can someone help me find this expression!! i don’t understand it at all, please comment only if you can help !!

Can Someone Help Me Find This Expression!! I Dont Understand It At All, Please Comment Only If You Can

Answers

Answer 1

Check the picture below.

Can Someone Help Me Find This Expression!! I Dont Understand It At All, Please Comment Only If You Can

Related Questions

for a summer job, you work for a pool resurfacing business. you’ve finished resurfacing the pool and it is now time to fill the empty pool with water. there are 2 water hoses that you can use to refill the pool. you wonder how long it is going to take to fill the pool because you have plans with friends and you need to leave by 6:15 PM. You decide to time the water flow of hoses as it fills a 5 gallon bucket. the first hose can fill the bucket in 4 seconds while the second hose can fill the same in 36 seconds. the pool needs 20,000 gallons of water.

a. How long will it take fill the pool with the first hose? It is now 2PM, will you be able to leave by 6:15pm?
b. You get the idea both hoses to fill the pool and hopefully fill up the pool faster. Will using both hoses be enough to fill up the pool in time for you to leave at 6:15PM?

Answers

Answer:

a. 267 hrs b.

Step-by-step explanation:

a.)4 secs divided by 5 gals is .8 secs per gal, multiply by 20,000 gals, is 16,000 secs, divide that by 60 secs in an hour and you get 266.666 hrs

b.)42 hrs with both hoses

.8 secs per gal and 7.2 secs per gal = 8 secs per gal

20,000 = 8 gals per hour = 2500 secs  divided by 60 secs per hour = 41.66

The volume of a cone is 50 pi cubic feet. Its height is 6 feet. In feet, what is the radius of the cone? Round the answer to the nearest tenth.

Answers

Answer:

The radius of the cone is [tex]5\ ft[/tex]

Step-by-step explanation:

we know that

The volume of a cone is equal to

[tex]V=\frac{1}{3}\pi r^{2}h[/tex]

In this problem we have

[tex]V=50\pi\ ft^{3}[/tex]

[tex]h=6\ ft[/tex]

substitute in the formula and solve for r

[tex]50\pi=\frac{1}{3}\pi r^{2}(6)[/tex]

Simplify

[tex]25=r^{2}[/tex]

square root both sides

[tex]r=5\ ft[/tex]

Answer:

5ft

Step-by-step explanation:

I did the test

Solve for the roots in the equation below. In your final answer, include each of the necessary steps and calculations. Hint: Use your knowledge of polynomial division and the quadratic formula.

x3 - 27 = 0

Answers

Answer:   3

Step-by-step explanation:

[tex]x^3-27=0\\\\x^3=27\\\\\sqrt[3]{x^3}=\sqrt[3]{27}\\\\x=\sqrt[3]{3\cdot 3\cdot 3} \\\\x=3[/tex]

wich of the following expressions is equivalent to 3x+3x+5+5?​

Answers

Answer:

OPTION B:  [tex]2(3x+5)[/tex]

Step-by-step explanation:

To solve the exercise you can simplify the expression given in the problem, as following:

- Add the like terms:

[tex]3x+3x+5+5\\6x+10[/tex]

- Find the greatest common factor (GCF) of 6 and 10:

[tex]6=2*3\\10=2*5\\\\GCF=2[/tex]

- Factor ir out.

Then, you obtain the following equivalent expression:

[tex]2(3x+5)[/tex]

Answer:

6x + 10

Step-by-step explanation:

Combine like terms:

3x + 3x = 6x, and

5+5 = 10

and so the final sum is 6x + 10

I WILL AWARD BRAINLIEST!!! PLEASE HELP!!! SOLVE FOR EACH!!!!

Using the given equation find the missing coordinates of the points and then find the slope of the line for each equation

1) y−2x=3; A(...; 6), B(15; ...)

2) 4.5x+3y=2; A(...; 1/3 ), B( 2/3 ; ...)

Answers

Answer:

1. A(3/2,6)

B(15,33)

2.A(2/9,1/3)

B(2/3,-1/3)

Step-by-step explanation:

1) y−2x=3; A(...; 6), B(15; ...)

We know y =6

Substitute this into the equation

6 -2x =3

Subtract 6 from each side

6-6 -2x=3-6

-2x = -3

Divide by -2

x = -3/-2

x = 3/2

A(3/2,6)

We know x = 15

y - 2(15) =3

y - 30 = 3

Add 30 to each side

y-30+30 = 3+30

y = 33

B(15,33)

2) 4.5x+3y=2; A(...; 1/3 ), B( 2/3 ; ...)

