 1.99\times {30}\times 3.30\times 10^{23}}{8.99\times 10^{21}}}[/tex]

[tex]d=\sqrt{4.87\times 10^{21}} m[/tex]

[tex]d=6.98\times 10^{10}\ m[/tex]

or

[tex]d=6.98\times 10^{7}\ Km[/tex]

So, mercury is [tex]6.98\times 10^{7}\ Km[/tex] far from the sun.

A 95 kg fullback, running at 8.2 m/s, collides in midair with a 128 kg defensive tackle moving in the opposite direction. Both players end up with zero speed.
A) What was the change in the fullbacks momentum?
B) What Was the change in the defensive momentum?
C) What was the defensive tackle's original momentum?
D) How fast was the defensive tackle moving origianally? ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Below is the answers:

Fullback running 

Mo = mass * velocity 
Mo = 95kg * 8.2 m/s =779 kg*m/s (a 

He got stopped Change in Mo = 779 kg*m/s (b 

Both stopped ===> Tackle's mo = - Halfback's Mo = - 779 kg*m/s (c & d 

- 779 = 128 * v 
v= - 6.09 m/s (e

So,option A)Change in the fullback's momentum:779 kg·m/s,B)Change in the defensive tackle's momentum: -779 kg·m/s,C)Defensive tackle's original momentum:-779 kg·m/s (opposite direction),D)The original speed of the defensive tackle:6.09 m/s.

Understanding Momentum and Collision:

A) Change in the fullback's momentum: Momentum is the product of mass and velocity. For the fullback running at 8.2 m/s with a mass of 95 kg, his initial momentum was 95 kg × 8.2 m/s = 779 kg·m/s. After the collision, since they stop, the fullback's speed is 0 m/s, giving a final momentum of 0 kg·m/s. Therefore, the change in momentum is 779 kg·m/s - 0 kg·m/s = 779 kg·m/s.

B) Change in the defensive tackle's momentum: The defensive tackle has mass 128 kg and final speed 0 m/s. Since we are not given the initial velocity, we cannot calculate the change directly; however, by conservation of momentum, the change will be equal and opposite to the fullback's, which is -779 kg·m/s.

C) Defensive tackle's original momentum: As mentioned above, the change in momentum is the negative of the fullback's, so if the fullback's momentum decreased by 779 kg·m/s, the tackle's momentum increased by this amount, meaning it was -779 kg·m/s (opposite direction).

D) The original speed of the defensive tackle: To find the original speed, we take the original momentum (from C) and divide by the tackle's mass. This gives us -779 kg·m/s ÷ 128 kg = -6.09 m/s. The negative indicates that he was moving in the opposite direction to the fullback.

Note that 'negative' here is used to indicate direction in one-dimensional motion, and the actual speed is just the absolute value, 6.09 m/s.

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the
a. x rays.
b. radio waves.
c. microwaves.
d. gamma rays.

Answers

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the "Radio waves"

So, option B is your answer

Hope this helps!

Which is true about atoms?
a.atoms have no mass
b.atoms are mostly empty space
c.most of the space in an atom is taken up by the nucleus?

Answers

B).atoms are mostly empty space 

This is the only answer. Hope this helps!
B.atoms are mostly empty space


physical science help please!
I will up-vote all answers!


The Periodic Table is organized so that atoms of elements with the same number of valence electrons are in __________.



cells

columns

diagonals

rows

Answers

columns- i know this because i took a similar quiz recently :)
Hope that helps :)

Answer:

Columns

Explanation:

The groups are arranged in columns on the Periodic Table.

Magnetic induction is used for what?

Answers

For radio broadcasting, in electricity meters, in any generator. 

What type of machine is a seesaw?



A.
simple machine

B.
compound machine

Answers

Answer: Option (A) is the correct answer.

Explanation:

A seesaw is a simple machine which has a long board and on a fixed part it is balanced in the middle.

For example, a seesaw on which children play in the park is balanced at the middle on a fixed point so that children sitting on both the sides can move up and down with the same force.

Thus, we can conclude that seesaw is a simple machine type of machine.

Seesaw is classified as a simple machine. The correct option is( A)

What is simple machine ?

A seesaw is categorized as a basic machine since it functions using the levering principle. One of the six traditional simple machines, together with the inclined plane, wedge, screw, wheel and axle, and pulley is the lever.