We know y = 1/3

4.5x + 3(1/3) = 2

4.5x +1 =2

Subtract 1 from each side

4.5x +1-1=2-1

4.5x = 1

Divide each side by 4.5

x = 1/4.5

x = 10/45

x =2/9

A(2/9,1/3)

Let x =2/3

4.5(2/3) +3y =2

3 +3y =2

Subtract 3 from each side

3-3+3y = 2-3

3y = -1

Divide by 3

y = -1/3

B(2/3,-1/3)

Answer:

1. A(3/2;6) B(15;33)

slope=2

2. A(2/9;1/3) B(2/3;-1/3)

slope=-1.5

Step-by-step explanation:

Hope this helps,

Have a great day

How can you represent constraints by absolute value equations?

Answers

Answer:

The absolute number of a number a is written as

|a|

And represents the distance between a and 0 on a number line.

An absolute value equation is an equation that contains an absolute value expression. The equation

|x|=a

Has two solutions x = a and x = -a because both numbers are at the distance a from 0.

To solve an absolute value equation as

|x+7|=14

You begin by making it into two separate equations and then solving them separately.

x+7=14

x+7−7=14−7

x=7

or

x+7=−14

x+7−7=−14−7

x=−21

An absolute value equation has no solution if the absolute value expression equals a negative number since an absolute value can never be negative.

The inequality

|x|<2

Represents the distance between x and 0 that is less than 2

picture42

Whereas the inequality

|x|>2

Represents the distance between x and 0 that is greater than 2

picture43

You can write an absolute value inequality as a compound inequality.

$$\left | x \right |<2\: or

−2<x<2

This holds true for all absolute value inequalities.

|ax+b|<c,wherec>0

=−c<ax+b<c

|ax+b|>c,wherec>0

=ax+b<−corax+b>c

You can replace > above with ≥ and < with ≤.

When solving an absolute value inequality it's necessary to first isolate the absolute value expression on one side of the inequality before solving the inequality.

Sorry If its not what your looking for but i tried

Constraints can be represented by absolute value equations when dealing with inequalities that involve the distance between a variable and a fixed value. Absolute value equations are commonly used to express constraints in mathematical modeling and optimization problems.

Constraints can be represented by absolute value equations when dealing with inequalities that involve the distance between a variable and a fixed value. Absolute value equations are commonly used to express constraints in mathematical modeling and optimization problems. Here's how you can do it:

Representing Constraints with "less than" or "greater than" inequalities:

Suppose you have a variable "x" and a fixed value "a." If you want to impose a constraint that the absolute value of the difference between "x" and "a" is less than some constant "k," you can write it as:

| x - a | < k

For example, if you want to constrain "x" to be within 3 units from 5, you write:

| x - 5 | < 3

Representing Constraints with "less than or equal to" or "greater than or equal to" inequalities:

If you want to impose a constraint that the absolute value of the difference between "x" and "a" is less than or equal to some constant "k," you can write it as:

| x - a | ≤ k

For example, if you want to constrain "x" to be within 2 units from 8, you write:

| x - 8 | ≤ 2

Using absolute value equations allows you to handle situations where the variable needs to be close to a certain value or within a specific range, regardless of whether it is greater or smaller than that value. This flexibility is particularly useful in various mathematical and optimization problems, including linear programming and constrained optimization.

Learn more about function from

brainly.com/question/11624077

#SPJ2

What is the area in terms of pi

Answers

Answer:

C = 70π cmA = 2,450 cm²

Step-by-step explanation:

The perimeter of the given figure is equal to the circumference of whole circle.

The formula of a circumference of a circle:

[tex]C=\pi d[/tex]

d - diameter

We have d = 70 cm. Substitute:

[tex]C=70\pi\ cm[/tex]

The area of given figure is equal to the area of rectangle 70cm × 35cm.

(look at the picture).

The area of a rectangle:

[tex]A=(70)(35)=2,450\ cm^2[/tex]

what number times 2 equals 0.36

Answers

Answer:

X is equal to 0.18

Step-by-step explanation:

X is that number

then

2X equal to 0.36

X equal to 0.36 divided 2

X is equal to 0.18

Best regards

The first and second steps to solve the equation 3x/5+5=20 are shown below.

3x/5+5=20-5

3x/5(5/3)=15(5/3)


Which property was applied in the second step?

Answers

Answer:

[tex]\large{\boxed{\text{the multiplication property of equality}}}[/tex]

Step-by-step explanation:

[tex]\dfrac{3x}{5}+5=20\qquad\text{subtract 5 from both sides}\\\boxed{\text{the subtraction property of equality}}\\\\\dfrac{3x}{5}+5-5=20-5\\\\\dfrac{3x}{5}=15\qquad\text{multiply both sides by}\ \dfrac{5}{3}\\\boxed{\text{the multiplication property of equality}}\\\\\dfrac{3\!\!\!\!\diagup^1}{5\!\!\!\!\diagup_1}\cdot\dfrac{5\!\!\!\!\diagup^1x}{3\!\!\!\!\diagup_1}=\dfrac{5}{3\!\!\!\!\diagup_1}\cdot15\!\!\!\!\!\diagup^5\\\\x=(5)(5)\\\\x=25[/tex]

Answer: C

Step-by-step explanation:

Find the volume of the figure: a cube with sides of length s with the biggest sphere that fits in it cut out.

Answers

Answer:

Volume of cube= a^3

=(2/√3)^3

=8/3√3 cubic units. (~1.5396 cubic units)

Step-by-step explanation:

Such a cube has diagonal lengths (DF, AG, EC & HB)=diameter of sphere=2 units.

Let the sides of the cube (FG, GC, CB, BF, etc.) be 'a'.

Hence facial diagonal of the cube (FC, BG, FH, etc.) will be √2a (Pythagoras' Theorem).

Applying Pythagoras' theorem for △DFC:

FC²+DC²=FD²

⇒(√2a)²+a²=2²

⇒3a²=4

⇒a=2/√3 units

Tell how to read the statement f(4)=16. Then interpret what it means in terms of input and output values.

Answers

Final answer:

An equation f(4)=16 means that when the input value is 4, the output value is 16.

Explanation:

An equation in the form f(4)=16 means that when the input value of the function f is 4, the output value is 16.

For example, if f represents the function that multiplies an input by 4, then f(4)=16 because 4 multiplied by 4 equals 16.

In terms of input and output values, f(4)=16 means that when the input value is 4, the function will return an output value of 16.

PLEASE HELP UWU
describe the graph:
f(x)= (3/4)^x +4

Answers

Answer:

See attached picture.

y-intercept at (0,5) and asymptote at y = 4.

Step-by-step explanation:

This graph has a base 3/4 that is less than 1. This means it will start high and end low.

It has also been shifted up 4 units by adding 4. This means the asymptote moves to from y = 0 to y =4. The y-intercept of the parent function will also move from (0,1) to (0,5).

This figure is dilated by a factor of 12, with the origin as center. 

Which statement is NOT correct?


A)R(2, 8) → R'(1, 4)


B)Q(10, 2) → Q'(5, 2)


C)P(2, -4) → P'(1, -2)


D)S(-10, 2) → S'(-5, 1)

Answers

Answer:

The one that stands out as incorrect is B

Step-by-Step Explanation:

I'll assume that by 12, you meant 1/2 because if the scale factor is 12, then none of the choices are correct. B is the only one that stands out because while in the x, 10 does turn into 5 after being multiplied by 1/2, the 2 in the y remained the same instead of being turned into 1.

Answer:

This figure is dilated by a factor of 12, with the origin as center.  

Which statement is NOT correct?

A)R(2, 8) → R'(1, 4)

B)Q(10, 2) → Q'(5, 2)

C)P(2, -4) → P'(1, -2)

 D)S(-10, 2) → S'(-5, 1)

Step-by-step explanation:

As you can see in A,C and D, the x-coordinate and the y-coordinate is divided by 2.

E.g.  2 / 2 =1     8/2=4    so ⇒R'(1, 4)  

but in B, the first x-coordinate is divided by 2 but the y-coordinate is divided by 1.

A rocket launched at an angle into outer space. After a minute, the rocket traveled 5 miles and had an altitude of 3.5 miles. What is the angle of elevation that the rocket was launched at?