The lever in the case of a seesaw is a long, rigid beam that pivots on a fulcrum. A back-and-forth motion is possible because of the effort put in on one end of the seesaw, which forces the other end to rise and fall.

Therefore, The correct option is ( A)

Learn more about simple machine here :brainly.com/question/31090053

#SPJ6

Frequency is measured in units called?

Answers

The frequency, f, of a wave is the number of waves passing a point in a certain time. We normally use a time of one second, so this gives frequency the unit hertz (Hz), since one hertz is equal to one wave per second.

The frequency of a wave is the inverse of time period. Hence, its unit is s⁻¹ which is equivalent to Hz unit. The standard unit of frequency is Hz.

What is frequency ?

Frequency of an event is the number of cycles of that event per unit time. For a wave frequency is the number of wave cycles per second. Hence, frequency is the inverse of time period.

Frequency of a wave is directly proportional to the energy of the wave and inversely proportional to the wavelength. Hence, the high frequency waves are shorter waves.

The unit of frequency is called Hertz (Hz) which is equal to s⁻¹ because, it is the frequency is inverse of the time period of the wave. Therefore, frequency is measured in units called Hertz.

Find more on frequency:

https://brainly.com/question/14316711

#SPJ2

Other Questions
what were some reasons renaissance humanist writers gave for writing in the vernacular Which of the following is true of both nuclear fusion and nuclear fission?a.They both require a high energy input.b.They both occur without byproducts.c.They both have a high energy output.d.They both involve large atoms breaking into smaller atoms. A business purchased for $650,000 in 1994 is sold in 1997 for $850,000. What is the annual rate of return for this investment? which of the following represents the most accurate estimation of 96-38? a car traveling at a speed of 13 meters per second accelerates uniformly to a speed of 25 meters per second in 5.0 seconds.-a truck traveling at a constant speed covers the same total distance as the car in the same 5.0 second interval. Determine the speed of the truck.-Calculate the magnitude of the accelerate of the car during this 5.0 second interval. A distribution of numbers has the following five-number summary:10.0, 15.0, 30.9, 50.0, 63.7True or False? These numbers can be used to calculate the standard deviation of the distribution. ...? what trend in atomic radius do you see as you go down a group on the periodic table Find the equilibrium concentrations of A, B, and C for a=1, b=1, and c=2. Assume that the initial concentrations of A and B are each 1.0 M and that no product is present at the beginning of the reaction.Consider the following reaction and associated equilibrium constant:aA(g)+bB(g)cC(g), Kc = 4.0 What is the volume of a gold nugget that weight 2.20kg. the density of gold is 19g/cm^3 ...? Angle lies in the second quadrant, and sin = 3/5.cos = tan = Manny has 48 feet of wood. He wants to use all of it to create a border around a garden. The equation 2l + 2w = 48 can be used to find the length and width of the garden, where l is the length and w is the width of the garden. If Manny makes the garden 15 feet long, how wide should the garden be? 9 feet 18 feet 30 feet 33 feet Compare and contrast different styles of illuminated manuscripts. What are the three types of illuminated manuscripts? What are the major differences between the styles of the Carolingian manuscripts, the Ebbo gospels, and the Ottonian gospels? What are the similarities? group of people that settle in Pennsylvania and practiced religious tolerance? Lava blown out of a volcano in explosive eruption is called pumice. True False Two heterozygous purple-flowering pea plants are crossed. If purple is dominant over white, what are the expected phenotypic results? Which statement offers the BEST explanation for why General Sherman was more destructive on his march through South Carolina than he was in North Carolina?A)The Union was seeking revenge for the Battle of Fort Sumter.B)General Sherman failed to supervise his troops adequately while in South Carolina.C)South Carolina was viewed as a prime target because they were the first state to secede from the Union.D)General Sherman was seeking revenge for Union soldiers killed in South Carolina's prisoner of war camps. ...? How do tsunamis effect the atmosphere? How do the hydrosphere, biosphere and the atmosphere affect tsunamis? which two authors wrote narratives of their journeys to america a scuba diver dives to a depth of 50 feet, sinks 12 feet, then rises 20 feet. what is the diver's final position relative to sea level? Jorge's hourly salary is $7.65. last week he worked 23 hour week how much did he earn Steam Workshop Downloader