Answers

Answer:

angle = 35 degrees

Step-by-step explanation:

The rocket traveled

5 miles in the       x direction

3.5 miles in the    y direction

The rocket was launched with a slope of

m =y/x = 3.5 miles / 5 miles   = 0.7

The slope is equal to the tangent of the angle of elevation

tan (angle) = m

angle  =  tan^-1 (0.7)

angle = 34.99 ≈ 35 degrees

Final answer:

To determine the angle of elevation, we use the tangent function: the angle θ is the arctan of the altitude over the horizontal distance, which is approximately 35 degrees.

Explanation:

The angle of elevation that the rocket was launched at can be determined using trigonometric functions. Specifically, we can use the tangent function, which relates the angle of a right triangle to the ratio of the opposite side (altitude in this case) over the adjacent side (horizontal distance).

The formula is:

tan(\(\theta\)) = \(\frac{{opposite}}{{adjacent}}\).

So, the angle \(\theta\) is:

\(\theta = tan^{-1}\left(\frac{{3.5 \text{{ miles}}}}{{5 \text{{ miles}}}}\right)\).

Using a calculator, we find that:

\(\theta\approx 35.0^\circ).

The rocket was thus launched at an angle of approximately 35 degrees.

Learn more about Angle of Elevation here:

https://brainly.com/question/29008290

#SPJ12

which sequence shows the numbers in order from least to greatest​

Answers

Answer:

C

Step-by-step explanation:

1/2 is positive unlike the other two so it is obviously last.

Now it's between -3/4 and -2/3

-3/4 = -0.75

-2/3 = -0.67

Since -0.75 < -0.67, -3/4 is first and -2/3 is second.

Answer:

Your answer would be C.

Step-by-step explanation:

mark goes to the mall every 4 days, costco every 2 days, and the grocery store every 3 days.if he goes to all three on the 15th, when will he go to all three again?​

Answers

Answer:

27th

Step-by-step explanation:

Every 4 days=4m

Every 3days=3s

Costco =2c

When does 4m=D=3s?

When m=0=s and when m=3 and s=4

4•3=12=3•4

Can 2c=12? Yes, when c=6

So 12 days from now, mall, store and Costco will all happen.

15+12=27

Mark will go to all three again on the 27th.

You must find the least common multiple of 4, 2, and 3. That is, find the smallest number that is divisible by all three of the numbers. You get 12. 12 is divisible by 4, 2, and 3.

Finally, add 12 to the 15th to get the 27th.

what shapes has parallel sides only​

Answers

Square, Rectangle and Rhombus

A water trough is being constructed in the shape of a rectangular prism. The trough will have a base area of 9 10 square yard and a height of 3 4 yard. How much water will the trough hold when filled to the brim? A. 27 10 cubic yard B. 9 40 cubic yard C. 27 40 cubic yard D. 3 10 cubic yard E. 1 40 cubic yard

Answers

Answer:

C. 27 40 cubic yard

Step-by-step explanation:

The base area is 9 10 square yard and a height of 3 4 yard.

Volume of the prism will be given by the formula;

= Base area × height

=  9 10 square yard × 3 4 yard

= 27 40 cubic yard

Rose purchased 2 packs of red pens, 4 packs of black pens, and 3 packs of blue pens. The cost of each pack of pens was $2.50. The expression $2.50 • 2 + $2.50 • 4 + $2.50 • 3 represents the total cost of the pens. Which expression also represents the total cost of the pens? A. $2.50 • 2 • 4 • 3 B. $2.50 • (2 + 4 + 3) C. $2.50 + (2 • 4 • 3) D. $2.50 + 2 + 4 + 3

Answers

Answer: B

Step-by-step explanation:

If she bought 9 packs of pens at 2.50$ each then she spent 22.50$ on pens. If you add up the packs and multiply by the price you get your answer. 2.50 * (2+3+4) = 22.50$

6....................

Answers

Answer:

option (a)

x - √7x / x - 7

Step-by-step explanation:

Given the expression in the question

  √x / (√x + √7)

 There are 3 steps to follow

Multiply numerator and denominator by a radical that will get rid of the radical in the denominator. Make sure all radicals are simplified. Simplify the fraction if needed.

Step 1

Multiply by √x - √7

√x (√x - √7) /  (√x + √7)(√x - √7)

√x .√x - √7.√x / (√x + √7)(√x - √7)

Step 2

a² - b² = (a+b)(a-b)

√x² - √7x / √x² - √7²

Step 3

x - √7x / x - 7

Solve:

2^x=32

X=_________a0

Answers

Answer:

x = 5

Step-by-step explanation:

As you know 32 = 2^5

so

2^x = 32

2^x = 2^5

Since both have same base 2

x = 5

32=2^x

Prime factors of 32

32 = 2 * 16

16 = 2 * 8

8 = 2 * 4

4 = 2 * 2

32 = 2*2*2*2*2

32 = 2^5

x=5

Hope this helps :)

Which expression is equivalent to (cd)^5​

Answers

Answer:

c^5 *d^5

Step-by-step explanation:

What is the smallest possible whole-number value of x?

Answers

Answer:

6

Step-by-step explanation:

We know:

If a ≤ b ≤ c are the sides of a triangle, then a + b > c.

We have a = x, b = 2x and c = 15 cm.

Therefore x ≤ 15 and 2x ≤ 15 ⇒ x ≤ 7.5

Therefore we have the inequality:

x + 2x > 15

3x > 15          divide both sides by 3

x > 5 and x ≤ 7.5

Finally x = 6

whats the answer
(5+3i)+(2-2i)

Answers

Answer: 7 + i

Step by step:

Remove parentheses.

5 + 3i + 2 - 2i

Add 5 and 2

7 + 3i - 2i

Subtract 2i and 3i

7 + i

The sum of the complex numbers (5+3i) and (2-2i) is 7+i. You add the real parts to get 7 and the imaginary parts to get i, then combine them.

Adding two complex numbers: (5+3i)+(2-2i). To perform this addition, we simply add the real parts and the imaginary parts separately. The real parts are 5 and 2, and when we add them together we get 7. The imaginary parts are 3i and -2i, which sum up to 1i (or just i). Hence, the result of the addition of these two complex numbers is 7+i.

To further clarify with an example similar to the student's question: (3+4i) + (−2+7i) = (3 - 2) + (4 + 7)i = 1 + 11i. The process is straightforward—add the real numbers, add the imaginary numbers, and combine them into one complex number.

Why do you divide by 60 after calculating the area of the trapezoid (to calculate the distance)? I got 900 but I don’t know why you divide by 60 to get 15 as your answer. Ignore the pen marks.

Answers

Answer:

Step-by-step explanation:

What you are trying to do is a nice way to solve this problem. Without knowing any physics, you are using what math you know to get the answer. You are actually very close to being correct, and you are right. You do have to divide by 60.

Here's why and it is the one bit of physics you have to know.

The speed is km/hour. That word hour is the culprit. Your time is in minutes and you have to get it into hours. In physics, the units have to be consistent.

So ...

b1 = 19 minutes which is 19 min [1 hour / 60 minutes] = 19/60 = 0.31667 hour

b2 = 26 minutes which is 26 min [ 1 hour/60 minutes] =  26/60 = 0.4333 hour

h = 40 km/hour

Area = (0.31667 hour + 0.4333 hour)*40 km/hour /2

Area = 0.75 hour * 40 km/hr //2

Area = 15 km

please help. how much would the statue weigh if the original was 10
feet?

Answers

Answer:

Part a) The weight of the original statue is [tex]9,483\ pounds[/tex]

The ratio of the height of the original statue to the height of the small statue is 8.4

The ratio of the weights or volumes is [tex]8.4^{3}[/tex]

Part b)  [tex]221,184\ pounds[/tex]

Step-by-step explanation:

Part a)

we know that

If two figures are similar, then the ratio of its corresponding sides is equal to the scale factor and the ratio of its volumes or weights is equal to the scale factor elevated to the cube

step 1

Find the scale factor

remember that

[tex]1\ ft=12\ in[/tex]

The original statue is 7 ft tall

Convert to inches

[tex]7\ ft=7*12=84\ in[/tex]

Divide the height of the original statue by the height of the model to find the scale factor

[tex]\frac{84}{10}=8.4[/tex]

step 2

Find the ratio of its weights

Let

z-----> the scale factor

x-----> the weight of the original statue

y----> the weight of the model

so

[tex]z^{3}=\frac{x}{y}[/tex]

we have

[tex]z=8.4[/tex]

[tex]y=16\ lb[/tex]

substitute

[tex]8.4^{3}=\frac{x}{16}[/tex]

[tex]x=16(8.4^{3})=9,483\ pounds[/tex]

The weight of the original statue is [tex]9,483\ pounds[/tex]

The ratio of the height of the original statue to the height of the small statue is 8.4

The ratio of the weights or volumes is [tex]8.4^{3}[/tex]

Part b) If the original statue were 20 ft tall, how much would it weight?

step 1

Find the scale factor

remember that

[tex]1\ ft=12\ in[/tex]

The original statue is 20 ft tall

Convert to inches

[tex]20\ ft=20*12=240\ in[/tex]

Divide the height of the original statue by the height of the model to find the scale factor

[tex]\frac{240}{10}=24[/tex]

step 2

Find the ratio of its weights

Let

z-----> the scale factor

x-----> the weight of the original statue

y----> the weight of the model

so

[tex]z^{3}=\frac{x}{y}[/tex]

we have

[tex]z=24[/tex]

[tex]y=16\ lb[/tex]

substitute

[tex]24^{3}=\frac{x}{16}[/tex]

[tex]x=16(24^{3})=221,184\ pounds[/tex]

which sequence shows the numbers in order from least to greatest?​

Answers

Answer:

The answer should be A) be square root of 11 is 3.3

Step-by-step explanation:

Is it a function why or why not ??

Answers

it is a function because each input (x) has a unique output (y) that is not repeated

In order for a relationship between numbers x and y to be considered a function from x to y, you need to have one unique y for every x. This doesn’t mean that each y needs exactly one x; for instance, the function y = x² is a function from x to y and has two y values associated with most x values (x = 2 and x = -2, for instance, both give you y = 4).

Essentially, if we give a function some x value, we want to know exactly what y value we’re getting out of it.

The pictured table gives you two possible values for x = 2; given a 2 as input, we have no idea whether to go to 1 or 7 for our output, so it would not be a function from x to y.

(Interestingly, a function from y to x would satisfy that “one output per input” requirement, so if you wanted to impress your teacher, you could answer “yes, but only from y to x, NOT x to y”)

Cooper’s Storage and Shipping Company is working with a local business to package some office supplies. The supplies are packed inside a cube – shaped box with side lengths 4 ½ in. These boxes are then packed into a shipping box with dimensions of 18 in x 9 in x 4 ½ in. What is the volume of the cube – shaped box? Show your work. What is the volume of the shipping box? Show your work. How many boxes of office supplies can be packed into the larger box for shipping? Show your work.

Answers

Answer:

1. Volume of cube-shaped box = 91.125 cubic inches

2. Volume of shipping box = 729 cubic inches

3. 8 boxes of office supplies can be packed into the larger box for shipping.

Step-by-step explanation:

1.

The first question asks for the volume of a cube. The formula is  V = s^3, where, s is the side length and V is the volume. Thus plugging in, we get:

[tex]V=s^3\\V=(4\frac{1}{2})^3\\V=(4.5)^3\\V=91.125[/tex]

Volume of cube-shaped box = 91.125 cubic inches

2.

The second question asks for the volume of the shipping box. Since 3 measurements are given, the shipping box is a rectangular prism. The volume of a rectangular prism is  V = l * w * h, where

V is the volume

l is the length

w is the width, and

h is the height

Plugging in all the info we know (multiplying the 3 numbers - dimensions), we can get the volume of the shipping box. So:

[tex]V=lwh\\V=(18)(9)(4\frac{1}{2})\\V=(18)(9)(4.5)\\V=729[/tex]

Volume of shipping box = 729 cubic inches

3.

Since the volume of a single box of office supplies (cub-shape) is 91.125 cu. in., and the volume of larger shipping box is 729, we can divide 729 by 91.125 to find how many of them would fit the large box.

[tex]\frac{729}{91.125}=8[/tex]

Hence, 8 boxes of office supplies can be packed into the larger box for shipping.

Answer:

8

Step-by-step explanation:

4 1/2=9/2*9/2=81/4*9/2=729/8

9/1*9/2*18/1=1,458/2

1,458/2*8/729=11,664/1,458

=8

So eight boxs of office supplies can be packed.

Solve for t.
t ÷ 5 1/3 = 3/4

Answers

Answer:

t = 4

Step-by-step explanation:

To solve for t, convert the numbers to improper functions. Then multiply by 16/3 on each side.

t ÷ 5 1/3 = 3/4

t ÷ 16/3 = 3/4

t = 16/3 * 3/4

t = 48/12

t = 4

Other Questions
Why is kinetic energy a constant for a satellite in a circular orbit but not for a satellite in an elliptical orbit? What is the answer 7/6 + 13/6= Why is an independent judiciary a key element of a democracy? For the following question, find the value of the variable(s). If your answer is not an integer, leave it in simplest radical form. Please help!! The diameter of the planet mars is approximately 6.794 10^6 meters. Which is an equivalent way to express that measure?a- 6.794 billion metersb- 679.4 million metersc- 67.94 million metersd- 6.794 million meters What is the solution to the equation g/13=52A.4B.19C.650D.676 What is the difference between micro-evolution and macro-evolution? 1. Macro evolution is a change in the gene pool and micro evolution is the formation of a new species. 2. Micro evolution is the change in the gene pool and macro evolution is the formation of a new species. 3. There is no difference. 4. Micro evolution only happens in the Galapagos island and Marco evolution only happens in Trinidad. Please please help! What is the value of x? Factor completely.4p+36p+81Question 3 options:(2p9)2(2p+9)2(4p+6)2 RateMinutesMiles0053107151220172521The table shows how many miles Brandon has traveled after the specified period of time. Find Brandon's rate in miles per minute between 15 and 20 minutes. A)1 mile per minute B)5 miles per minute C)12 miles per minute D)17 miles per minute how did the U.S. government use propaganda during ww2 Read the excerpt from "Civil Peace" by Chinua Achebe.Jonathan Iwegbu counted himself extraordinarily lucky. "Happy survival! meant so much more to him than just a current fashion of greeting old friends in the first hazy days of peace. It went deep to his heart. He had come out of the war with five inestimable blessingshis head, his wife Marias head and the heads of three out of their four children. As a bonus he also had his old bicyclea miracle too but naturally not to be compared to the safety of five human heads.What can you most clearly determine about the storys setting from this excerpt?a. The story takes place right before a war.b. The story takes place in the middle of a war.c. The story takes place right after a war.d. The story takes place years before the start of a war. sara has 24 sweets tim also has 24 sweets sara gives tim x sweets sara then eats 7 of her sweets tim then eats half of his sweetswrite an expression for the number of sweets sara and tim have now Read the excerpt below and answer the question. The Dust Bowl years spanned 1930-1936, when a million acres of farmland across the Plains became unusable due to severe drought and over-farming. When Dust Bowl conditions devastated farmers, many defaulted on their bank loans, which helped lead to the widespread bank failure. Franklin D. Roosevelt called for restoration in America with a promise that there are better days ahead. What is the best definition you can infer for the word "restoration" from the excerpt above? bringing back to former position or condition re-establish monarchy replacement giving back Which of the following is not a typical type of weather data collected? Help me please. FUN AND EASY assignment!! please check it out!!!Imagine and create a character that lived and experienced the cold war!Part B 1. What was the first time you remember hearing about the Soviet Union (or the USSR) and its conflict with the United States? Tell me about it. 2. What do you remember seeing or reading in the news about the Cold War? 3. What books did you read or movies did you watch that villainized the Soviet Union or dealt with the Cold War? How did they shape your impressions at that time? 4. What were you taught in school and at home about the Soviet Union? What did your school and family teach about nuclear threats and nuclear war? 5. Were you or any of your family members ever afraid that there would be a hot war or nuclear war between the United States and the Soviet Union? When did you feel that way? If yes, did you do anything to prepare or get ready for it? 6. What aspects of the Space Race do you remember? Was "Space Race" a phrase that you remember using at the time? What did it mean to you? 7. How was the rivalry between the United States and the Soviet Union promoted in sports? Can you think of any specific examples? 8. Do you remember the Berlin Wall coming down? How did it make you feel? How have your feelings about that era changed since 1989 and the Berlin Wall coming down? 9. How do you think future generations will remember the Cold War? What lessons should students today take away from the Cold War? 10. How does psychological warfare today compare to psychological warfare during the Cold War? 11. Where you a participant of the cold war? 12. Do you think the cold war was necessary? What helps a literary critic determine a story's complex theme? A. The public's reaction to the story B. The number of characters in a story C. The order of events within the story D. The specific details within the story What is the best definition for a paragraph's topic sentence? a sentence that begins the paragraph a sentence that helps the reader to organize her thoughts a sentence that tells the reader what will be discussed a sentence that is the first sentence of the paragraph Which of the following is the best example of kinetic energy? A book sitting on a bookshelf A golfer preparing to putt the ball A race car in position at the start line A satellite orbiting the Earth Predict how many times you will roll a number less than 5 if you roll a standard number cube 250 times Steam Workshop Downloader